Notes :
To produce a seemingly natural freshness.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 1,1-dimethoxypropan-2-ylbenzene | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H16O2/c1-9(11(12-2)13-3)10-7-5-4-6-8-10/h4-9,11H,1-3H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | UFOUDYPOSJJEDJ-UHFFFAOYAK | |||||||||||||||||||||||||||||||||
| SMILES : | COC(OC)C(C)c1ccccc1 | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2911.00.5000 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| International Flavors & Fragrances : | Hydratropic Aldehyde Dimethyl Acetal | |||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | 2-Phenylpropionaldehyde dimethyl acetal | |||||||||||||||||||||||||||||||||
| ≥97%, FCC | ||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | floral leafy hyacinth green mushroom earthy walnut | |||||||||||||||||||||||||||||||||
| substantivity : | 12 Hour(s) | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.98900 - 0.99700 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.229 to 8.296 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.99000 - 0.99800 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.247 to 8.314 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.49200 - 1.49700 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 111.00 - 112.00 °C. @ 12.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 240.00 - 241.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 2.58 | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1850.00 mg/kg FCTXAV 17,819,1979 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 17,819,1979 | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 4.30 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-USA) : | 3.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 198.00 °F. TCC ( 92.22 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for 2-phenyl propionaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for 2-phenyl propionaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||
| 25.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-022-8 | |||||||||||||||||||||||||||||||||
| rtecs : | MU6480000 for 90-87-9 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000090879 | |||||||||||||||||||||||||||||||||
| epa-srs : | 90-87-9 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 46115 | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 1468 | |||||||||||||||||||||||||||||||||
| fl. number : | 06.030 | |||||||||||||||||||||||||||||||||
| pubchem : | 203618 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2752614940 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| (2,2- | dimethoxy-1-methyl ethyl) benzene |
| (2,2- | dimethoxy-1-methylethyl)benzene |
| 1,1- | dimethoxy-2-phenyl propane |
| 1,1- | dimethoxy-2-phenylpropane |
| 1,1- | dimethoxyphenyl propane |
| 1,1- | dimethoxypropan-2-ylbenzene |
| hydratropaldehyde dimethyl acetal | |
| hydratropic aldehyde dimethyl acetal | |
| hydrotropic aldehyde dimethyl acetal | |
| alpha- | methyl phenacetaldehyde dimethyl acetal |
| alpha- | methylphenacetaldehyde dimethyl acetal |
| 2- | phenyl propanal dimethyl acetal |
| 2- | phenyl propionaldehyde dimethyl acetal |
| 2- | phenylpropanal dimethyl acetal |
| 2- | phenylpropanal dimethylacetal |
| 2- | phenylpropionaldehyde dimethyl acetal |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| alkalis | |
| antiperspirant | |
| bleach | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl propionate | |
| benzyl salicylate | |
| bois de rose oil | |
| cinnamyl alcohol | |
| citronellol | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| 9- | decen-1-ol |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| ethyl laurate | |
| ethyl vanillin | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| green acetate | |
| heliotropin | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose butanoate | |
| 10- | undecen-1-al |
| (odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| artichoke | |
| berry | |
| blackberry | |
| broom genet genista | |
| carnation dianthus oeillet | |
| cherry | |
| cherry blossom | |
| chocolate cocoa | |
| cinq fleurs forvil | |
| crabapple blossom | |
| elderberry | |
| evergreen | |
| floral | |
| flower | |
| frangipanni plumeria | |
| fresh | |
| fruit | |
| gardenia | |
| grapefruit | |
| green | |
| honey miel | |
| hyacinth jacinthe | |
| jasmin | |
| jockey club | |
| jonquil narcissus jonquilla | |
| joy | |
| leaf | |
| lilac lilas syringa | |
| lily | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mushroom | |
| narcissus narcisse | |
| neroli | |
| nut | |
| nut walnut | |
| orange | |
| peach | |
| pear | |
| plum | |
| powder | |
| pumpkin | |
| raspberry | |
| rose | |
| rose tea rose | |
| sweet pea pois de senteur | |
| tamarind | |
| tea | |
| tea green tea | |
| tobacco tabac tabaco | |
| tutti frutti | |
| verbena verveine | |
| wallflower giroflee | |
| natural occurrence in : | |
| not found in nature | |