Notes :
Gives body and depth.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl 3-phenylprop-2-enoate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2 | |||||||||||||||||||||||||||||||
| InChIKey : | NGHOLYJTSCBCGC-UHFFFAOYAN | |||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)COC(=O)C=CC2=CC=CC=C2 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl (E)-3-phenylprop-2-enoate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+ | |||||||||||||||||||||||||||||||
| InChIKey : | NGHOLYJTSCBCGC-VAWYXSNFBS | |||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)COC(=O)\C=C\C2=CC=CC=C2 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl (Z)-3-phenylprop-2-enoate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11- | |||||||||||||||||||||||||||||||
| SMILES : | O=C(OCc1ccccc1)/C=C\c2ccccc2 | |||||||||||||||||||||||||||||||
|
||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.12.6000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||||||
| odor strength : | low | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet balsam floral fruity cherry | |||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Spicy, floral, fruity, balsamic | |||||||||||||||||||||||||||||||
| substantivity : | 243 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow solid | |||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| melting point : | 37.00 - 39.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 195.00 - 200.00 °C. @ 5.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 228.00 - 230.00 °C. @ 22.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 4.06 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5530.00 gm/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >3000.00 mg/kg | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||||||
| Category 1 : | 0.10 % (1) | Category 2 : | 0.20 % | |||||||||||||||||||||||||||||
| Category 3 : | 0.70 % | Category 4 : | 2.10 % | |||||||||||||||||||||||||||||
| Category 5 : | 1.10 % | Category 6 : | 3.40 % (1) | |||||||||||||||||||||||||||||
| Category 7 : | 0.40 % | Category 8 : | 2.00 % | |||||||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case benzyl cinnamate) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||||||
| recommendation for benzyl cinnamate usage levels up to : | ||||||||||||||||||||||||||||||||
| 120.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 203-109-3 | |||||||||||||||||||||||||||||||
| rtecs : | GD8400000 for 103-41-3 | |||||||||||||||||||||||||||||||
| chemidplus : | 103-41-3 | |||||||||||||||||||||||||||||||
| epa-srs : | 103-41-3 | |||||||||||||||||||||||||||||||
| dtp/nci : | 11780 | |||||||||||||||||||||||||||||||
| chemidplus : | 000103413 | |||||||||||||||||||||||||||||||
| epa-srs : | 103-41-3 | |||||||||||||||||||||||||||||||
| chemidplus : | 103-41-3 | |||||||||||||||||||||||||||||||
| epa-srs : | 103-41-3 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 76633 | |||||||||||||||||||||||||||||||
| pubchem : | 150734 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1930632504 | |||||||||||||||||||||||||||||||
| pubchem : | 103-41-3 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 17, No. 1, 41, (1992)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl 3-phenyl propenoate | |
| benzyl alcohol cinnamate | |
| benzyl alcohol cinnamic ester | |
| benzyl beta-phenyl acrylate | |
| benzyl cinnamate | |
| (E)- | benzyl cinnamate |
| trans- | benzyl cinnamate |
| benzyl gamma-phenyl acrylate | |
| benzyl-3-phenyl propenoate | |
| cinnamein | |
| (E)- | cinnamic acid benzyl ester |
| trans- | cinnamic acid benzyl ester |
| phenyl methyl 3-phenyl-2-propenoate | |
| 3- | phenyl-2-propenoic acid phenyl methyl ester |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| fixed oils | |
| water, 9 mg/L @ 25C | |
| insoluble in : | |
| glycerin | |
| propylene glycol | |
| water | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bois de rose oil | |
| cassia bark oil | |
| cedarwood oils | |
| citronellyl acetate | |
| coriander seed oil | |
| costus valerolactone | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| green acetate | |
| heliotropin | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| ionones | |
| lavender absolute | |
| lavender oil | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| ocean propanal | |
| osmanthus absolute | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| strawberry glycidate 1 | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| almond blossom | |
| amber | |
| ambreine | |
| apple | |
| apple blossom | |
| apricot | |
| balsam | |
| benzoin | |
| berry | |
| blossom tropical blossom | |
| boronia | |
| bouquet | |
| butterscotch | |
| cabreuva | |
| caramel | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| chocolate | |
| clover trefle le'trefle incarnat | |
| cologne | |
| cookie | |
| copaiba | |
| crabapple blossom | |
| cranberry | |
| currant | |
| evergreen | |
| fern fougere | |
| fir balsam | |
| fixer | |
| floral | |
| fruit | |
| gooseberry | |
| hawthorn | |
| heliotrope | |
| honey miel | |
| honeysuckle chevrefeuille | |
| iris blossom | |
| jackfruit | |
| labdanum | |
| lavender | |
| lavender water | |
| loganberry dewberry | |
| malt | |
| mango blossom | |
| melon | |
| melon watermelon muskmelon cantaloupe | |
| muguet lily of the valley | |
| orchid | |
| oriental | |
| peach | |
| peach blossom | |
| pear blossom | |
| peru balsam | |
| petal flower petal | |
| pineapple | |
| plum | |
| poppy red poppy | |
| powder | |
| prune | |
| raspberry | |
| reseda mignonette | |
| rose | |
| rum | |
| strawberry | |
| sweet pea pois de senteur | |
| toffee | |
| tolu balsam | |
| vanilla | |
| violet | |
| wistaria wisteria glycine | |
| natural occurrence in : | |
| data page | cabreuva oil @ 28.38-31.92% |
| copaiba balsam | |
| data page | cumin seed oil turkey @ trace% |
| peru balsam | |
| styrax | |
| tolu balsam | |
| data page | ylang ylang oil CO2 extract @ 0.04% |