| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | hexahydro-3,5,5-trimethyl-3,8a-ethano-8ah-1-benzopyran-2(3H)-one | |||||||||||||||||||||||
| InChI : | InChI=1/C14H22O2/c1-12(2)5-4-6-14-8-7-13(3,9-10(12)14)11(15)16-14/h10H,4-9H2,1-3H3 | |||||||||||||||||||||||
| InChIKey : | TUVXRDNMAFEUBI-UHFFFAOYAD | |||||||||||||||||||||||
| SMILES : | CC1(CCCC23C1CC(CC2)(C(=O)O3)C)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | 2932.29.6000 | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||
| Symrise : | Lactoscatone | |||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | dry animal amber | |||||||||||||||||||||||
| substantivity : | 52 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 97.00 to 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.04500 to 1.05100 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.695 to 8.745 | |||||||||||||||||||||||
| refractive index : | 1.49300 to 1.49700 @ 20.00 °C. | |||||||||||||||||||||||
| logp : | 3.60 | |||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1600.00 mg/kg | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||
| recommendation for animal carbolactone usage levels up to : | ||||||||||||||||||||||||
| 1.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for animal carbolactone usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 244-310-6 | |||||||||||||||||||||||
| chemidplus : | 021280295 | |||||||||||||||||||||||
| EPA Substance Registry Services : | 21280-29-5 | |||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 21280-29-5 | |||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 21280-29-5 | |||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 21280-29-5 | |||||||||||||||||||||||
| NLM GENetic TOXicology : | 21280-29-5 | |||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| pubchem : | 666245 | |||||||||||||||||||||||
| synonyms : | |
| animal carbolactone | |
| decahydro-2,8,8-trimethyl naphthalene-2,4alpha-carbolactone | |
| hexahydro-3,5,5-trimethyl-3,8a-ethano-8ah-1-benzopyran-2(3H)-one | |
| 1- | hydroxy-4,7,7-trimethyl bicyclo(4.4.0)decane-4-carboxylic acid lactone |
| hydroxy-4,7,7-trimethyl-4-carboxylic acid lactone | |
| lactoscaton | |
| lactoscatone | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| iso | eugenyl acetate |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| indole | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
(odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| azzaro | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| cloth clean cloths | |
| cool water | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| sandalwood | |
| spice | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| not found in nature | |