| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 3,7-dimethylocta-1,6-dien-3-yl (E)-3-phenylprop-2-enoate |
| InChI : | InChI=1/C19H24O2/c1-5-19(4,15-9-10-16(2)3)21-18(20)14-13-17-11-7-6-8-12-17/h5-8,10-14H,1,9,15H2,2-4H3/b14-13+ |
| InChIKey : | DPFUEXLIKDHJNB-BUHFOSPRBD |
| SMILES : | CC(=CCCC(C)(C=C)OC(=O)\C=C\C1=CC=CC=C1)C |
| (EINECS) number : | 201-110-3 |
| cas number : | 78-37-5 |
| beilstein number : | 3140688 |
| fema number : | 2641 |
| coe number : | 329 |
| jecfa number : | 668 |
| fl. number : | 09.736 |
| molar refractivity : | 89.83 ± 0.3 cm3 |
| parachor : | 700.3 ± 4.0 cm3 |
| index of refraction : | 1.537 ± 0.02 |
| surface tension : | 35.1 ± 3.0 dyne/cm |
| density : | 0.989 ± 0.06 g/cm3 |
| polarizability : | 35.61 ± 0.5 10-24cm3 |
| xlogp : | 5.20 |
| molecular weight : | 284.3926600 |
| formula : | C19 H24 O2 |
|
|
| |
| |
| fda reg : | 172.515 |
h. number : | 2916.12.6000 |
| organoleptics : | |
| odor type : | balsamic |
| odor strength : | medium |
odor description :
at 100.00 %. | sweet balsam lily neroli labdanum amber |
| substantivity : | 132 Hour(s) |
| properties : | |
| appearence : | colorless to yellow clear liquid |
| assay : | 94.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.99100 @ 25.00 °C.
|
| boiling point : | 353.00 °C. @ 760.00 mm Hg
|
| logp : | 6.04 |
| safety : | |
| Oral Toxicity(LD50) : |
Oral-Rat 9960.00 mg/kg
|
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg
|
| | |
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. )
|
| | |
| recommendation for linalyl cinnamate usage levels up to : | | | 8.0000 % in the fragrance concentrate.
|
| | |
| recommendation for linalyl cinnamate usage levels up to : | | | 5.0000 ppm in the flavor.
|
| | |
| safety links : | |
| (EINECS) number : | 201-110-3 |
| chemidplus : | 000078375 |
| epa-srs : | 78-37-5 |
| dtp/nci : | 46163 |
| | |
| other : | |
| |
|
| references : | |
| pubchem : | 149495 |
| | |
|
| synonyms : |
| | cinnamic acid 1,5-dimethyl-1-vinyl-4-hexen-1-yl ester | | | cinnamic acid 1,5-dimethyl-1-vinyl-4-hexenyl ester | | | cinnamic acid linalyl ester | | 1,5- | dimethyl-1-vinyl hex-4-enyl 3-phenyl-2-propenoate | | 1,5- | dimethyl-1-vinyl-4-hexen-1-yl cinnamate | | 1,5- | dimethyl-1-vinyl-4-hexenyl cinnamate | | 3,7- | dimethyl-1,6-octadien-3-yl 3-phenyl propenoate | | 3,7- | dimethyl-1,6-octadien-3-yl beta-phenyl acrylate | | 3,7- | dimethyl-1,6-octadien-3-yl cinnamate | | 1- | ethenyl-1,5-dimethyl-4-hexenyl 3-phenyl-2-propenoate | | | linalyl 3-phenyl propenoate | | | linalyl cinnamate | | 3- | phenyl-2-propenoic acid 1-ethenyl-1,5-dimethyl-4-hexenyl ester |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| | cinnamyl valerate |
| | rose butanoate |
| (odor and/or flavor) used in : |
| | amber | | | balsam | | | champaca champak | | | fixer | | | freesia | | | jasmin | | | labdanum | | | lavender | | | lily | | | lotus | | | magnolia | | | neroli | | | orange blossom fleur d'oranger | | | oriental | | | rose | | | tuberose tubereuse | | | woody |
| natural occurrence in : |
| not found in nature |
|