| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 2-phenylhexanenitrile | |||||||||||||||||||||||||
| InChI : | InChI=1/C12H15N/c1-2-3-7-12(10-13)11-8-5-4-6-9-11/h4-6,8-9,12H,2-3,7H2,1H3 | |||||||||||||||||||||||||
| InChIKey : | OTERUZJEJFMEEB-UHFFFAOYAI | |||||||||||||||||||||||||
| SMILES : | CCCCC(C#N)C1=CC=CC=C1 | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||
| odor description : at 100.00 %. | balsam clover styrax | |||||||||||||||||||||||||
| substantivity : | 260 Hour(s) | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.94200 - 0.95000 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.838 to 7.905 | |||||||||||||||||||||||||
| refractive index : | 1.49800 - 1.50500 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 272.00 - 273.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| logp : | 3.39 | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||
| recommendation for clover nitrile usage levels up to : | ||||||||||||||||||||||||||
| 20.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for clover nitrile usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| (EINECS) number : | 423-460-8 | |||||||||||||||||||||||||
| chemidplus : | 003508983 | |||||||||||||||||||||||||
| epa-srs : | 3508-98-3 | |||||||||||||||||||||||||
| dtp/nci : | 41712 | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| pubchem : | 675032 | |||||||||||||||||||||||||
| synonyms : | |
| alpha- | butyl benzene acetonitrile |
| clover nitrile | |
| 2- | phenyl hexane nitrile |
| salicynalva | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| abies alba mill oil | |
| abies sibirica oil | |
| iso | amyl salicylate |
| amyris wood oil | |
| bay leaf oil | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl phenyl acetate |
| iso | butyl salicylate |
| citronella oil | |
| clary sage oil | |
| cognac oil | |
| coumarin | |
| cypress oil | |
| decanol | |
| deertongue absolute | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl benzoate | |
| ethyl cinnamate | |
| eugenia jambolana leaf oil | |
| eugenol | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| ho leaf oil | |
| hyssop oil | |
| ivy absolute | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| linalool oxide | |
| litsea cubeba oil | |
| melilot absolute | |
| mimosa absolute | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| patchouli ethanone | |
| pimento berry oil | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| spike lavender oil | |
| spruce oil | |
| alpha- | terpineol |
| tonka bean absolute | |
| treemoss absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vetiver oil | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| aldehydic | |
| almond | |
| alpine bouquet | |
| amber | |
| apple blossom | |
| apricot | |
| balsam | |
| banana | |
| berry | |
| blue grass | |
| blue mist | |
| bluebell | |
| bouquet | |
| broom genet genista | |
| camelia | |
| carnation dianthus oeillet | |
| cedar | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chrysanthemum chrysantheme | |
| chypre | |
| citrus | |
| clean | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| currant | |
| cyclamen | |
| date | |
| fern fougere | |
| floral | |
| fresh | |
| fruit | |
| gooseberry | |
| grenadine | |
| hay new mown hay foin coupe | |
| herbal | |
| honey miel | |
| hyacinth jacinthe | |
| leather | |
| lemon | |
| lilac lilas syringa | |
| lotus | |
| maja | |
| meadow | |
| mimosa wattle | |
| mint | |
| moss | |
| musk | |
| ocean sea breeze | |
| orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| peach | |
| pine | |
| plum | |
| poppy red poppy | |
| potpourri | |
| raspberry | |
| rootbeer | |
| rose | |
| rose tea rose | |
| spearmint | |
| spice | |
| strawberry | |
| tuberose tubereuse | |
| vanilla | |
| wallflower giroflee | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| not found in nature | |