Notes :
Benzyl salicylate increases the carnation note while methyl salicylate in traces shifts it towards the tuberose note. Good for combining isobutyl and hexyl esters.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | pentyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H16O3/c1-2-3-6-9-15-12(14)10-7-4-5-8-11(10)13/h4-5,7-8,13H,2-3,6,9H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | RANVDUNFZBMTBK-UHFFFAOYAV | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H16O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h3-6,9,13H,7-8H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PMGCQNGBLMMXEW-UHFFFAOYAO | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C)CCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2918.23.0000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Givaudan : | Amyl Salicylate | |||||||||||||||||||||||||||||||||||
| International Flavors & Fragrances : | Amyl Salicylate | |||||||||||||||||||||||||||||||||||
| ≥98% (sum of esters) | ||||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | herbal floral clover azalea green sweet chocolate | |||||||||||||||||||||||||||||||||||
| substantivity : | 124 Hour(s) | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.04900 - 1.05500 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.729 to 8.779 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.05000 - 1.05600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.747 to 8.797 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.50600 - 1.51200 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 276.00 - 277.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 151.00 - 152.00 °C. @ 15.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 4.36 | |||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn N - Harmful, Dangerous for the environment. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 0.24 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| modified Theoretical Added Maximum Daily Intake (mTAMDI) : | 3700 (μg/person/day) | |||||||||||||||||||||||||||||||||||
| Threshold of concern : | 1800 (μg/person/day) | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for amyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| Food categories according to Commission Regulation EC No. 1565/2000 (EC, 2000) in FGE.06 (EFFA, 2002a). According to the Industry the "normal" use is defined as the average of reported usages and "maximum use" is defined as the 95th percentile of reported usages (EFFA, 2002i). | ||||||||||||||||||||||||||||||||||||
| Note : mg/kg = 0.001/1000 = 0.000001 = 1/1000000 = ppm. | ||||||||||||||||||||||||||||||||||||
| Dairy products, excluding products of category 02.0 (01.0) : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||||||
| Fats and oils, and fat emulsions (type water-in-oil) (02.0) : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||||||
| Edible ices, including sherbet and sorbet (03.0) : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||||||
| Processed fruit (04.1) : | 7.00000 | 35.00000 | ||||||||||||||||||||||||||||||||||
| Processed vegetables (incl. mushrooms & fungi, roots & tubers, pulses and legumes), and nuts & seeds (04.2) : | - | - | ||||||||||||||||||||||||||||||||||
| Confectionery (05.0) : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||||||
| Cereals and cereal products, incl. flours & starches from roots & tubers, pulses & legumes, excluding bakery (06.0) : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||||||
| Bakery wares (07.0) : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||||||
| Meat and meat products, including poultry and game (08.0) : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||||||||
| Fish and fish products, including molluscs, crustaceans and echinoderms (MCE) (09.0) : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||||||||
| Eggs and egg products (10.0) : | - | - | ||||||||||||||||||||||||||||||||||
| Sweeteners, including honey (11.0) : | - | - | ||||||||||||||||||||||||||||||||||
| Salts, spices, soups, sauces, salads, protein products, etc. (12.0) : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||||||
| Foodstuffs intended for particular nutritional uses (13.0) : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||||||
| Non-alcoholic ("soft") beverages, excl. dairy products (14.1) : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||||||
| Alcoholic beverages, incl. alcohol-free and low-alcoholic counterparts (14.2) : | - | - | ||||||||||||||||||||||||||||||||||
| Ready-to-eat savouries (15.0) : | 20.00000 | 100.00000 | ||||||||||||||||||||||||||||||||||
| Composite foods (e.g. casseroles, meat pies, mincemeat) - foods that could not be placed in categories 01.0 - 15.0 (16.0) : | 5.00000 | 25.00000 | ||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 218-080-2 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 002050080 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 2050-08-0 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 44877 | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 201-730-4 | |||||||||||||||||||||||||||||||||||
| rtecs : | VO4375000 for 87-20-7 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000087207 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 87-20-7 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 7952 | |||||||||||||||||||||||||||||||||||
| EPI System : | Click here | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| fl. number : | 09.762 | |||||||||||||||||||||||||||||||||||
| pubchem : | 159558 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1194665655 | |||||||||||||||||||||||||||||||||||
| jecfa number : | 903 | |||||||||||||||||||||||||||||||||||
| fl. number : | 09.751 | |||||||||||||||||||||||||||||||||||
| pubchem : | 149878 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 70942751 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| amyl salicylate | |
| N- | amyl salicylate |
| 2- | hydroxybenzoic acid pentyl ester |
| pentyl 2-hydroxybenzoate | |
| pentyl ortho-hydroxybenzoate | |
| pentyl salicylate | |
| salicylic acid pentyl ester | |
| soluble in : | |
| alcohol | |
| water, 5 mg/L @ 20C | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| non-discoloring in most media | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| amyris wood oil | |
| bay leaf oil | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl phenyl acetate |
| citronella oil | |
| clary sage oil | |
| cognac oil | |
| coumarin | |
| cypress oil | |
| decanol | |
| deertongue absolute | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl benzoate | |
| ethyl cinnamate | |
| eugenia jambolana leaf oil | |
| eugenol | |
| iso | eugenyl acetate |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropyl acetone | |
| ho leaf oil | |
| hyssop oil | |
| ivy absolute | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| linalool oxide | |
| litsea cubeba oil | |
| melilot absolute | |
| mimosa absolute | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| patchouli ethanone | |
| pimento berry oil | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| spike lavender oil | |
| spruce oil | |
| alpha- | terpineol |
| tonka bean absolute | |
| treemoss absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vetiver oil | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| aldehydic | |
| almond | |
| alpine bouquet | |
| amber | |
| apple blossom | |
| apricot | |
| azalea | |
| balsam | |
| banana | |
| berry | |
| blue grass | |
| blue mist | |
| bluebell | |
| bouquet | |
| broom genet genista | |
| camelia | |
| carnation dianthus oeillet | |
| cedar | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chrysanthemum chrysantheme | |
| chypre | |
| citrus | |
| clean | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| currant | |
| cyclamen | |
| date | |
| fern fougere | |
| fixer | |
| floral | |
| fresh | |
| fruit | |
| gooseberry | |
| hay new mown hay foin coupe | |
| herbal | |
| honey miel | |
| hyacinth jacinthe | |
| leather | |
| lemon | |
| lilac lilas syringa | |
| lotus | |
| meadow | |
| mimosa wattle | |
| mint | |
| moss | |
| musk | |
| ocean sea breeze | |
| orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| peach | |
| pine | |
| plum | |
| poppy | |
| poppy red poppy | |
| potpourri | |
| powder | |
| raspberry | |
| rose | |
| rose tea rose | |
| spearmint | |
| spice | |
| strawberry | |
| tuberose tubereuse | |
| vanilla | |
| wallflower giroflee | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| data page | osmanthus absolute @ trace% |