| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 2-methyl-3-(4-methylphenyl)propanal | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O/c1-9-3-5-11(6-4-9)7-10(2)8-12/h3-6,8,10H,7H2,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | SGVBCLGVIOFAFT-UHFFFAOYAU | |||||||||||||||||||||||||||||||
| SMILES : | CC1=CC=C(C=C1)CC(C)C=O | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | fresh cyclamen orange dry sweet aldehydic amber woody costus | |||||||||||||||||||||||||||||||
| taste description³ : | at 20.00 ppm. Orange flower, sweet, floral, melon-like with a green fruity nuance | |||||||||||||||||||||||||||||||
| substantivity : | 168 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | pale yellow clear liquid | |||||||||||||||||||||||||||||||
| assay : | 96.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 0.96300 - 0.97100 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.013 to 8.080 | |||||||||||||||||||||||||||||||
| refractive index : | 1.49800 - 1.49800 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 85.00 - 87.00 °C. @ 1.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 2.84 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 186.80 °F. TCC ( 86.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for satinaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for satinaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||
| 20.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 255-410-4 | |||||||||||||||||||||||||||||||
| chemidplus : | 041496439 | |||||||||||||||||||||||||||||||
| epa-srs : | 41496-43-9 | |||||||||||||||||||||||||||||||
| dtp/nci : | 22267 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| jecfa number : | 1466 | |||||||||||||||||||||||||||||||
| fl. number : | 05.052 | |||||||||||||||||||||||||||||||
| pubchem : | 672756 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 16, No. 2, 49, (1991)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| alpha,4- | dimethyl benzene propanal |
| jasmorange | |
| 2- | methyl-3-(para-methyl phenyl) propanal |
| 2- | methyl-3-(para-tolyl) propionaldehyde |
| 2- | methyl-3-para-cresyl propionaldehyde |
| satinaldehyde | |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| water, very slightly | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| amber carbinol | |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| caraway seed oil | |
| carrot seed oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus root oil | |
| cuminaldehyde | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl laurate | |
| fir needle oil | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| ho leaf oil | |
| hyacinth ether | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| (Z)- | jasmone |
| iso | jasmone |
| leaf acetal | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| marine pyridine | |
| mcp acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl octine carbonate | |
| 2- | methyl undecanal |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musk indanone | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanal | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| oakmoss absolute | |
| (Z)-5- | octen-1-ol |
| orange oil | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| pepper oil black | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| gamma- | undecalactone |
| undecanol | |
| 10- | undecen-1-al |
| violet decenol | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| algae | |
| alpine bouquet | |
| amber | |
| animal | |
| apple blossom | |
| apple green apple | |
| ash mountain ash | |
| balsam | |
| bark | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| boronia | |
| bouquet | |
| boxwood | |
| boxwood blossom | |
| boysenberry | |
| bramble arctic bramble blackberry | |
| briar sweet briar eglantine | |
| burberry | |
| cabreuva | |
| cedar forest | |
| champaca champak | |
| cherry wild cherry | |
| chestnut blossom | |
| chypre | |
| cilantro | |
| citrus | |
| clean | |
| clematis | |
| cloudberry bakeapple | |
| clover trefle le'trefle incarnat | |
| colonia | |
| cortex | |
| crabapple blossom | |
| cranberry | |
| cucumber | |
| cyclamen | |
| daffodil narcissus | |
| diorella | |
| dry | |
| evergreen | |
| exotic | |
| fagonia | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fir needle | |
| fixer | |
| foliage | |
| forest | |
| fruit punch | |
| galbanum | |
| gooseberry | |
| grapefruit | |
| green | |
| hay new mown hay foin coupe | |
| herbal | |
| hinoki | |
| hollyberry | |
| honey miel | |
| honeysuckle chevrefeuille | |
| huckleberry bilberry | |
| iris blossom | |
| ivy leaf | |
| jackfruit | |
| jasmin | |
| juniperberry | |
| kiwi | |
| kiwi blossom | |
| leaf green leaf | |
| leather | |
| lemon | |
| lettuce | |
| lily | |
| linden blossom limeflower tilleul | |
| loganberry dewberry | |
| lotus | |
| lychee soapberry | |
| magnolia | |
| mango | |
| mango blossom | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| muguet lily of the valley | |
| mulberry | |
| narcissus narcisse | |
| natural | |
| new car | |
| ocean sea | |
| orange | |
| orange bitter orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| ozone | |
| pansy | |
| papaya | |
| paper | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear prickly pear | |
| petunia | |
| phlox | |
| pine | |
| poppy | |
| powder | |
| privet blossom | |
| quince | |
| rain spring rain | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose moss rose | |
| rose tea rose | |
| rose white rose | |
| rose wild rose | |
| saffron | |
| starfruit | |
| stephanotis | |
| tulip | |
| verbena verveine | |
| violet | |
| watery | |
| woody | |
| yew | |
| natural occurrence in : | |
| not found in nature | |