Notes :
Blends well with amber notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 5-butyl-5-ethyloxan-2-one | |||||||||||||||||||||||
| InChI : | InChI=1/C11H20O2/c1-3-5-7-11(4-2)8-6-10(12)13-9-11/h3-9H2,1-2H3 | |||||||||||||||||||||||
| InChIKey : | BACWTVIXOCGZHC-UHFFFAOYAT | |||||||||||||||||||||||
| SMILES : | CCCCC1(CCC(=O)OC1)CC | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 3302.90.0010 | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | animal | |||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | warm fatty animal costus root coconut | |||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.97600 - 0.98900 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.121 to 8.229 | |||||||||||||||||||||||
| refractive index : | 1.46400 - 1.46700 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 125.00 - 130.00 °C. @ 5.00 mm Hg | |||||||||||||||||||||||
| boiling point : | 289.00 - 291.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 2.96 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5000.00 mg/kg | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||
| recommendation for costus valerolactone usage levels up to : | ||||||||||||||||||||||||
| 4.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for costus valerolactone usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 267-048-4 | |||||||||||||||||||||||
| chemidplus : | 067770790 | |||||||||||||||||||||||
| epa-srs : | 67770-79-0 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 684011 | |||||||||||||||||||||||
| synonyms : | |
| 5- | butyl-5-ethyl tetrahydro-2H-pyran-2-one |
| costaulon | |
| costausol | |
| costus valerolactone | |
| ethyl butyl valerolactone | |
| 4- | ethyl-4-butyl-delta-valerolactone |
| soluble in : | |
| alcohol | |
| carbitol | |
| dipropylene glycol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| amber carbinol | |
| ambroxan | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| cade oil | |
| caraway seed oil | |
| carrot seed oil | |
| castoreum absolute | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| civet absolute | |
| civet decenone | |
| clover nitrile | |
| costus root oil | |
| coumarin | |
| para- | cresyl caprylate |
| para- | cresyl phenyl acetate |
| gamma- | decalactone |
| decanol | |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanol | |
| ethyl vanillin | |
| floral pyranol | |
| frankincense resinoid | |
| guaiacol | |
| guaiacwood oil | |
| heliotropin | |
| gamma- | hexalactone |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| labdanum resinoid | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| longifolene | |
| methyl cedryl ketone | |
| methyl ionones | |
| methyl undecylenate | |
| musks | |
| gamma- | nonalactone |
| oakmoss absolute | |
| ocean propanal | |
| orris absolute | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose oxides | |
| santall | |
| timber propanol | |
| tobacco dodecane | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanillin | |
| verymoss | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| amber | |
| animal | |
| artichoke | |
| bark | |
| bayberry | |
| birch tar | |
| burberry | |
| carnation dianthus oeillet | |
| carrot seed | |
| castoreum | |
| chestnut blossom | |
| chypre | |
| clean | |
| coconut | |
| coconut tropical coconut | |
| corn chip | |
| coronilla | |
| cortex | |
| costus | |
| cumin | |
| dahlia | |
| daisy | |
| daphne | |
| deertongue | |
| earth humus | |
| fantasy blends | |
| fecal | |
| fenugreek | |
| fern fougere | |
| fir balsam | |
| flouve | |
| foliage | |
| forest | |
| fungus | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hair | |
| hawthorn | |
| heather | |
| incense | |
| labdanum | |
| leather | |
| meadow | |
| moss | |
| musk | |
| nut | |
| oakmoss mousse de chene | |
| oriental | |
| orris iris | |
| petunia | |
| pomegranate | |
| powder | |
| privet | |
| privet blossom | |
| rose d'orient | |
| stephanotis | |
| straw | |
| tea | |
| tobacco tabac tabaco | |
| tonka | |
| truffle | |
| woodruff asperula | |
| woody | |
| wool | |
| natural occurrence in : | |
| not found in nature | |