Notes :
Adds a modern sparkle to any Fragrance.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | prop-2-enyl 2-(3-methylbutoxy)acetate | |||||||||||||||||||||||||
| InChI : | InChI=1/C10H18O3/c1-4-6-13-10(11)8-12-7-5-9(2)3/h4,9H,1,5-8H2,2-3H3 | |||||||||||||||||||||||||
| InChIKey : | XCWPXUNHSPOFGV-UHFFFAOYAP | |||||||||||||||||||||||||
| SMILES : | CC(C)CCOCC(=O)OCC=C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| IUPAC name : | prop-2-enyl 2-(2-methylbutoxy)acetate | |||||||||||||||||||||||||
| InChI : | InChI=1/C10H18O3/c1-4-6-13-10(11)8-12-7-9(3)5-2/h4,9H,1,5-8H2,2-3H3 | |||||||||||||||||||||||||
| InChIKey : | GWFJURKHPPFFMD-UHFFFAOYAI | |||||||||||||||||||||||||
| SMILES : | CCC(C)COCC(=O)OCC=C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2918.90.3500 | |||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | fruity green galbanum pineapple | |||||||||||||||||||||||||
| substantivity : | 84 Hour(s) | |||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.93500 - 0.94300 @ 25.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.780 to 7.847 | |||||||||||||||||||||||||
| specific gravity : | 0.93600 - 0.94400 @ 20.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.798 to 7.864 | |||||||||||||||||||||||||
| refractive index : | 1.42800 - 1.43300 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 201.00 - 203.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| logp : | 2.72 | |||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||
| IFRA purity specification : | < 0.1% free allyl alcohol | |||||||||||||||||||||||||
| recommendation for allyl amyl glycolate usage levels up to : | ||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for allyl amyl glycolate usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||
| (EINECS) number : | 266-803-5 | |||||||||||||||||||||||||
| chemidplus : | 067634008 | |||||||||||||||||||||||||
| epa-srs : | 67634-00-8 | |||||||||||||||||||||||||
| (EINECS) number : | 266-804-0 | |||||||||||||||||||||||||
| chemidplus : | 067634019 | |||||||||||||||||||||||||
| epa-srs : | 67634-01-9 | |||||||||||||||||||||||||
| ifra : | ifra - ( Found under : Allyl esters ) | |||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||
| pubchem : | 683955 | |||||||||||||||||||||||||
| pubchem : | 683956 | |||||||||||||||||||||||||
| synonyms : | |
| allyl (3-methyl butoxy) acetate | |
| allyl amyl glycolate | |
| allyl isoamyl glycolate | |
| allyl isoamyl oxyacetate | |
| iso | amyl oxyacetic acid allyl ester |
| galbanum glycolate | |
| glycolic acid 2-pentoxyallyl ester | |
| 2- | propen-1-yl (3-methyl butoxy) acetate |
| 2- | propenyl (3-methyl butoxy) acetate |
| 2- | propenyl 2-((3-methyl butyl)oxy) ethanoate |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| galbanum oil | |
| galbanum oxyacetate | |
| geraniol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| 2,4- | ivy carbaldehyde |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| alliage | |
| apple | |
| apple red apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| bramble arctic bramble | |
| chamomile | |
| christmas blends | |
| chypre | |
| cloudberry bakeapple | |
| coconut tropical coconut | |
| cool water | |
| drakkar | |
| eternity | |
| fern fougere | |
| fig | |
| floral | |
| fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| galbanum | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| jasmin | |
| lavender | |
| lilac lilas syringa | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| papaya | |
| passion fruit | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| plum mirabelle plum | |
| pomegranate | |
| quince | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tomato | |
| tresor | |
| tropical | |
| tutti frutti | |
| natural occurrence in : | |
| not found in nature | |