Notes :
Gives good body.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | 3-(4-ethylphenyl)-2,2-dimethylpropanal | |||||||||||||||||||||||||||
| InChI : | InChI=1/C13H18O/c1-4-11-5-7-12(8-6-11)9-13(2,3)10-14/h5-8,10H,4,9H2,1-3H3 | |||||||||||||||||||||||||||
| InChIKey : | JFTSYAALCNQOKO-UHFFFAOYAC | |||||||||||||||||||||||||||
| SMILES : | CCC1=CC=C(C=C1)CC(C)(C)C=O | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| IUPAC name : | 3-(2-ethylphenyl)-2,2-dimethylpropanal | |||||||||||||||||||||||||||
| InChI : | InChI=1/C13H18O/c1-4-11-7-5-6-8-12(11)9-13(2,3)10-14/h5-8,10H,4,9H2,1-3H3 | |||||||||||||||||||||||||||
| InChIKey : | ITJHALDCYCTNNJ-UHFFFAOYAK | |||||||||||||||||||||||||||
| SMILES : | CCC1=CC=CC=C1CC(C)(C)C=O | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | 2906.19.0000 | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| IFF : | Floralozone
≥97% (sum of isomers) Odor: Powerful, clean, green, fresh air tone reminiscent of ocean breezes. | |||||||||||||||||||||||||||
| John D. Walsh : | Floralozone | |||||||||||||||||||||||||||
| Moellhausen : | floralozonex
95% min. nature identical kosher Odor: powerful, clean, fresh air, ocean note | |||||||||||||||||||||||||||
| Penta : | floralozone | |||||||||||||||||||||||||||
| Symrise : | Florazon | |||||||||||||||||||||||||||
| Vigon : | Florazon | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | marine | |||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | ozone clean fresh green marine | |||||||||||||||||||||||||||
| odor sample from : | International Flavors & Fragrances Inc. | |||||||||||||||||||||||||||
| substantivity : | 80 Hour(s) | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||
| assay : | 94.00 to 100.00 % sum of isomers | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| specific gravity : | 0.95000 to 0.95800 @ 25.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.905 to 7.972 | |||||||||||||||||||||||||||
| specific gravity : | 0.95100 to 0.95900 @ 20.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.922 to 7.989 | |||||||||||||||||||||||||||
| refractive index : | 1.50400 to 1.50900 @ 20.00 °C. | |||||||||||||||||||||||||||
| flash point : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| logP (o/w) : | 3.60 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Oral-Rat 5000.00 mg/kg Food and Chemical Toxicology. Vol. 26, Pg. 307, 1988. | ||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Skin-Rabbit >5000.00 mg/kg Food and Chemical Toxicology. Vol. 26, Pg. 307, 1988. | ||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||
| recommendation for ozone propanal usage levels up to : | ||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for ozone propanal usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||
| 3-(4-ethylphenyl)-2,2-dimethylpropanal | ||||||||||||||||||||||||||||
| (EINECS) number : | 266-819-2 | |||||||||||||||||||||||||||
| chemidplus : | 067634155 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 67634-15-5 | |||||||||||||||||||||||||||
| 3-(2-ethylphenyl)-2,2-dimethylpropanal | ||||||||||||||||||||||||||||
| (EINECS) number : | 266-818-7 | |||||||||||||||||||||||||||
| chemidplus : | 067634144 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 67634-14-4 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| 3-(4-ethylphenyl)-2,2-dimethylpropanal | ||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2736369355 | |||||||||||||||||||||||||||
| pubchem : | 682950 | |||||||||||||||||||||||||||
| 3-(2-ethylphenyl)-2,2-dimethylpropanal | ||||||||||||||||||||||||||||
| pubchem : | 682949 | |||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||
| Cosmetic uses : |
masking agents perfuming agents | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1983)¹ | |||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||
| synonyms : | |
| alpha,alpha- | dimethyl-4-ethyl benzene propanal |
| alpha,alpha- | dimethyl-ortho- and para-ethyl phenyl propanal |
| -2,2- | ethyl dimethyl hydrocinnamal |
| ortho- and para- | ethyl dimethyl hydrocinnamaldehyde |
| 3-(ortho- and para- | ethyl phenyl)-2,2-dimethyl propionaldehyde |
| ortho- and para- | ethyl-alpha-alpha-dimethyl hydrocinnamaldehyde |
| 3-(4- | ethylphenyl)-2,2-dimethylpropanal |
| floralozone | |
| floralozonex | |
| florazon | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| amber carbinol | |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| caraway seed oil | |
| carrot seed oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus root oil | |
| cuminaldehyde | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl laurate | |
| fir needle oil | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| ho leaf oil | |
| hyacinth ether | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| (Z)- | jasmone |
| iso | jasmone |
| leaf acetal | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| marine pyridine | |
| mcp acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl octine carbonate | |
| 2- | methyl undecanal |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musk indanone | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanal | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| oakmoss absolute | |
| (Z)-5- | octen-1-ol |
| orange oil | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| pepper oil black | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| gamma- | undecalactone |
| undecanol | |
| 10- | undecen-1-al |
| violet decenol | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody amylene | |
(odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| animal | |
| apple blossom | |
| apple green apple | |
| ash mountain ash | |
| bark | |
| boronia | |
| bouquet | |
| boxwood | |
| boxwood blossom | |
| boysenberry | |
| bramble arctic bramble blackberry | |
| briar sweet briar eglantine | |
| burberry | |
| cabreuva | |
| cedar forest | |
| champaca champak | |
| cherry wild cherry | |
| chestnut blossom | |
| chypre | |
| cilantro | |
| clean | |
| clematis | |
| cloudberry bakeapple | |
| clover trefle le'trefle incarnat | |
| colonia | |
| cortex | |
| crabapple blossom | |
| cranberry | |
| cucumber | |
| cyclamen | |
| daffodil narcissus | |
| diorella | |
| evergreen | |
| exotic | |
| fagonia | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fir needle | |
| fixer | |
| floral | |
| foliage | |
| forest | |
| fresh | |
| galbanum | |
| gooseberry | |
| grapefruit | |
| green | |
| hay new mown hay foin coupe | |
| herbal | |
| hinoki | |
| hollyberry | |
| honeysuckle chevrefeuille | |
| huckleberry bilberry | |
| iris blossom | |
| ivy leaf | |
| jasmin | |
| juniperberry | |
| kiwi blossom | |
| leaf green leaf | |
| leather | |
| lemon | |
| lettuce | |
| lily | |
| linden blossom limeflower tilleul | |
| loganberry dewberry | |
| lotus | |
| lychee soapberry | |
| magnolia | |
| mango blossom | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| moss | |
| muguet lily of the valley | |
| mulberry | |
| narcissus narcisse | |
| new car | |
| ocean sea | |
| ocean sea breeze | |
| orange bitter orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| pansy | |
| papaya | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear prickly pear | |
| petunia | |
| phlox | |
| pine | |
| poppy | |
| privet blossom | |
| rain spring rain | |
| reseda mignonette | |
| rhubarb | |
| rose moss rose | |
| rose tea rose | |
| rose white rose | |
| rose wild rose | |
| saffron | |
| seaweed | |
| stephanotis | |
| tulip | |
| verbena verveine | |
| violet | |
| watery | |
| woody | |
| yew | |
natural occurrence in : | |
| not found in nature | |