| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 2-methyl-4-propyl-1,3-oxathiane | |||||||||||||||||||||||||
| InChI : | InChI=1/C8H16OS/c1-3-4-8-5-6-9-7(2)10-8/h7-8H,3-6H2,1-2H3 | |||||||||||||||||||||||||
| InChIKey : | GKGOLPMYJJXRGD-UHFFFAOYAU | |||||||||||||||||||||||||
| SMILES : | CCCC1CCOC(S1)C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | sulfurous | |||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | sulfureous green galbanum pineapple | |||||||||||||||||||||||||
| substantivity : | 56 Hour(s) | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.97000 - 0.98200 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.071 to 8.171 | |||||||||||||||||||||||||
| refractive index : | 1.47500 - 1.48500 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 218.00 - 220.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||
| logp : | 2.31 | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 6000.00 mg/kg | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 122.00 °F. TCC ( 50.00 °C. ) | |||||||||||||||||||||||||
| recommendation for galbanum oxathiane usage levels up to : | ||||||||||||||||||||||||||
| 0.1000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| (EINECS) number : | 261-699-8 | |||||||||||||||||||||||||
| chemidplus : | 067715804 | |||||||||||||||||||||||||
| epa-srs : | 59323-76-1 | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| pubchem : | 199034 | |||||||||||||||||||||||||
| synonyms : | |
| galbanum oxathiane | |
| (2R,4S)-rel-2- | methyl-4-propyl-1,3-oxathiane |
| (Z)-2- | methyl-4-propyl-1,3-oxathiane |
| cis-2- | methyl-4-propyl-1,3-oxathiane |
| oxane | |
| (Z)- | tropathiane |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| antiperspirant | |
| cream | |
| deodorant | |
| detergent powder | |
| shampoo | |
| soap | |
| talcum powder | |
| (odor and/or flavor) blends with : | |
| abies alba mill oil | |
| acetaldehyde ethyl phenethyl acetal | |
| algae absolute | |
| allyl amyl glycolate | |
| ambroxan | |
| iso | amyl benzoate |
| amyris wood oil | |
| animal carbolactone | |
| anise seed oil | |
| para- | anisyl alcohol |
| basil oil | |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl alcohol | |
| benzyl benzoate | |
| benzyl salicylate | |
| bois de rose oil | |
| camphor oil | |
| caraway seed oil | |
| carrot seed oil | |
| cedarleaf oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clover nitrile | |
| cognac oil | |
| cortex pyridine | |
| costus root oil | |
| costus valerolactone | |
| para- | cresyl caprylate |
| cubeb oil | |
| cumin seed oil | |
| cuminaldehyde | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanal | |
| decyl acetate | |
| dihydromyrcenol | |
| dimethyl hydroquinone | |
| dodecanal | |
| dodecanol | |
| estragon | |
| ethyl laurate | |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| flouve absolute | |
| frankincense oil | |
| gardenia decalone | |
| geranyl acetate | |
| (E)- | geranyl acetone |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| hyacinth ether | |
| ionones | |
| ivy absolute | |
| 2,4- | ivy carbaldehyde |
| jascitile | |
| juniper berry oil | |
| karo-karounde absolute | |
| lavender absolute | |
| leaf acetal | |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| lovage root oil | |
| melon heptenal | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl octine carbonate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musks | |
| myrtenyl isobutyrate | |
| narcissus absolute | |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| oakmoss absolute | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| phenyl acetic acid | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rose oxides | |
| santall | |
| spruce oil | |
| strawberry furanone | |
| styralyl acetate | |
| alpha- | terpineol |
| tobacco dodecane | |
| tonka bean absolute | |
| trimenal | |
| gamma- | undecalactone |
| undecanol | |
| verymoss | |
| vetiver oil | |
| violet methyl carbonate | |
| watermelon ketone | |
| waxy nitrile | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| amaryllis | |
| amber | |
| animal | |
| apple | |
| apple crabapple | |
| ash mountain ash | |
| balsam | |
| bark | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| briar sweet briar eglantine | |
| cabochard | |
| calamus | |
| celery | |
| chamomile | |
| champaca champak | |
| cherry wild cherry | |
| chervil | |
| cilantro | |
| citrus | |
| clematis | |
| cloudberry bakeapple | |
| cognac | |
| cortex | |
| cypress | |
| daffodil narcissus | |
| earth humus | |
| evergreen | |
| fagonia | |
| fern fougere | |
| fig | |
| fir | |
| fixer | |
| foliage | |
| forest | |
| forest pine forest | |
| fresh | |
| fruit | |
| fruit tropical fruit | |
| galbanum | |
| gardenia | |
| geranium | |
| ginger | |
| grass green grass | |
| grass sweet grass | |
| green | |
| hops houblon | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| lavender | |
| leaf autumn leaf | |
| leaf green leaf | |
| lemon | |
| lime | |
| lotus | |
| mimosa wattle | |
| moss | |
| muguet lily of the valley | |
| musk | |
| narcissus narcisse | |
| natural | |
| nut | |
| ocean sea | |
| opoponax | |
| orange | |
| orange bitter orange | |
| oregano | |
| palmarosa | |
| pansy | |
| parsley | |
| passion fruit | |
| patchouli | |
| pepper | |
| pepper bell pepper | |
| pine | |
| pine needle | |
| pizza | |
| privet | |
| privet blossom | |
| rain spring rain | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose geranium | |
| sandalwood | |
| seaweed | |
| spruce | |
| stem | |
| strawberry leaf | |
| tea green tea | |
| tomato | |
| tomato leaf | |
| tropical | |
| vegetable | |
| verbena verveine | |
| vetiver | |
| vine | |
| weedy | |
| woody | |
| wormwood absinthium | |
| yew | |
| natural occurrence in : | |
| passion fruit | |