| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||
| IUPAC name : | methyl 2-[[3-(4-methoxyphenyl)-2-methylpropylidene]amino]benzoate | |||||||||||||||||||||
| InChI : | InChI=1/C19H21NO3/c1-14(12-15-8-10-16(22-2)11-9-15)13-20-18-7-5-4-6-17(18)19(21)23-3/h4-11,13-14H,12H2,1-3H3/b20-13+ | |||||||||||||||||||||
| InChIKey : | DCVGBQPSFNIPPI-DEDYPNTBBU | |||||||||||||||||||||
| SMILES : | CC(CC1=CC=C(C=C1)OC)C=NC2=CC=CC=C2C(=O)OC | |||||||||||||||||||||
|
| |||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2922.49.8050 | |||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 50.00 % solution or less | |||||||||||||||||||||
| odor description : at 50.00 % in dipropylene glycol. | sweet anise hawthorn green floral cortex mimosa absolute spicy powdery | |||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||
| properties : | ||||||||||||||||||||||
| appearence : | yellow solid paste | |||||||||||||||||||||
| assay : | 90.00 - 100.00 % sum of isomers | |||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||
| specific gravity : | 1.09950 - 1.10750 @ 25.00 °C. | |||||||||||||||||||||
| pounds per gallon - calc. : | 9.149 to 9.216 | |||||||||||||||||||||
| refractive index : | 1.54800 - 1.55700 @ 20.00 °C. | |||||||||||||||||||||
| boiling point : | 465.00 - 466.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||
| logp : | 5.16 | |||||||||||||||||||||
| shelf life : | 48.00 month(s) or longer if stored properly. | |||||||||||||||||||||
| safety : | ||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||
| flash point ( Deg. F. ) : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||
| recommendation for anisyl propanal / methyl anthranilate schiff's base usage levels up to : | ||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||
| chemidplus : | 111753629 | |||||||||||||||||||||
| epa-srs : | 111753-62-9 | |||||||||||||||||||||
| other : | ||||||||||||||||||||||
| references : | ||||||||||||||||||||||
| pubchem : | 662991 | |||||||||||||||||||||
| synonyms : | |
| anisyl propanal / methyl anthranilate schiff's base | |
| 2-((3-(4- | methoxyphenyl)-2-methyl propylidene)amino) benzoic acid methyl ester |
| methyl anthranilate / anisyl propanal schiff's base | |
| methyl anthranilate / canthoxal schiff's base | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl benzoate |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| caramel furanone | |
| cassia bark oil | |
| chocolate pyrazine | |
| cinnamyl alcohol | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| currant bud absolute black | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanol | |
| 9- | decen-1-ol |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl benzyl carbinyl isobutyrate | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| geraniol | |
| grapefruit pentanol | |
| green acetate | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hawthorn acetate | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl isovalerate | |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| labdanum resinoid | |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| maltol | |
| melon nonenoate | |
| methyl 2-methyl valerate | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl octine carbonate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| nerol | |
| nerolidol | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| nutmeg oil | |
| ocean propanal | |
| orange oil | |
| orris pyridine | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| phenethyl propionate | |
| phenyl acetic acid | |
| 3- | phenyl propyl alcohol |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| strawberry furanone | |
| strawberry glycidate 1 | |
| alpha- | terpineol |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| angel | |
| anise | |
| apple crabapple | |
| apple red apple | |
| apricot | |
| balsam | |
| banana | |
| basil | |
| bergamot | |
| blackberry | |
| blossom tropical blossom | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| boysenberry | |
| briar sweet briar eglantine | |
| butterscotch | |
| cabreuva | |
| candy cotton candy | |
| cassia | |
| cherry | |
| cherry black cherry | |
| cherry blossom | |
| chocolate cacao | |
| christmas blends | |
| chypre | |
| colonia | |
| cookie | |
| crabapple blossom | |
| cranberry | |
| cucumber | |
| currant | |
| daffodil narcissus | |
| fantasy blends | |
| fennel | |
| fern fougere | |
| fetes | |
| fig | |
| fir balsam | |
| fir needle | |
| floral | |
| forest | |
| frangipanni plumeria | |
| freesia | |
| fruit dried fruit | |
| gardenia | |
| gooseberry | |
| grape | |
| hawthorn | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jackfruit | |
| jam | |
| jasmin | |
| kiwi blossom | |
| licorice | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| loganberry dewberry | |
| lychee soapberry | |
| magnolia | |
| mango | |
| mango blossom | |
| marshmallow | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| moss | |
| muguet lily of the valley | |
| mulberry | |
| musk | |
| nectarine | |
| orange blossom fleur d'oranger | |
| oriental | |
| pansy | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| peony | |
| pineapple | |
| plum | |
| plum blossom | |
| pomegranate | |
| raspberry | |
| raspberry black raspberry | |
| redwood | |
| rose | |
| rose white rose | |
| rose wild rose | |
| starfruit | |
| stock evening scented stock | |
| strawberry | |
| sweet pea pois de senteur | |
| tobacco tabac tabaco | |
| toffee | |
| tropical | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| woody | |
| natural occurrence in : | |
| not found in nature | |