| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 2-(3-methylbutoxy)ethylbenzene | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C13H20O/c1-12(2)8-10-14-11-9-13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | BHQBQWOZHYUVTL-UHFFFAOYAL | |||||||||||||||||||||||||||||||
| SMILES : | CC(C)CCOCCC1=CC=CC=C1 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| export tariff code : | 2909.30.2000 | |||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||
| Givaudan : | Anther
Odor: Green, Fresh, Floral, Hyacinth | |||||||||||||||||||||||||||||||
| John D. Walsh : | Anther | |||||||||||||||||||||||||||||||
| Moellhausen : | antherex
99% min. nature identical kosher Odor: aromatic, floral (hyacint, slightly rose), chocolate | |||||||||||||||||||||||||||||||
| Penta : | phenylethyl isoamyl ether | |||||||||||||||||||||||||||||||
| Vigon : | ANTHER | |||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | fresh green metallic spring hyacinth cool leafy | |||||||||||||||||||||||||||||||
| odor sample from : | PPF Norda, Inc | |||||||||||||||||||||||||||||||
| substantivity : | 32 Hour(s) | |||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 0.89900 to 0.90200 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.481 to 7.506 | |||||||||||||||||||||||||||||||
| refractive index : | 1.47700 to 1.48500 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 109.00 to 110.00 °C. @ 8.00 mm Hg | |||||||||||||||||||||||||||||||
| flash point : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||||||||
| logP (o/w) : | 4.08 | |||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Oral-Rat >5000.00 mg/kg Food and Chemical Toxicology. Vol. 21, Pg. 873, 1983. | ||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Skin-Rabbit >5000.00 mg/kg Food and Chemical Toxicology. Vol. 21, Pg. 873, 1983. | ||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||
| recommendation for green ether usage levels up to : | ||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||||||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA on the "LIBRARY" link. | ||||||||||||||||||||||||||||||||
| publication number : 24 | ||||||||||||||||||||||||||||||||
| average usual ppm | average maximum ppm | |||||||||||||||||||||||||||||||
| baked goods : | - | - | ||||||||||||||||||||||||||||||
| beverages(nonalcoholic) : | 0.50000 | 2.50000 | ||||||||||||||||||||||||||||||
| beverages(alcoholic) : | 0.50000 | 2.50000 | ||||||||||||||||||||||||||||||
| breakfast cereal : | - | - | ||||||||||||||||||||||||||||||
| cheese : | - | - | ||||||||||||||||||||||||||||||
| chewing gum : | 1.00000 | 5.00000 | ||||||||||||||||||||||||||||||
| condiments / relishes : | - | - | ||||||||||||||||||||||||||||||
| confectionery froastings : | - | - | ||||||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||||||
| fats / oils : | - | - | ||||||||||||||||||||||||||||||
| fish products : | - | - | ||||||||||||||||||||||||||||||
| frozen dairy : | - | - | ||||||||||||||||||||||||||||||
| fruit ices : | - | - | ||||||||||||||||||||||||||||||
| gelatins / puddings : | - | - | ||||||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||||||
| gravies : | - | - | ||||||||||||||||||||||||||||||
| hard candy : | 1.00000 | 5.00000 | ||||||||||||||||||||||||||||||
| imitation dairy : | - | - | ||||||||||||||||||||||||||||||
| instant coffee / tea : | - | - | ||||||||||||||||||||||||||||||
| jams / jellies : | - | - | ||||||||||||||||||||||||||||||
| meat products : | - | - | ||||||||||||||||||||||||||||||
| milk products : | - | - | ||||||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||||||
| other grains : | - | - | ||||||||||||||||||||||||||||||
| poultry : | - | - | ||||||||||||||||||||||||||||||
| processed fruits : | - | - | ||||||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||||||
| seasonings / flavors : | - | - | ||||||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||||||
| soft candy : | - | - | ||||||||||||||||||||||||||||||
| soups : | - | - | ||||||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||||||
| sweet sauces : | - | - | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||||||
| 2-(3-methylbutoxy)ethylbenzene | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 259-943-3 | |||||||||||||||||||||||||||||||
| chemidplus : | 056011020 | |||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 56011-02-0 | |||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||
| 2-(3-methylbutoxy)ethylbenzene | ||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 56011020 | |||||||||||||||||||||||||||||||
| pubchem : | 668786 | |||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1985)¹ | |||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||
| synonyms : | |
| iso | amyl phenethyl ether |
| iso | amyl phenyl ethyl ether |
| anther | |
| antherex | |
| (2-(3- | methyl butoxy)ethyl) benzene |
| 3- | methyl butyl oxyethyl benzene |
| 1-(2-((3- | methyl butyl)oxy)ethyl) benzene |
| (2-(3- | methylbutoxy)ethyl) benzene |
| (2-(3- | methylbutoxy)ethyl)benzene |
| 2-(3- | methylbutoxy)ethylbenzene |
| iso | pentyl phenethyl ether |
| phenethyl isoamyl ether | |
| phenyl ethyl isoamyl ether | |
| 2- | phenylethyl isoamyl ether |
| treflon | |
| trefrone | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| antiperspirant | |
| detergent | |
| fabric softener | |
| soap | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| amber carbinol | |
| iso | amyl acetate |
| iso | amyl benzoate |
| iso | amyl salicylate |
| angelica root oil | |
| para- | anisyl acetate |
| benzaldehyde | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl benzoate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl salicylate |
| carrot seed oil | |
| cedarleaf oil | |
| cedarwood oils | |
| chamomile oil | |
| cinnamyl alcohol | |
| citral | |
| citronella oils | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanal | |
| 9- | decen-1-al |
| diethyl malonate | |
| dimethyl benzyl carbinol | |
| dimethyl octandiol | |
| ethyl cinnamate | |
| ethyl laurate | |
| eucalyptus oil | |
| fir needle oil | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl diethyl acetal | |
| herbal undecanone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| ho leaf oil | |
| hyacinth ether | |
| ionones | |
| juniper berry oil | |
| lavender absolute | |
| leaf acetal | |
| leerall | |
| lemon oil | |
| lemongrass oil | |
| lime oil | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| litsea cubeba oil | |
| marine pyridine | |
| melon heptenal | |
| melon nonenoate | |
| methyl 2-methyl valerate | |
| methyl benzoate | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| 2- | methyl undecanal |
| methyl undecylenate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| nerol | |
| nerolidol | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanal | |
| nopyl acetate | |
| ocean propanal | |
| octanal | |
| orange oil | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose butanoate | |
| spruce oil | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| waxy aldehyde | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
(odor and/or flavor) used in : | |
| agate | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amaryllis | |
| apple crabapple | |
| ash mountain ash | |
| balsam | |
| bark | |
| bean | |
| bergamot | |
| blossom tropical blossom | |
| boxwood | |
| boxwood blossom | |
| broom genet genista | |
| cajuput | |
| calamus | |
| cedar forest | |
| celery | |
| cherry wild cherry | |
| chrysanthemum chrysantheme | |
| chypre | |
| cilantro | |
| citrus | |
| clematis | |
| cloudberry bakeapple | |
| cognac | |
| cologne | |
| cortex | |
| cranberry | |
| daffodil narcissus | |
| diffusion | |
| enhancer | |
| ethereal | |
| evergreen | |
| fantasy blends | |
| fern fougere | |
| fig | |
| fir balsam | |
| fir needle | |
| floral | |
| flouve | |
| foliage | |
| gardenia | |
| ginger white ginger | |
| grass | |
| green | |
| heather | |
| herbal | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| leaf | |
| leaf autumn leaf | |
| lemon | |
| lemongrass | |
| lifter | |
| lily | |
| lime | |
| lotus | |
| magnolia | |
| meadow | |
| metallic | |
| millefleurs | |
| mint | |
| mushroom | |
| narcissus narcisse | |
| nut | |
| ocean sea | |
| orchid | |
| orris iris | |
| outdoors fresh outdoors | |
| pansy | |
| pear prickly pear | |
| peony | |
| pepper tabasco pepper | |
| petitgrain lime petitgrain | |
| petunia | |
| pineapple | |
| privet | |
| privet blossom | |
| rain | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose wild rose | |
| saffron | |
| tea | |
| tomato | |
| topnotes | |
| tuberose tubereuse | |
| tulip | |
| verbena verveine | |
| vine | |
| watercress nasturtium | |
| weedy | |
| yew | |
natural occurrence in : | |
| not found in nature | |