Notes :
Has considerable potential throughout the entire perfumery spectrum, from alcoholic preparation to modern soap and detergent fragrances, particularly in woody, spicy and oriental types. It is compatible with a wide range of perfumery component materials and has marked fixative properties.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| InChI : | InChI=1/C17H26O2/c1-14(2)6-5-11(9-19-10-18)17-13-7-12(15(17,3)4)8-16(13,14)17/h10-13H,5-9H2,1-4H3 | |||||||||||||||||||||||
| InChIKey : | AMKJSSRFMFASCY-UHFFFAOYAF | |||||||||||||||||||||||
| SMILES : | CC1(CCC(C23C14C2CC(C4)C3(C)C)COC=O)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.13.0000 | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | woody amber cedar vetiver acetate clary sage orris | |||||||||||||||||||||||
| substantivity : | 208 Hour(s) | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | pale yellow viscous liquid to crystals | |||||||||||||||||||||||
| assay : | 87.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.02500 - 1.02900 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.529 to 8.562 | |||||||||||||||||||||||
| refractive index : | 1.49800 - 1.51000 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 330.00 - 331.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 5.05 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||
| recommendation for formoxymethyl isolongifolene usage levels up to : | ||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for formoxymethyl isolongifolene usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 261-582-1 | |||||||||||||||||||||||
| chemidplus : | 059056701 | |||||||||||||||||||||||
| epa-srs : | 59056-70-1 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 678348 | |||||||||||||||||||||||
| synonyms : | |
| amborate | |
| amboryl formate | |
| formoxymethyl isolongifolene | |
| octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bh-cyclopenta(1,3)cyclopropa(1,2)benzene-4-methyl formate | |
| octahydrotetramethyl methanocyclopentacyclopropabenzene-4-methanol formate | |
| soluble in : | |
| alcohol | |
| water, slightly | |
| insoluble in : | |
| water | |
| stability : | |
| aerosols | |
| air freshener | |
| cosmetic creams and emisified lotions | |
| deodorants | |
| detergent | |
| fabric conditioner | |
| hair sprays | |
| shampoo | |
| shaving foam | |
| soap | |
| spray cologne | |
| talcum powder | |
| (odor and/or flavor) blends with : | |
| acetyl thujopsene | |
| agarwood oil | |
| amber furan | |
| ambergris | |
| ambra oxide | |
| ambrarome | |
| ambreine | |
| ambrettolide | |
| alpha- | ambrinol |
| ambrinol epoxide | |
| ambroxan | |
| ambroxide | |
| iso | amyl salicylate |
| angelica root oil | |
| animal carbolactone | |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| calarene epoxide | |
| carrot seed oil | |
| castoreum absolute | |
| cedarwood oil | |
| chaulmooga oil | |
| cistus oil | |
| citronellone | |
| civet absolute | |
| civettone | |
| clary sage oil | |
| costus root oil | |
| costus valerolactone | |
| cypress oil | |
| decahydro-beta-naphthaldehyde | |
| dihydro-gamma-ionone | |
| dihydrocoumarin | |
| dihydrolinalool | |
| dodecanal | |
| grisambrene | |
| grisambria | |
| grisambrol | |
| heptalactones | |
| hexalactones | |
| indole | |
| ionones | |
| juniper lactone | |
| labdanum resinoid | |
| lilyall | |
| linalool oxide | |
| marjoram oil | |
| methyl ionones | |
| 2- | methyl undecanal |
| musks | |
| nonadienal acetate | |
| oakmoss absolute | |
| olibanum oil | |
| patchouli ethanone | |
| patchouli oil | |
| peru balsam oil | |
| rhodinol | |
| rose absolute | |
| rosewood oil | |
| sandalwood oil | |
| santall | |
| sclareol | |
| 5,6,7,8- | tetrahydro-1-naphthyl acetaldehyde |
| tetrahydromethyl quinoleine | |
| tolu balsam | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillin | |
| versalide | |
| vetiver acetate | |
| vetiver oil | |
| (odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar | |
| cedar forest | |
| chypre | |
| cigar box | |
| clary sage | |
| cloth clean cloths | |
| coronilla | |
| deertongue | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| oriental | |
| orris iris | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| spice | |
| tonka | |
| vanilla | |
| vetiver | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| not found in nature | |