Notes :
A good general purpose non-distinct fruit note. Adds "juicyness". Very good modifier for diacetyl in butterscotch. Add to grain alcohol for fixer.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl heptanoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H18O2/c1-3-5-6-7-8-9(10)11-4-2/h3-8H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | TVQGDYNRXLTQAP-UHFFFAOYAW | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCCCC(=O)OCC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.90.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fruity pineapple cognac rum wine | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 20.00 ppm. Fruity, pineapple, banana and strawberry with a spicy, oily nuance | |||||||||||||||||||||||||||||||||||
| substantivity : | 56 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.86700 - 0.87200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.214 to 7.256 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.41100 - 1.41500 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -66.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 188.00 - 189.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 3.32 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >34640.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 19,247,1981 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 151.00 °F. TCC ( 66.11 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for ethyl heptanoate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for ethyl heptanoate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 35.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-382-9 | |||||||||||||||||||||||||||||||||||
| rtecs : | MJ2087000 for 106-30-9 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000106309 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 106-30-9 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8891 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150891 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 954101375 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 22, No. 2, 69, (1997)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| enanthylic ether | |
| ethyl capronate | |
| ethyl enanthate | |
| ethyl heptanoate | |
| ethyl heptoate | |
| ethyl heptylate | |
| ethyl N-heptanoate | |
| ethyl oenanthate | |
| ethyl oenanthylate | |
| oenanthic ether | |
| soluble in : | |
| fixed oils | |
| paraffin oil | |
| water, 290 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| bath foam | |
| cream | |
| hair spray | |
| lipstick | |
| lotion | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| benzaldehyde | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cinnamyl alcohol | |
| citronellyl acetate | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanal | |
| diethyl malonate | |
| dihydroanethol | |
| ethyl (E,Z)-2,4-decadienoate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| fennel seed oil | |
| fir needle oil | |
| floral pyranol | |
| gardenia oxide | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl isovalerate | |
| hexyl tiglate | |
| hyacinth ether | |
| ionones | |
| leaf acetal | |
| leerall | |
| lemon oil | |
| lime oil | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| litsea cubeba oil | |
| melon heptenal | |
| melon nonenoate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| beta- | naphthyl ethyl ether |
| neryl acetate | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanal | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| octanal | |
| (Z)-5- | octen-1-ol |
| orange oil | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propyl alcohol |
| strawberry furanone | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| tangerine oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| verbena oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| apple | |
| apple blossom | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arrack | |
| banana | |
| basil | |
| beer | |
| berry | |
| blackberry | |
| blossom tropical blossom | |
| brandy | |
| briar sweet briar eglantine | |
| butter | |
| butterscotch | |
| cherry | |
| cherry blossom | |
| cherry brandy | |
| chocolate cacao | |
| cider | |
| citrus | |
| cloudberry bakeapple | |
| coconut | |
| coffee | |
| cognac | |
| colonia | |
| crabapple blossom | |
| curacao | |
| exotic | |
| fern fougere | |
| fig | |
| fixer | |
| frangipanni plumeria | |
| fruit | |
| ginger | |
| ginger ale | |
| gooseberry | |
| grape | |
| grapefruit | |
| grass green grass | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hops houblon | |
| iris blossom | |
| jackfruit | |
| kiwi | |
| kiwi blossom | |
| kumquat | |
| licorice | |
| linden blossom limeflower tilleul | |
| lotus | |
| lychee soapberry | |
| mango | |
| mango blossom | |
| marigold tagete | |
| melon watermelon muskmelon cantaloupe | |
| mulberry | |
| nectarine | |
| new car | |
| nut pistachio | |
| nut walnut | |
| orange | |
| orchid | |
| orris iris | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear blossom | |
| pineapple | |
| plum blossom | |
| plum greengage plum | |
| plum mirabelle plum | |
| plum mirabille blossom | |
| pomegranate | |
| quince | |
| raspberry | |
| reseda mignonette | |
| rose wild rose | |
| rum | |
| rum butter rum | |
| spearmint | |
| starfruit | |
| strawberry | |
| tangerine | |
| tea | |
| tea green tea | |
| toffee | |
| topnotes | |
| tropical | |
| tutti frutti | |
| verbena verveine | |
| wine | |
| natural occurrence in : | |
| beer | |
| brandy apple brandy | |
| grapefruit juice | |
| pea | |
| rum | |
| vegetables | |
| whiskey | |
| whiskey bourbon whiskey | |
| whiskey scotch whiskey | |