Fragrance Demo Formulas |
3-(1,3-benzodioxol-5-yl)-2-methylpropanal (Click)
IUPAC Name: 3-(1,3-benzodioxol-5-yl)-2-methylpropanal
Std.InChI: InChI=1S/C11H12O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-3,5-6,8H,4,7H2,1H3
InChI: InChI=1/C11H12O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-3,5-6,8H,4,7H2,1H3
Std.InChIKey: BOPPSUHPZARXTH-UHFFFAOYSA-N
InChIKey: BOPPSUHPZARXTH-UHFFFAOYAR
SMILES: CC(CC1=CC2=C(C=C1)OCO2)C=O
|
CAS Number: | 1205-17-0 |
|
ECHA EINECS - REACH Pre-Reg: | 214-881-6 |
FDA UNII: | L65EG8H6PA |
Nikkaji Web: | J217.049C |
MDL: | MFCD00067053 |
FEMA Number: | 4599 |
XlogP3: | 2.20 (est) |
Molecular Weight: | 192.21424000 |
Formula: | C11 H12 O3 |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | pale yellow to yellow clear oily liquid (est) |
Assay: | 97.00 to 100.00 %
|
Food Chemicals Codex Listed: | No |
Specific Gravity: | 1.15800 to 1.16600 @ 25.00 °C.
|
Pounds per Gallon - (est).: | 9.636 to 9.702
|
Specific Gravity: | 1.15900 to 1.16700 @ 20.00 °C.
|
Pounds per Gallon - est.: | 9.655 to 9.722
|
Refractive Index: | 1.53100 to 1.53600 @ 20.00 °C.
|
Boiling Point: | 282.00 to 284.00 °C. @ 760.00 mm Hg
|
Acid Value: | 5.00 max. KOH/g
|
Vapor Pressure: | 0.002700 mm/Hg @ 25.00 °C. (est) |
Flash Point: | > 200.00 °F. TCC ( > 93.33 °C. )
|
logP (o/w): | 1.368 |
Shelf Life: | 24.00 month(s) or longer if stored properly. |
Storage: | store in cool, dry place in tightly sealed containers, protected from heat and light. store under nitrogen. |
Storage: | store under nitrogen. |
Soluble in: |
| alcohol | | water, 342.6 mg/L @ 25 °C (est) |
Stability: |
| alcoholic lotion | | antiperspirant | | deo stick | | detergent | | fabric softener | | hard surface cleaner | | shampoo | | soap |
Organoleptic Properties:
Odor Type: | floral |
Odor Strength: | medium |
Odor Description: at 100.00 %. | watery fresh green ozone cyclamen hay |
Substantivity: | 64 Hour(s) |
| |
Cosmetic Information:
Safety Information:
Most important hazard(s): | Xi N - Irritant, Dangerous for the environment. |
|
R 36/38 - Irritating to skin and eyes. R 51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet.
|
Oral/Parenteral Toxicity: | |
oral-rat LD50 3600 mg/kg
|
Dermal Toxicity: | |
skin-rabbit LD50 > 2000 mg/kg
|
Inhalation Toxicity: | |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
IFRA Critical Effect: | Sensitization |
IFRA: | View Standard |
Fragrance usage is IFRA RESTRICTED. View Standard for complete information. |
Please review all IFRA documents for complete information. |
IFRA categories: limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) |
Category 1: See Note (1) | 0.34 % (1) |
Category 2: | 0.43 % |
Category 3: | 1.78 % |
Category 4: | 5.30 % |
Category 5: | 2.80 % |
Category 6: | 8.60 % (1) |
Category 7: | 0.89 % |
Category 8: | 2.00 % |
Category 9: | 5.00 % |
Category 10: | 2.50 % |
Category 11: | See Note (2) |
| Notes: |
| (1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). |
| (2) Category 11 includes all non-skin contact or incidental skin contact products. Due to the negligible skin contact from these types of products there is no justification for a restriction of the concentration of this fragrance ingredient in the finished product. |
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 24 |
Click here to view publication 24 |
| average usual ppm | average maximum ppm |
baked goods: | 2.00000 | 4.00000 |
beverages(nonalcoholic): | 10.00000 | 50.00000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | 100.00000 | 500.00000 |
condiments / relishes: | - | - |
confectionery froastings: | 10.00000 | 100.00000 |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | - |
fruit ices: | - | - |
gelatins / puddings: | 10.00000 | 50.00000 |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | 1.00000 | 4.00000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | 1.00000 | 3.00000 |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | 1.00000 | 2.00000 |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
| satinaldehyde | FL/FR |
aldehydic |
| adoxal (Givaudan) | FL/FR |
iso | butyraldehyde | FL/FR |
| citronellyl oxyacetaldehyde | FL/FR |
| citrus carbaldehyde | FR |
| decanal (aldehyde C-10) | FL/FR |
6,7,8- | decen-1-ol | FR |
9- | decenal | FL/FR |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
| fresh carbaldehyde | FR |
| geranyl oxyacetaldehyde | FR |
| lily pentanal | FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
3- | methyl-4-hexyl oxybutyraldehyde | FR |
| muguet undecadienal | FR |
| nonanal (aldehyde C-9) | FL/FR |
| pinoacetaldehyde | FR |
| tridecanal | FL/FR |
| undecanal | FL/FR |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
alliaceous |
| methyl furfuryl disulfide | FL/FR |
amber |
| amber carane | FR |
| ambergris naphthol | FR |
| ambroxan | FL/FR |
| formoxymethyl isolongifolene | FR |
animal |
| animal carbolactone | FR |
| animal carbolactone | FR |
| costus valerolactone | FR |
| methyl (E)-2-octenoate | FL/FR |
anisic |
para- | anisyl propanal | FR |
| methyl para-anisate | FL/FR |
aromatic |
| damascone carboxylate | FR |
balsamic |
| amyris wood oil | FL/FR |
siam | benzoin resinoid | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl cinnamate | FL/FR |
| benzyl salicylate | FL/FR |
iso | butyl cinnamate | FL/FR |
| cinnamyl alcohol | FL/FR |
| cinnamyl formate | FL/FR |
| clover nitrile | FR |
| ethyl cinnamate | FL/FR |
| fir needle oil siberia | FL/FR |
| geranyl benzoate | FL/FR |
| linalyl cinnamate | FL/FR |
| methyl cinnamate | FL/FR |
| octyl cinnamate | FR |
3- | phenyl propyl cinnamate | FL/FR |
iso | propyl cinnamate | FL/FR |
| terpinyl cinnamate | FL/FR |
berry |
| raspberry ketone acetate | FL/FR |
| raspberry ketone methyl ether | FL/FR |
buttery |
| acetyl isobutyryl | FL/FR |
caramellic |
| maltyl isobutyrate | FL/FR |
chocolate |
| cocoa pentenal | FL/FR |
2- | methoxy-3-methyl pyrazine | FL/FR |
citrus |
| benzyl anthranilate | FR |
| bergamot oil | FL/FR |
| bergamot oil bergaptene reduced italy | FL/FR |
| bergamot oil turkey | FL/FR |
| citral | FL/FR |
| citral dimethyl acetal | FL/FR |
| citrus floral green fragrance | FR |
| citrus specialty | FR |
| dihydromyrcenol | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanyl acetate | FR |
| grapefruit pentanol | FR |
| lime pyran | FR |
| limonene aldehyde | FR |
| marine decadienal | FR |
| myrmac aldehyde | FR |
| nonanal dimethyl acetal | FL/FR |
| orange nitrile | FR |
blood | orange oil italy | FL/FR |
sweet | orange peel oil c.p. brazil | FL/FR |
beta- | sinensal | FL/FR |
(E)-2- | tetradecenal | FL/FR |
2- | tetradecenal | FL/FR |
| tetrahydrocitral | FL/FR |
10- | undecen-1-ol | FL/FR |
| waxy nitrile | FR |
clean |
| clean nitrile | FR |
| undecyl acetate | FL/FR |
coconut |
delta-2- | dodecenolactone | FL/FR |
delta- | nonalactone | FL/FR |
delta- | undecalactone | FL/FR |
creamy |
| creamy lactone | FL/FR |
3- | heptyl dihydro-5-methyl-2(3H)-furanone | FL/FR |
| waxy lactone | FL/FR |
earthy |
| bean pyrazine | FL/FR |
| geosmin | FL/FR |
2- | octanone oxime | |
fatty |
(Z)- | dairy lactone | FL/FR |
| decanol | FL/FR |
(E)-2- | decen-1-ol | FL/FR |
2- | decen-1-ol | FL/FR |
2- | decenal | FL/FR |
(E,Z)-2,6- | dodecadienal | FL/FR |
| methyl (E)-2-hexenoate | FL/FR |
5- | methyl-5-hexen-2-one | FL/FR |
(E)-2- | nonenal | FL/FR |
(Z)-2- | nonenal | CS |
2- | nonenal | FL/FR |
(E)-2- | octenal | FL/FR |
fermented |
iso | butyl decanoate | FL/FR |
3- | methyl-1-pentanol | FL/FR |
floral |
| acetaldehyde dibutyl acetal | FL/FR |
| amyl benzoate | FL/FR |
alpha- | amyl cinnamaldehyde diethyl acetal | FR |
| amyl salicylate | FL/FR |
iso | amyl salicylate | FL/FR |
iso | amyl undecylenate | FL/FR |
| anisyl propanal / methyl anthranilate schiff's base | FR |
| autumn carboxylate | FR |
| bois de rose oil brazil | FL/FR |
| boronia butenal | FR |
| boronia concrete | FL/FR |
alpha- | butyl cinnamaldehyde | FL/FR |
| cassie concrete | FR |
| cassis buteneone | FR |
| cassis cyclohexene | FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| citronellyl hexanoate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
(E)- | citronellyl tiglate | FL/FR |
| coriander seed oil | FL/FR |
| coriander seed oil CO2 extract | FL/FR |
| cumin carbinol | FR |
| cyclamen aldehyde | FL/FR |
| cyclamen homoaldehyde | FR |
| cyclamen propanal | FR |
| cyclohexyl ethyl acetate | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
4-(1- | cyclopenten-1-yl)-1-butanol | |
beta- | damascenone | FL/FR |
delta- | damascone | FL/FR |
alpha- | damascone | FL/FR |
9- | decen-1-ol | FL/FR |
| decyl anthranilate | FR |
| decyl formate | FR |
| dewy propionate | FR |
| dictamnus hispanicus oil | FR |
| dihydro-alpha-ionone | FL/FR |
| dihydrocarvyl acetate | FL/FR |
(±)-2,3- | dihydrofarnesol | FL/FR |
| dihydroisojasmonate methyl ester | FR |
| dihydrojasmone | FL/FR |
| dihydrolinalool | FL/FR |
| dihydrorose oxide | FR |
| dimethyl alpha-ionone | FR |
| dimethyl anthranilate | FL/FR |
| dimethyl benzyl carbinol | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
| dimethyl benzyl carbinyl propionate | FR |
6,8- | dimethyl-2-nonanol | FR |
| ethyl anthranilate | FL/FR |
| ethyl ethyl anthranilate | FL/FR |
| ethyl ortho-anisate | FL/FR |
| ethyl phenoxyacetate | FR |
| ethyl safranate | FR |
| farnesol | FL/FR |
| farnesyl acetate | FL/FR |
| floral butanal | FR |
| floral pyran | FR |
| floral pyranol | FR |
| floral undecenone | FR |
| gardenia absolute | FR |
| gardenia acetal | FR |
| gardenia concrete | FR |
| gardenia oxide | FR |
| geraniol | FL/FR |
| geranium oil | FL/FR |
| geranium oil africa | FL/FR |
| geranyl acetate | FL/FR |
| geranyl acetone | FL/FR |
| geranyl formate | FL/FR |
| geranyl hexanoate | FL/FR |
| geranyl nonanoate | CS |
| geranyl phenyl acetate | FL/FR |
| hawthorn ethanol | FR |
| heliotropyl acetate | FL/FR |
| heliotropyl acetone | FL/FR |
| heliotropyl diethyl acetal | FR |
(Z)-4- | hepten-2-yl salicylate | FR |
| hexahydrofarnesyl acetone | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
| hexyl 2-furoate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hexyl lactate | FL/FR |
2- | hexylidene cyclopentanone | FL/FR |
| ho leaf oil | FR |
| hyacinth ether | FR |
| hyacinth oil | FR |
| hydrangea fragrance | FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal diethyl acetal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
| hydroxycitronellal propylene glycol acetal | FL/FR |
| hydroxycitronellol | FL/FR |
alpha- | ionol | FL/FR |
alpha- | ionone | FL/FR |
beta- | ionone | FL/FR |
alpha- | irone | FL/FR |
| jasimia | FR |
| jasmin acetate | FL/FR |
| jasmin cyclopentanol | FR |
| jasmin cyclopentanone | FR |
(Z)- | jasmone | FL/FR |
iso | jasmone | FL/FR |
| jonquil absolute | FR |
| lavandulol | FR |
| leerall | FR |
| lilac absolute | FR |
| lily fragrance | FR |
| lily propanol | FR |
laevo- | linalool | FL/FR |
| linalool | FL/FR |
| linalool oxide | FL/FR |
| linalyl phenyl acetate | FL/FR |
| lotus fragrance | FR |
| magnolia cyclohexanol | FR |
| magnolia indene | FR |
(2- | methoxy-1-methyl propyl) benzene | FR |
(3- | methoxy-2-methyl propyl) benzene | FR |
| methoxycitronellal | FR |
| methoxymelonal | FL/FR |
1-(2- | methyl allyl oxy)-2-methyl butane | FR |
| methyl dihydrojasmonate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| methyl ionyl acetate | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
| muguet butanal | FR |
| muguet butanol | FR |
| muguet carbaldehyde | FR |
| muguet carbinol | FL/FR |
| muguet carboxaldehyde | FR |
| muguet ethanol | FR |
| muguet nitrile | FR |
| muguet octadienol | FR |
| muguet propanol | FR |
| muguet shiseol | FL/FR |
| nerol | FL/FR |
| neroli oil CO2 extract | FL/FR |
| nerolidol | FL/FR |
(E)- | nerolidol | FL/FR |
| neryl acetate | FL/FR |
| neryl formate | FL/FR |
| nonanol | FL/FR |
3- | nonanone | FL/FR |
(S)- | ocean propanal | |
(R)- | ocean propanal | |
| ocean propanal / methyl anthranilate schiff's base | FR |
allo | ocimene | FL/FR |
| octahydro-4,7-methano-1H-indene-5-acetaldehyde + 6-methyl-octahydro-4,7-methano-indene-5-carbaldehyd | FR |
| orange leaf absolute | FL/FR |
bitter | orangeflower absolute tunisia | FL/FR |
| orchid specialty | FR |
| orris butenone | FR |
| orris pyridine 25% IPM | FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| papaya isobutyrate | FL/FR |
| peony alcohol | FR |
clementine | petitgrain oil | FL/FR |
| petitgrain oil paraguay | FL/FR |
| phenethyl acetate | FL/FR |
| phenethyl anthranilate | FL/FR |
| phenethyl butyrate | FL/FR |
| phenethyl heptanoate | FL/FR |
| phenethyl pivalate | FL/FR |
| phenethyl salicylate | FL/FR |
| phenyl acetaldehyde dicitronellyl acetal | FR |
| phenyl acetaldehyde diisobutyl acetal | FL/FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
2- | phenyl propionaldehyde ethylene glycol acetal | FR |
2- | phenyl propyl isobutyrate | FL/FR |
(E)-2- | phenyl-1(2)-propene-1-yl acetate | FR |
4- | phenyl-2-butanol | FL/FR |
iso | phytol | FL/FR |
(Z,E)- | phytol | FL/FR |
| propyl salicylate | FR |
| rhodinol | FL/FR |
| rhodinyl formate | FL/FR |
| rose absolute pentanol | FR |
| rose blossom pentanol | FR |
| rose butanoate | FL/FR |
| rose carbonate | FR |
| rose carboxylate | FR |
(Z)- | rose oxide | FL/FR |
laevo- | rose oxide | FL/FR |
| rose petal acetate | FR |
| rose pyran | FR |
| rose undecene | FR |
| styralyl formate | FL/FR |
| sweet pea absolute | FR |
| tagetes erecta flower oleoresin | |
alpha- | terpinyl anthranilate | FL/FR |
| terpinyl isobutyrate | FL/FR |
| tetrahydroionol | FR |
| tetrahydroionyl acetate | FR |
| tetrahydrolinalool | FL/FR |
| tetrahydrolinalyl acetate | FR |
5- | tricyclodecenyl acetate | FR |
(S,E)-3,7,11- | trimethyldodeca-6,10-dienal | FR |
| tuberolide | FL/FR |
2- | undecen-1-ol | FL/FR |
| verdyl acetate | FR |
| violet methyl carbonate | FR |
| ylang ylang flower oil III | FL/FR |
fresh |
| decyl methyl ether | FR |
| decyl vinyl ether | FR |
3-(3- | propen-2-yl phenyl) butanal | FR |
fruity |
| acetyl methyl anthranilate | FL/FR |
| allyl 2-ethyl butyrate | FL/FR |
| allyl amyl glycolate | FR |
| allyl cyclohexyl propionate | FL/FR |
iso | amyl hexanoate | FL/FR |
| amyl hexanoate | FL/FR |
iso | amyl nonanoate | FL/FR |
iso | amyl octanoate | FL/FR |
para- | anisyl propionate | FL/FR |
| apricot isobutyrate | FR |
| benzyl methyl ether | FL/FR |
| berry hexanoate | FR |
| berry pentadienoate | FL/FR |
| bread thiophene | FL/FR |
iso | butyl anthranilate | FL/FR |
| cherry oxyacetate | FL/FR |
| cherry propanol | FL/FR |
| citronellyl isobutyrate | FL/FR |
| cyclohexyl crotonate | FR |
beta- | damascone | FL/FR |
gamma- | decalactone | FL/FR |
| decyl butyrate | FL/FR |
| diethyl sebacate | FL/FR |
| dihydroactinidolide | FL/FR |
| dimethyl benzyl carbinyl isobutyrate | FR |
| dimethyl succinate | FL/FR |
epsilon- | dodecalactone | FL/FR |
| ethyl 3-acetoxyhexanoate | FL/FR |
2- | ethyl butyl 2-butenoate | |
| ethyl heptanoate | FL/FR |
| ethyl methyl anthranilate | FL/FR |
| ethyl methyl-para-tolyl glycidate | FL/FR |
| farnesyl acetone | FL/FR |
| fig crotonate | FR |
| fleuramone (IFF) | FR |
| fruity carboxylate | FR |
| fruity ketal | FL/FR |
| green acetate | FR |
(Z)-3- | hexen-1-yl anthranilate | FL/FR |
2- | hexenyl cyclopentanyl acetate | FR |
beta- | ionone epoxide | FL/FR |
| linalyl hexanoate | FL/FR |
| methyl (Z)-5-octenoate | FL/FR |
| methyl anthranilate | FL/FR |
2- | methyl butyl isovalerate | FL/FR |
| methyl formyl anthranilate | FL/FR |
| octen-1-yl cyclopentanone | FL/FR |
(Z)-3- | octen-1-yl propionate | FL/FR |
| octyl propionate | FL/FR |
| peach cyclopentanone | FR |
| peach nitrile | FR |
| peach pivalate | FR |
| pear valerate | FR |
2- | pentyl furan | FL/FR |
| plum crotonate | FR |
| plum damascone (high alpha) | FR |
| propyl 2,4-decadienoate | FL/FR |
| propyl heptanoate | FL/FR |
| propyl hexanoate | FL/FR |
iso | propyl hexanoate | FL/FR |
iso | propyl octanoate | FL/FR |
| prune glycidate | FR |
| rhubarb pyran | FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| strawberry glycidate 2 | FL/FR |
4-(para- | tolyl)-2-butanone | FL/FR |
| tropical indene | FR |
| tropical ionone | FL/FR |
| tropical thiazole | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| vanilla carboxylate | FL/FR |
fungal |
| jasmin nonane | FR |
| methyl 2-furoate | FL/FR |
green |
iso | amyl 3-(2-furan) propionate | FL/FR |
| benzyl hexanoate | FL/FR |
iso | butyl benzyl carbinol | FL/FR |
| butyl heptanoate | FL/FR |
2-iso | butyl thiazole | FL/FR |
2-sec- | butyl thiazole | FL/FR |
| chrysanthemum oxide | FL/FR |
| coriander heptenol | FL/FR |
| cumin acetaldehyde | FL/FR |
3,5,6-neo | cyclocitral | FR |
iso | cyclocitral (IFF) | FL/FR |
2- | cyclohexyl propionaldehyde | FR |
3,7- | dimethyl-6-octenoic acid | FL/FR |
| diphenyl oxide | FL/FR |
| earthy acetal | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| ethylene glycol diacetate | |
2- | ethylidene-6-methyl-cis-3-heptenal | |
| flower hexene | FR |
| fresh nitrile | FR |
| galbanum oil | FL/FR |
| green carbaldehyde | FR |
| green carboxylate | FR |
| green cyclopropionate | FR |
| green ether | FL/FR |
| green heptenal | FR |
iso | green methanoindene | FR |
(Z)-4- | hepten-1-ol | FL/FR |
(Z)-3- | hepten-1-ol | FL/FR |
| heptyl benzoate | FL/FR |
| heptyl heptanoate | FL/FR |
| heptyl hexanoate | FL/FR |
2- | heptyl pyridine | |
2- | heptyl tetrahydrofuran | FR |
(Z)-4- | hexen-1-ol | FL/FR |
(Z)-3- | hexen-1-ol | FL/FR |
(Z)-3- | hexen-1-yl 2-methyl butyrate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl acetoacetate | FL/FR |
(Z)-3- | hexen-1-yl angelate | FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(Z)-3- | hexen-1-yl butyrate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl lactate | FL/FR |
(Z)-3- | hexen-1-yl methyl carbonate | FL/FR |
(Z)-3- | hexen-1-yl octanoate | FL/FR |
(Z)-3- | hexen-1-yl oxyacetaldehyde | FR |
| hexen-1-yl oxypropane nitrile | FR |
(Z)-3- | hexen-1-yl phenyl acetate | FL/FR |
(Z)-3- | hexen-1-yl propionate | FL/FR |
(Z)-3- | hexen-1-yl pyruvate | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
(Z)-3- | hexen-1-yl valerate | FL/FR |
| hexyl (Z)-tiglate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| hexyl heptanoate | FL/FR |
| hexyl hexanoate | FL/FR |
| hexyl octanoate | FL/FR |
| hexyl phenyl acetate | FL/FR |
| hexyl tiglate | FL/FR |
| hyacinth absolute | FL/FR |
| ivy carbaldehyde | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
3,5- | ivy carbaldehyde | FL/FR |
3,6- | ivy carbaldehyde | FL/FR |
2,4- | ivy carbaldehyde / methyl anthranilate schiff's base | FR |
| ivy dioxolane | FR |
(Z)- | leaf acetal | FL/FR |
| leafy oxime | FR |
| lilac acetaldehyde | FL/FR |
| manzanate (Givaudan) | FL/FR |
| melon acetal | FL/FR |
| melon heptenal propylene glycol acetal | FL/FR |
| melon nonenoate | FL/FR |
(2- | methoxy-1-methyl butyl) benzene | FR |
[(4E,4Z)-5- | methoxy-3-methyl-4-penten-1-yl] benzene | FR |
| methyl cyclocitrone (IFF) | FR |
| methyl heptine carbonate | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
| methyl octine carbonate | FL/FR |
4- | methyl-4-phenyl pentanone | FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
(Z,Z)-3,6- | nonadien-1-ol | FL/FR |
(E,Z)-2,6- | nonadien-1-ol | FL/FR |
3,6- | nonadien-1-ol | FL/FR |
(E,Z)-3,6- | nonadien-1-yl acetate | FL/FR |
3,6- | nonadien-1-yl acetate | FL/FR |
(E,Z)-2,6- | nonadienal | FL/FR |
2- | nonanone oxime | |
(Z)-2- | nonen-1-ol | FL/FR |
(E)-2- | nonen-1-ol | FL/FR |
2- | nonyn-1-al dimethyl acetal | FR |
1-( | octahydro-4,7-methanoinden-5-yl)-propan-2-ol | |
(Z)-5- | octen-1-ol | FL/FR |
(E)-2- | octen-1-yl acetate | FL/FR |
(Z)-5- | octen-1-yl propionate | FL/FR |
| octyl oxyacetaldehyde | FR |
| olive oil absolute | FL/FR |
| pelargonium graveolens stem leaf extract | FR |
| phenethyl tiglate | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
| phenyl acetaldehyde solution | FL/FR |
3- | phenyl propionaldehyde | FL/FR |
2- | propenyl-para-cymene | FR |
iso | propyl phenyl propionaldehyde | FR |
4-iso | propyl quinoline | FL/FR |
iso | propyl quinoline | FR |
| styralyl acetate | FL/FR |
| violet decenol | FR |
| violet dienyne | FR |
| violet leaf absolute | FL/FR |
| violet nitrile | FR |
hay |
| beeswax absolute | FL/FR |
iso | amyl heptanoate | FL/FR |
| anethum graveolens herb oil | FL/FR |
| benzyl octanoate | FL/FR |
(S)- | campholene acetate | FL/FR |
| carum carvi fruit oil | FL/FR |
| celery ketone | FL/FR |
| chrysanthemum ketone | FR |
| clary sage absolute | FL/FR |
| clary sage oil france | FL/FR |
white | cognac oil | FL/FR |
| coriander oleoresin | FL/FR |
| daucus carota fruit oil | FL/FR |
| dihexyl (E)-fumarate | FR |
| dimethyl cyclormol (IFF) | FR |
| ethyl chrysanthemate | FR |
| floral nitrile | FR |
| freesia heptanol | FL/FR |
| geranyl octanoate | FL/FR |
| herbal acetal | FR |
| herbal carbonate | FR |
| juniper carboxaldehyde | FR |
| linalyl acetate | FL/FR |
| linalyl octanoate | FL/FR |
2- | methyl butyl salicylate | FL/FR |
2- | methyl-3-buten-2-ol | FL/FR |
(1S,5R)- | myrtenyl acetate | FL/FR |
| ocimene oxirane | FR |
3- | octanone | FL/FR |
| phenethyl senecioate | FL/FR |
| phenyl acetaldehyde diisoamyl acetal | FR |
| reseda absolute | FR |
| saffron indenone | FL/FR |
| theaspirane | FL/FR |
honey |
| methyl hydrocinnamate | FL/FR |
| phenethyl furoate | FL/FR |
| propyl phenyl acetate | FL/FR |
leathery |
| leather cyclohexanol | FR |
marine |
green | algae absolute | FL/FR |
| marine carbonitrile | FR |
| marine hexane | FR |
| marine pyridine | FR |
| ocean carboxaldehyde | FR |
| ozone propanal | FR |
medicinal |
| kunzea ericoides leaf oil | FR |
melon |
| melon carboxaldehyde | FR |
| melon heptenal | FL/FR |
(Z)-6- | nonen-1-ol | FL/FR |
(Z)-6- | nonen-1-yl acetate | FL/FR |
(Z)-6- | nonenal | FL/FR |
| watermelon ketone | FR |
minty |
| diosphenol | FL/FR |
iso | propyl tiglate | FL/FR |
iso | pulegyl formate | FL/FR |
mossy |
| oakmoss absolute | FL/FR |
| oakmoss phenol | FR |
| sea resorcylate | FR |
mushroom |
1- | octen-3-yl butyrate | FL/FR |
musk |
iso | ambrettolide | FL/FR |
| dehydro beta-linalool | FL/FR |
| musk indanone | FR |
| musk tetralin | FR |
omega- | pentadecalactone | FL/FR |
musty |
ketoiso | phorone | FL/FR |
| strawberry furanone methyl ether | FL/FR |
naphthyl |
beta- | naphthyl ethyl ether | FL/FR |
nutty |
2- | acetyl-3,5(or 6)-dimethyl pyrazine | FL/FR |
3,6- | cocoa pyrazine | FL/FR |
2- | ethyl-4-methyl thiazole | FL/FR |
2- | methyl-3-ethoxypyrazine | FL/FR |
orris |
| orris capronate | FL/FR |
powdery |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
| dimethyl ionone | FR |
spicy |
| cinnamyl isovalerate | FL/FR |
| cinnamyl propionate | FL/FR |
| clove bud oil | FL/FR |
| cuminaldehyde | FL/FR |
| cuminyl nitrile | FR |
black | currant bud absolute | FL/FR |
iso | cyclogeraniol (IFF) | FR |
iso | eugenyl acetate | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
2- | octanol | FL/FR |
| pepper hexanone | FR |
black | pepper oil | FL/FR |
| pimenta acris leaf oil | FL/FR |
| spicy carbonate | FR |
sulfurous |
| blackberry thiophenone | FL/FR |
| buchu mercaptan | FL/FR |
| cassis pentanone | FL/FR |
| ethyl 2-mercaptopropionate | FL/FR |
| ethyl methyl mercaptopropionate | FL/FR |
| grapefruit menthane | FL/FR |
| mango thiol | FL/FR |
3-( | methyl thio) hexanol | FL/FR |
tea |
| camellia oleifera leaf extract | FL/FR |
terpenic |
| frankincense oil | FL/FR |
alpha- | terpineol | FL/FR |
tobacco |
3- | ethyl pyridine | FL/FR |
(E,E/E,Z)- | tobacco cyclohexenone | FL/FR |
tonka |
| whiskey lactone | FL/FR |
tropical |
beta- | cyclocitral | FL/FR |
delta- | dodecalactone | FL/FR |
cis- | galbanum oxathiane | FL/FR |
| genet absolute | FL/FR |
| glyceryl 5-hydroxydecanoate | FL/FR |
| glyceryl 5-hydroxydodecanoate | FL/FR |
| hexyl 2-methyl-3-pentenoate | FL/FR |
| hotrienol | FL/FR |
| tropical 3-thiobutyrate | FL/FR |
2- | tropical oxathiane | FL/FR |
vegetable |
| methional | FL/FR |
waxy |
iso | amyl laurate | FL/FR |
| decanal diethyl acetal | FL/FR |
| decanal dimethyl acetal | FL/FR |
3- | decanone | FL/FR |
(Z)-4- | decen-1-ol | FL/FR |
| decyl acetate | FL/FR |
1- | dodecanol | FL/FR |
| dodecyl acetate | FL/FR |
| ethyl laurate | FL/FR |
| ethyl myristate | FL/FR |
| ethyl nonanoate | FL/FR |
| heptyl octanoate | FL/FR |
(E)- | methyl geranate | FL/FR |
2,4- | nonadien-1-ol | FL/FR |
(Z)-3- | nonen-1-ol | FL/FR |
(E)-2- | octen-1-yl butyrate | FL/FR |
| octyl isobutyrate | FL/FR |
| phenethyl octanoate | FL/FR |
| phytyl acetate | FL/FR |
1- | undecanol | FL/FR |
2- | undecanol | FL/FR |
| waxy undecadienol | FR |
woody |
| amber carbinol | FR |
| amber decatriene | FR |
| amber formate | FR |
| cedrol | FL/FR |
| dihydro-beta-ionol | FL/FR |
| methyl cedryl ketone | FL/FR |
| patchouli ethanone | FR |
| patchouli hexanol | FR |
| patchouli oil | FL/FR |
| polylimonene | FL/FR |
| sandal pentenone | FR |
| santall | FR |
| timber propanol | FR |
| woody acetate | FR |
(Z)- | woody amylene | FR |
| woody carboxylate | FR |
| woody dioxolane | FR |
| woody epoxide | FR |
| woody ether | FR |
| woody heptene | FR |
| woody nonane (ethoxy) | FR |
|
For Flavor |
|
No flavor group found for these |
| acetaldehyde dibutyl acetal | FL/FR |
green | algae absolute | FL/FR |
iso | amyl 3-methyl thiopropionate | FL |
| amyl benzoate | FL/FR |
iso | amyl undecylenate | FL/FR |
para- | anisyl propionate | FL/FR |
| bean pyrazine | FL/FR |
| benzyl hexanoate | FL/FR |
| benzyl octanoate | FL/FR |
| blackberry thiophenone | FL/FR |
| boronia concrete | FL/FR |
iso | butyl decanoate | FL/FR |
2-sec- | butyl thiazole | FL/FR |
2(4)-iso | butyl-4(2),6-dimethyl dihydro-4H-1,3,5-dithiazine | FL |
2-(2- | butyl)-4,5-dimethyl-3-thiazoline | FL |
| coriander heptenol | FL/FR |
4-(1- | cyclopenten-1-yl)-1-butanol | |
| decanal dimethyl acetal | FL/FR |
3- | decanone | FL/FR |
(Z)-4- | decen-1-ol | FL/FR |
(E)-2- | decen-1-ol | FL/FR |
9- | decenal | FL/FR |
2- | decyl furan | FL |
| dehydro beta-linalool | FL/FR |
2,5- | diethyl tetrahydrofuran | FL |
| dihydro-beta-ionol | FL/FR |
| dihydroactinidolide | FL/FR |
(±)-2,3- | dihydrofarnesol | FL/FR |
| diosphenol | FL/FR |
epsilon- | dodecalactone | FL/FR |
delta-2- | dodecenolactone | FL/FR |
| earthy acetal | FL/FR |
| epoxy-2-decenal | FL |
| ethyl 2-(methyl dithio) propionate | FL |
| ethyl 3-acetoxyhexanoate | FL/FR |
| ethyl 3-octenoate | FL |
2- | ethyl butyl 2-butenoate | |
| ethyl ethyl anthranilate | FL/FR |
| ethyl methyl anthranilate | FL/FR |
| ethyl ortho-anisate | FL/FR |
2- | ethyl-4,5-dimethyl oxazole | FL |
| ethylene glycol diacetate | |
2- | ethylidene-6-methyl-cis-3-heptenal | |
| farnesyl acetone | FL/FR |
| furfuryl heptanoate | FL |
| geranyl benzoate | FL/FR |
| geranyl octanoate | FL/FR |
| green pea pyrazine | FL |
(Z)-3- | hepten-1-ol | FL/FR |
| heptyl benzoate | FL/FR |
| heptyl hexanoate | FL/FR |
2- | heptyl pyridine | |
(Z)-3- | hexen-1-yl acetoacetate | FL/FR |
| hexyl (Z)-tiglate | FL/FR |
| hexyl heptanoate | FL/FR |
2- | hexylidene cyclopentanone | FL/FR |
| hyacinth absolute | FL/FR |
| hydroxycitronellal propylene glycol acetal | FL/FR |
beta- | ionone epoxide | FL/FR |
3,5- | ivy carbaldehyde | FL/FR |
| ivy carbaldehyde | FL/FR |
| linalyl hexanoate | FL/FR |
| linalyl phenyl acetate | FL/FR |
| mango furanone | FL |
| melon heptenal propylene glycol acetal | FL/FR |
| menthyl propylene glycol carbonate | FL |
| methyl (E)-2-hexenoate | FL/FR |
2- | methyl butyl salicylate | FL/FR |
| methyl formyl anthranilate | FL/FR |
(E)- | methyl geranate | FL/FR |
| methyl hydrocinnamate | FL/FR |
| methyl para-anisate | FL/FR |
2- | methyl-3-buten-2-ol | FL/FR |
2- | methyl-3-ethoxypyrazine | FL/FR |
2- | nonanone oxime | |
2,4,6- | nonatrienal | FL |
(R)- | ocean propanal | |
(S)- | ocean propanal | |
1-( | octahydro-4,7-methanoinden-5-yl)-propan-2-ol | |
2- | octanone oxime | |
(E)-2- | octen-1-yl butyrate | FL/FR |
| phenethyl furoate | FL/FR |
| phenethyl heptanoate | FL/FR |
| phenethyl pivalate | FL/FR |
| phenethyl senecioate | FL/FR |
| phenyl acetaldehyde solution | FL/FR |
2- | phenyl propyl isobutyrate | FL/FR |
| phytyl acetate | FL/FR |
| polylimonene | FL/FR |
iso | propyl hexanoate | FL/FR |
4-iso | propyl quinoline | FL/FR |
iso | pulegyl formate | FL/FR |
beta- | sinensal | FL/FR |
| styralyl formate | FL/FR |
| tagetes erecta flower oleoresin | |
alpha- | terpinyl anthranilate | FL/FR |
| terpinyl isobutyrate | FL/FR |
2- | tetradecenal | FL/FR |
| tetrahydrocitral | FL/FR |
(R)- | tonka furanone | FL |
2- | tropical oxathiane | FL/FR |
2- | undecen-1-ol | FL/FR |
10- | undecen-1-ol | FL/FR |
| undecyl acetate | FL/FR |
|
iso | amyl 3-(2-furan) propionate | FL/FR |
alpha- | butyl cinnamaldehyde | FL/FR |
beta- | damascone | FL/FR |
aldehydic |
iso | butyraldehyde | FL/FR |
| nonanal (aldehyde C-9) | FL/FR |
1- | undecanol | FL/FR |
alliaceous |
| tropical thiazole | FL/FR |
amber |
iso | butyl benzyl carbinol | FL/FR |
apple |
(E,Z)-2,6- | nonadien-1-ol | FL/FR |
aromatic |
| amyl salicylate | FL/FR |
balsamic |
siam | benzoin resinoid | FL/FR |
| benzyl benzoate | FL/FR |
| benzyl salicylate | FL/FR |
iso | butyl cinnamate | FL/FR |
| ethyl cinnamate | FL/FR |
| fir needle oil siberia | FL/FR |
(Z,E)- | phytol | FL/FR |
iso | propyl cinnamate | FL/FR |
berry |
| dihydro-alpha-ionone | FL/FR |
| heliotropyl acetone | FL/FR |
| raspberry ketone acetate | FL/FR |
| raspberry ketone methyl ether | FL/FR |
brown |
| beeswax absolute | FL/FR |
burnt |
| bacon dithiazine | FL |
caramellic |
3- | ethyl pyridine | FL/FR |
| methyl 2-furoate | FL/FR |
chocolate |
| cocoa propanal | FL |
citrus |
| bergamot oil | FL/FR |
| bergamot oil bergaptene reduced italy | FL/FR |
| bergamot oil turkey | FL/FR |
| citral | FL/FR |
| citral dimethyl acetal | FL/FR |
| citronellyl oxyacetaldehyde | FL/FR |
| freesia heptanol | FL/FR |
| linalool | FL/FR |
laevo- | linalool | FL/FR |
| nerol | FL/FR |
allo | ocimene | FL/FR |
blood | orange oil italy | FL/FR |
sweet | orange peel oil c.p. brazil | FL/FR |
clementine | petitgrain oil | FL/FR |
| petitgrain oil paraguay | FL/FR |
ketoiso | phorone | FL/FR |
alpha- | terpineol | FL/FR |
coconut |
| butyl heptanoate | FL/FR |
coffee |
2- | ethyl-4-methyl thiazole | FL/FR |
| methyl furfuryl disulfide | FL/FR |
cooling |
| manzanate (Givaudan) | FL/FR |
| theaspirane | FL/FR |
creamy |
| acetyl ethyl carbinol | FL |
| acetyl isobutyryl | FL/FR |
| creamy lactone | FL/FR |
delta- | dodecalactone | FL/FR |
| glyceryl 5-hydroxydecanoate | FL/FR |
| glyceryl 5-hydroxydodecanoate | FL/FR |
delta- | nonalactone | FL/FR |
| octyl isobutyrate | FL/FR |
delta- | undecalactone | FL/FR |
gamma- | undecalactone (aldehyde C-14 (so-called)) | FL/FR |
| waxy lactone | FL/FR |
dairy |
| methyl (Z)-5-octenoate | FL/FR |
earthy |
| geosmin | FL/FR |
estery |
| octyl propionate | FL/FR |
ethereal |
| allyl 2-ethyl butyrate | FL/FR |
5- | methyl-5-hexen-2-one | FL/FR |
fatty |
iso | amyl laurate | FL/FR |
(Z)- | dairy lactone | FL/FR |
(E,E)-2,4- | decadienal | FL |
2- | decenal | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
2,4- | nonadien-1-ol | FL/FR |
(E,E)-2,4- | nonadienal | FL |
2,4- | nonadienal | FL |
(Z)-2- | nonen-1-ol | FL/FR |
2- | nonenal | FL/FR |
(E)-2- | octenal | FL/FR |
10- | undecenal (aldehyde C-11 undecylenic) | FL/FR |
floral |
| bois de rose oil brazil | FL/FR |
| cinnamyl propionate | FL/FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| citronellyl hexanoate | FL/FR |
| citronellyl phenyl acetate | FL/FR |
| citronellyl propionate | FL/FR |
| cocoa pentenal | FL/FR |
| dihydrocarvyl acetate | FL/FR |
| dihydrojasmone | FL/FR |
| dihydrolinalool | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
3,7- | dimethyl-6-octenoic acid | FL/FR |
| farnesol | FL/FR |
| farnesyl acetate | FL/FR |
| geraniol | FL/FR |
| geranium oil | FL/FR |
| geranium oil africa | FL/FR |
| geranyl acetone | FL/FR |
| geranyl phenyl acetate | FL/FR |
| heliotropyl acetate | FL/FR |
(Z)-3- | hexen-1-yl anthranilate | FL/FR |
| hotrienol | FL/FR |
alpha- | ionone | FL/FR |
| jasmin acetate | FL/FR |
| linalyl acetate | FL/FR |
| methyl dihydrojasmonate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| muguet carbinol | FL/FR |
| muguet shiseol | FL/FR |
| neroli oil CO2 extract | FL/FR |
| neryl acetate | FL/FR |
| orange leaf absolute | FL/FR |
bitter | orangeflower absolute tunisia | FL/FR |
| orris rhizome resinoid (iris pallida) | FL/FR |
| phenethyl anthranilate | FL/FR |
4- | phenyl-2-butanol | FL/FR |
| rhodinol | FL/FR |
laevo- | rose oxide | FL/FR |
| satinaldehyde | FL/FR |
| tetrahydrolinalool | FL/FR |
| tropical ionone | FL/FR |
| ylang ylang flower oil III | FL/FR |
fruity |
| acetyl methyl anthranilate | FL/FR |
| allyl cyclohexyl propionate | FL/FR |
| amyl hexanoate | FL/FR |
iso | amyl hexanoate | FL/FR |
iso | amyl octanoate | FL/FR |
para- | anisyl acetate | FL/FR |
para- | anisyl alcohol | FL/FR |
| benzyl methyl ether | FL/FR |
| berry pentadienoate | FL/FR |
| bread thiophene | FL/FR |
iso | butyl anthranilate | FL/FR |
| cherry oxyacetate | FL/FR |
| cherry propanol | FL/FR |
| cinnamyl isovalerate | FL/FR |
| citronellyl isobutyrate | FL/FR |
alpha- | damascone | FL/FR |
gamma- | decalactone | FL/FR |
| decyl butyrate | FL/FR |
| diethyl sebacate | FL/FR |
| dimethyl anthranilate | FL/FR |
| dimethyl succinate | FL/FR |
| ethyl anthranilate | FL/FR |
| ethyl heptanoate | FL/FR |
| ethyl methyl-para-tolyl glycidate | FL/FR |
| fruity ketal | FL/FR |
| geranyl hexanoate | FL/FR |
3- | heptyl dihydro-5-methyl-2(3H)-furanone | FL/FR |
| hexyl 2-methyl-3-pentenoate | FL/FR |
| hexyl hexanoate | FL/FR |
| hexyl lactate | FL/FR |
| hexyl phenyl acetate | FL/FR |
| lilac acetaldehyde | FL/FR |
| linalyl cinnamate | FL/FR |
| linalyl octanoate | FL/FR |
3- | mercaptohexyl hexanoate | FL |
| methoxymelonal | FL/FR |
| methyl (E)-2-octenoate | FL/FR |
| methyl anthranilate | FL/FR |
2- | methyl butyl isovalerate | FL/FR |
| neryl formate | FL/FR |
| octen-1-yl cyclopentanone | FL/FR |
(Z)-3- | octen-1-yl propionate | FL/FR |
| phenethyl butyrate | FL/FR |
| phenethyl octanoate | FL/FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
| propyl hexanoate | FL/FR |
iso | propyl octanoate | FL/FR |
| rhodinyl formate | FL/FR |
| rose butanoate | FL/FR |
| strawberry glycidate 1 (aldehyde C-16 (so-called)) | FL/FR |
| strawberry glycidate 2 | FL/FR |
| styralyl acetate | FL/FR |
| terpinyl cinnamate | FL/FR |
4-(para- | tolyl)-2-butanone | FL/FR |
| vanilla carboxylate | FL/FR |
fusel |
white | cognac oil | FL/FR |
green |
iso | amyl salicylate | FL/FR |
2-iso | butyl thiazole | FL/FR |
| cassis pentanone | FL/FR |
| celery ketone | FL/FR |
| chrysanthemum oxide | FL/FR |
| cinnamyl alcohol | FL/FR |
(E)- | citronellyl tiglate | FL/FR |
| clary sage absolute | FL/FR |
| coriander oleoresin | FL/FR |
| cucumber distillates | FL |
| cumin acetaldehyde | FL/FR |
| cyclamen aldehyde | FL/FR |
iso | cyclocitral (IFF) | FL/FR |
| cyclohexyl ethyl acetate | FL/FR |
| cyclohexyl ethyl alcohol | FL/FR |
| dihydromyrcenol | FL/FR |
| dihydroxyacetophenone (mixed isomers) | FL |
3,4- | dimethoxystyrene | FL |
| diphenyl oxide | FL/FR |
(E,Z)-2,6- | dodecadienal | FL/FR |
| ethyl (E,Z)-2,4-decadienoate | FL/FR |
| galbanum oil | FL/FR |
cis- | galbanum oxathiane | FL/FR |
| geranyl acetate | FL/FR |
| geranyl formate | FL/FR |
| green ether | FL/FR |
(Z)-4- | hepten-1-ol | FL/FR |
| heptyl heptanoate | FL/FR |
2,4- | hexadienal | FL |
| hexahydrofarnesyl acetone | FL/FR |
(Z)-3- | hexen-1-ol | FL/FR |
(Z)-4- | hexen-1-ol | FL/FR |
(Z)-3- | hexen-1-yl 2-methyl butyrate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl butyrate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl lactate | FL/FR |
(Z)-3- | hexen-1-yl methyl carbonate | FL/FR |
(Z)-3- | hexen-1-yl octanoate | FL/FR |
(Z)-3- | hexen-1-yl phenyl acetate | FL/FR |
(Z)-3- | hexen-1-yl propionate | FL/FR |
(Z)-3- | hexen-1-yl pyruvate | FL/FR |
(Z)-3- | hexen-1-yl salicylate | FL/FR |
(Z)-3- | hexen-1-yl tiglate | FL/FR |
(Z)-3- | hexen-1-yl valerate | FL/FR |
| hexyl 2-furoate | FL/FR |
| hexyl 2-methyl butyrate | FL/FR |
| hexyl octanoate | FL/FR |
| hexyl tiglate | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
3,6- | ivy carbaldehyde | FL/FR |
iso | jasmone | FL/FR |
(Z)- | leaf acetal | FL/FR |
| linalool oxide | FL/FR |
| melon acetal | FL/FR |
| melon heptenal | FL/FR |
| melon nonenoate | FL/FR |
| methyl 2-undecynoate | FL |
| methyl heptine carbonate | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
| methyl octine carbonate | FL/FR |
(E)- | nerolidol | FL/FR |
| nerolidol | FL/FR |
(E,Z)-3,6- | nonadien-1-ol | FL/FR |
3,6- | nonadien-1-ol | FL/FR |
3,6- | nonadien-1-yl acetate | FL/FR |
(E,Z)-3,6- | nonadien-1-yl acetate | FL/FR |
(E,Z)-2,6- | nonadienal | FL/FR |
(E,E)-2,6- | nonadienal | FL |
| nonanal dimethyl acetal | FL/FR |
3- | nonanone | FL/FR |
(E)-2- | nonen-1-ol | FL/FR |
(Z)-6- | nonen-1-yl acetate | FL/FR |
(E)-2- | nonenal | FL/FR |
(Z)-6- | nonenal | FL/FR |
| oakmoss absolute | FL/FR |
(E,E)-2,4- | octadienal | FL |
(Z)-5- | octen-1-ol | FL/FR |
(E)-2- | octen-1-yl acetate | FL/FR |
(Z)-5- | octen-1-yl propionate | FL/FR |
| papaya isobutyrate | FL/FR |
2- | pentyl furan | FL/FR |
| phenethyl tiglate | FL/FR |
| phenyl acetaldehyde diisobutyl acetal | FL/FR |
| phenyl acetaldehyde dimethyl acetal | FL/FR |
3- | phenyl propionaldehyde | FL/FR |
iso | propyl tiglate | FL/FR |
(Z)- | rose oxide | FL/FR |
| violet leaf absolute | FL/FR |
hay |
| genet absolute | FL/FR |
herbal |
iso | amyl heptanoate | FL/FR |
| anethum graveolens herb oil | FL/FR |
| carum carvi fruit oil | FL/FR |
| clary sage oil france | FL/FR |
| coriander seed oil | FL/FR |
| coriander seed oil CO2 extract | FL/FR |
| daucus carota fruit oil | FL/FR |
5- | hydroxymethyl furfural | FL |
| saffron indenone | FL/FR |
honey |
| phenethyl acetate | FL/FR |
| propyl phenyl acetate | FL/FR |
jammy |
(S)- | campholene acetate | FL/FR |
| maltyl isobutyrate | FL/FR |
meaty |
ortho- | thioguaiacol | FL |
medicinal |
| dimethyl benzyl carbinol | FL/FR |
| phenethyl salicylate | FL/FR |
melon |
| hydroxycitronellal diethyl acetal | FL/FR |
| propyl 2,4-decadienoate | FL/FR |
metallic |
3-( | methyl thio) hexanol | FL/FR |
milky |
dextro,laevo-3-( | methyl thio) butanone | FL |
mushroom |
3- | octanone | FL/FR |
1- | octen-3-yl butyrate | FL/FR |
musk |
iso | ambrettolide | FL/FR |
musty |
| strawberry furanone methyl ether | FL/FR |
nutty |
2- | acetyl-3,5(or 6)-dimethyl pyrazine | FL/FR |
3,6- | cocoa pyrazine | FL/FR |
| furfural acetone | FL |
2- | methoxy-3-methyl pyrazine | FL/FR |
(E,E/E,Z)- | tobacco cyclohexenone | FL/FR |
oily |
| olive oil absolute | FL/FR |
iso | phytol | FL/FR |
onion |
| ethyl 2-mercaptopropionate | FL/FR |
| methyl propyl trisulfide | FL |
orris |
| costus root oil | FL |
| orris capronate | FL/FR |
phenolic |
| propyl 2-furoate | FL |
popcorn |
2- | propionyl-2-thiazoline | FL |
powdery |
| hydroxycitronellol | FL/FR |
beta- | naphthyl ethyl ether | FL/FR |
| powdery ketone | FL |
pungent |
| acetaldehyde | FL |
soapy |
| dodecanal (aldehyde C-12 lauric) | FL/FR |
1- | dodecanol | FL/FR |
spicy |
| benzyl cinnamate | FL/FR |
| cinnamyl formate | FL/FR |
| clove bud oil | FL/FR |
| cuminaldehyde | FL/FR |
black | currant bud absolute | FL/FR |
iso | eugenyl acetate | FL/FR |
alpha- | methyl cinnamaldehyde | FL/FR |
| methyl cinnamate | FL/FR |
2- | octanol | FL/FR |
black | pepper oil | FL/FR |
3- | phenyl propyl cinnamate | FL/FR |
| pimenta acris leaf oil | FL/FR |
sulfurous |
| buchu mercaptan | FL/FR |
| ethyl methyl mercaptopropionate | FL/FR |
| grapefruit menthane | FL/FR |
| mango thiol | FL/FR |
1- | methyl thio-2-propanone | FL |
| potato butanone | FL |
| tropical 3-thiobutyrate | FL/FR |
tea |
| camellia oleifera leaf extract | FL/FR |
tomato |
| methional | FL/FR |
tropical |
beta- | cyclocitral | FL/FR |
vanilla |
omega- | pentadecalactone | FL/FR |
waxy |
| adoxal (Givaudan) | FL/FR |
| decanal (aldehyde C-10) | FL/FR |
| decanal diethyl acetal | FL/FR |
| decanol | FL/FR |
9- | decen-1-ol | FL/FR |
2- | decen-1-ol | FL/FR |
| decyl acetate | FL/FR |
| dodecyl acetate | FL/FR |
| ethyl laurate | FL/FR |
| ethyl myristate | FL/FR |
| ethyl nonanoate | FL/FR |
| heptyl octanoate | FL/FR |
alpha- | hexyl cinnamaldehyde | FL/FR |
| hydroxycitronellal | FL/FR |
| hydroxycitronellal dimethyl acetal | FL/FR |
2- | methyl undecanal (aldehyde C-12 mna) | FL/FR |
| mimosa absolute | FL/FR |
| mimosa absolute france | FL/FR |
| mimosa absolute india | FL/FR |
(Z,Z)-3,6- | nonadien-1-ol | FL/FR |
| nonanol | FL/FR |
(Z)-6- | nonen-1-ol | FL/FR |
(Z)-3- | nonen-1-ol | FL/FR |
| propyl heptanoate | FL/FR |
(E)-2- | tetradecenal | FL/FR |
| tridecanal | FL/FR |
| tuberolide | FL/FR |
| undecanal | FL/FR |
2- | undecanol | FL/FR |
whiskey |
3- | methyl-1-pentanol | FL/FR |
winey |
iso | amyl nonanoate | FL/FR |
woody |
| ambroxan | FL/FR |
| amyris wood oil | FL/FR |
| cedrol | FL/FR |
beta- | damascenone | FL/FR |
delta- | damascone | FL/FR |
| frankincense oil | FL/FR |
alpha- | ionol | FL/FR |
beta- | ionone | FL/FR |
alpha- | irone | FL/FR |
(Z)- | jasmone | FL/FR |
| methyl cedryl ketone | FL/FR |
| methyl ionyl acetate | FL/FR |
(1S,5R)- | myrtenyl acetate | FL/FR |
| patchouli oil | FL/FR |
| whiskey lactone | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
| aquanal (Quest) | 3-(1,3- | benzodioxol-5-yl)-2-methylpropanal | 1,3- | benzodioxole-5-propanal, a-methyl- | | cetonial | | floramelon | | florial | | florial synthetic | neo | helial | | heliobouquet | | heliofresh | | heliogan | | heliolan | | helional (IFF) | | helionix | | heliopropanal | | hydrocinnamaldehyde, a-methyl-3,4-(methylenedioxy)- | alpha- | methyl-1,3-benzodioxole-5-propanal | a- | methyl-1,3-benzodioxole-5-propionaldehyde | alpha- | methyl-1,3-benzodioxole-5-propionaldehyde | 2- | methyl-3-(3,4-methyene dioxyphenyl) propionaldehyde | 2- | methyl-3-(3,4-methyenedioxyphenyl)propionaldehyde | 2- | methyl-3-(3,4-methylene dioxyphenyl) hydrocinnamaldehyde | 2- | methyl-3-(3,4-methylene dioxyphenyl) propanal | 2- | methyl-3-(3,4-methylenedioxyphenyl)-propanal | 2- | methyl-3-(3,4-methylenedioxyphenyl)propanal | alpha- | methyl-3,4-(methylene dioxy) hydrocinnamaldehyde | alpha- | methyl-3,4-(methylenedioxy)hydrocinnamaldehyde | alpha- | methyl-3,4-methylene dioxyhydrocinnamic aldehyde | a- | methyl-3,4-methylene-dioxyhydrocinnamic aldehyde | .alpha.- | methyl-3,4-methylenedioxy-hydrocinnamic aldehyde | a- | methyl-3,4-methylenedioxy-hydrocinnamic aldehyde | 3-(3,4- | methylene dioxyphenyl)-2-methyl propanal | 3-(3,4- | methylenedioxyphenyl)-2-methylpropanal | | neohelial (A.C.S. International) | | ocean propanal | | tropional |
Articles:
|