| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||
| IUPAC name : | 2-[(E)-hex-2-enyl]cyclopentan-1-ol | |||||||||||||||||||||
| InChI : | InChI=1/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h4-5,10-12H,2-3,6-9H2,1H3/b5-4+ | |||||||||||||||||||||
| InChIKey : | OLPVLAJYJZWXPZ-SNAWJCMRBN | |||||||||||||||||||||
| SMILES : | CCC\C=C\CC1CCCC1O | |||||||||||||||||||||
|
| |||||||||||||||||||||
| export tariff code : | 2906.19.5000 | |||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||
| Bedoukian Research : | JASMONOL
≥97.0%, Kosher Odor: floral, waxy | |||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||
| odor description :¹ at 100.00 %. | floral green fruity natural waxy jasmin tropical banana | |||||||||||||||||||||
| odor sample from : | Bedoukian Research, Inc. | |||||||||||||||||||||
| substantivity : | 112 Hour(s) | |||||||||||||||||||||
properties : | ||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||
| assay : | 97.00 to 100.00 % sum of isomers | |||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||
| specific gravity : | 0.90000 to 0.92000 @ 25.00 °C. | |||||||||||||||||||||
| pounds per gallon - calc. : | 7.489 to 7.655 | |||||||||||||||||||||
| refractive index : | 1.46500 to 1.48000 @ 20.00 °C. | |||||||||||||||||||||
| boiling point : | 85.00 °C. @ 2.00 mm Hg | |||||||||||||||||||||
| boiling point : | 80.00 °C. @ 4.00 mm Hg | |||||||||||||||||||||
| vapor pressure : | 0.00200 mm/Hg @ 25.00 °C. | |||||||||||||||||||||
| flash point : | 200.00 °F. TCC ( 93.33 °C. ) | |||||||||||||||||||||
| logP (o/w) : | 3.42 | |||||||||||||||||||||
safety : | ||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||
| recommendation for jasmin cyclopentanol usage levels up to : | ||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||
| recommendation for jasmin cyclopentanol usage levels up to : | ||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||
safety references : | ||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||
| 2-[(E)-hex-2-enyl]cyclopentan-1-ol | ||||||||||||||||||||||
| chemidplus : | 034686674 | |||||||||||||||||||||
| EPA Substance Registry Services : | 34686-67-4 | |||||||||||||||||||||
references : | ||||||||||||||||||||||
| 2-[(E)-hex-2-enyl]cyclopentan-1-ol | ||||||||||||||||||||||
| pubchem : | 694892 | |||||||||||||||||||||
other : | ||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1992)¹ | |||||||||||||||||||||
| synonyms : | |
| 2-[(E)- | hex-2-enyl]cyclopentan-1-ol |
| 2- | hexen-1-yl cyclopentanole |
| 2- | hexenyl cyclopentanol |
| 2-(2- | hexenyl) cyclopentanol |
| 2-(2- | hexenyl)cyclopentanole |
| jasmonol | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| iso | butyl salicylate |
| cedarwood oils | |
| citronella oil | |
| decanol | |
| 9- | decen-1-ol |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl benzyl carbinyl butyrate | |
| floral pyranol | |
| geranium oil | |
| hexyl 2-methyl butyrate | |
| hexyl tiglate | |
| labdanum resinoid | |
| laevo- | linalool |
| melon heptenal | |
| methyl dihydrojasmonate | |
| musks | |
| nerolidol | |
| nonanal | |
| (Z)-6- | nonen-1-al |
| nutmeg oil | |
| ocean propanal | |
| gamma- | octalactone |
| octanol | |
| orange oil | |
| orangeflower absolute | |
| patchouli ethanone | |
| petitgrain oil | |
| phenyl acetaldehyde dimethyl acetal | |
| rose butanoate | |
| santall | |
| tangerine oil | |
| vetiver oil | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
(odor and/or flavor) used in : | |
| acacia | |
| amber | |
| apricot | |
| bayberry | |
| bouquet | |
| cedarwood | |
| cheese blue cheese | |
| citrus | |
| cranberry | |
| dairy | |
| floral | |
| gardenia | |
| grapefruit | |
| grass sweet grass | |
| herbal | |
| honeysuckle chevrefeuille | |
| jasmin | |
| juniperberry | |
| lemon | |
| lilac lilas syringa | |
| lily | |
| melon | |
| melon watermelon muskmelon cantaloupe | |
| milk | |
| muguet lily of the valley | |
| neroli | |
| oakmoss mousse de chene | |
| orange | |
| orange bitter orange | |
| orange blossom fleur d'oranger | |
| orchid | |
| orris iris | |
| peach | |
| pineapple | |
| poppy red poppy | |
| rain | |
| reseda mignonette | |
| rose | |
| rose d'orient | |
| rose red rose | |
| rose white rose | |
| strawberry | |
| tea green tea | |
| tuberose tubereuse | |
| waxy | |
| woody | |
natural occurrence in : | |
| not found in nature | |