| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carbaldehyde |
| InChI : | InChI=1/C13H20O/c1-13(2)7-3-4-11-6-5-10(9-14)8-12(11)13/h9-10H,3-8H2,1-2H3 |
| InChIKey : | AQJANVUPNABWRU-UHFFFAOYAK |
| SMILES : | CC1(CCCC2=C1CC(CC2)C=O)C |
| (EINECS) number : | 273-661-8 |
| cas number : | 68991-97-9 |
| molar refractivity : | 57.93 ± 0.4 cm3 |
| parachor : | 474.9 ± 6.0 cm3 |
| index of refraction : | 1.499 ± 0.03 |
| surface tension : | 33.7 ± 5.0 dyne/cm |
| density : | 0.97 ± 0.1 g/cm3 |
| polarizability : | 22.96 ± 0.5 10-24cm3 |
| xlogp : | 3.40 |
| molecular weight : | 192.2973000 |
| formula : | C13 H20 O |
|
|
| |
| |
| fda reg : | unspecified |
h. number : | 2912.29.0000 |
| organoleptics : | |
| odor type : | floral |
| odor strength : | medium |
odor description :
at 100.00 %. | floral clean ozone marine muguet fruity |
| substantivity : | 140 Hour(s) |
| properties : | |
| appearence : | colorless clear liquid |
| assay : | 93.00 - 100.00 % sum of isomers
|
| Food Chemicals Codex Listed : | Yes |
| specific gravity : | 0.99200 - 1.00000 @ 25.00 °C.
|
| pounds per gallon - calc. : | 8.254 to 8.321
|
| specific gravity : | 9.93000 - 1.00100 @ 20.00 °C.
|
| pounds per gallon - calc. : | 82.724 to 8.339
|
| refractive index : | 1.50200 - 1.50800 @ 20.00 °C.
|
| boiling point : | 276.00 - 277.00 °C. @ 760.00 mm Hg
|
| logp : | 4.24 |
| safety : | |
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. )
|
| | |
| recommendation for muguet carboxaldehyde usage levels up to : | | | 15.0000 % in the fragrance concentrate.
|
| | |
| recommendation for muguet carboxaldehyde usage levels up to : | | | not for flavor use.
|
| | |
| safety links : | |
| (EINECS) number : | 273-661-8 |
| chemidplus : | 068991979 |
| epa-srs : | 68991-97-9 |
| | |
| other : | |
| |
|
| references : | |
| pubchem : | 689507 |
| | |
|
| synonyms : |
| | cyclemone a | | | cyclomugual | | 8,8- | dimethyl-1,2,3,4,5,6,7,8-octahydro-2-naphthaldehyde | | 8,8- | dimethyl-1,2,3,4,5,6,7,8-octahydro-2-naphthalene carboxaldehyde | | | melafleur | | | muguet carboxaldehyde | | | octahydro-8,8-dimethyl-2-naphthaldehyde | | 1,2,3,4,5,6,7,8- | octahydro-8,8-dimethyl-2-naphthaldehyde | | 1,2,3,4,5,6,7,8- | octahydro-8,8-dimethyl-2-naphthalene carboxaldehyde |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| stability : |
| | alcoholic lotion | | | antiperspirant | | | detergent | | | fabric softener | | | shampoo | | | soap |
| (odor and/or flavor) blends with : |
| | acetaldehyde ethyl phenethyl acetal |
| | algae absolute |
| | allyl amyl glycolate |
| | amber carbinol |
| | ambrette seed oil |
| | ambroxan |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| | amyris wood oil |
| | angelica root oil |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| | bay leaf oil |
| | benzoin resinoid |
| | benzophenone |
| | benzyl acetate |
| | benzyl alcohol |
| | benzyl benzoate |
| | benzyl isoeugenol |
| | benzyl propionate |
| | benzyl salicylate |
| | bergamot oil |
| | bois de rose oil |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| iso | butyl salicylate |
| | carrot seed oil |
| | cedarwood oils |
| | cinnamyl alcohol |
| | cistus oil |
| | citronellol |
| | clary sage oil |
| | clover nitrile |
| | coriander seed oil |
| | cortex pyridine |
| | coumarin |
| | cuminaldehyde |
| | cyclamen aldehyde |
| | cyclohexyl ethyl alcohol |
| gamma- | decalactone |
| | decanol |
| 9- | decen-1-ol |
| | decyl acetate |
| | dimethyl anthranilate |
| | dimethyl benzyl carbinol |
| | dimethyl benzyl carbinyl acetate |
| | dimethyl benzyl carbinyl butyrate |
| | diphenyl oxide |
| | dodecanal |
| | dodecanol |
| | ethyl cinnamate |
| | ethyl laurate |
| | ethyl vanillin |
| | fir balsam absolute |
| | fir needle oil |
| | floral pyranol |
| | frankincense oil |
| | galbanum oil |
| | gardenia oxide |
| | geraniol |
| | grapefruit pentanol |
| | green acetate |
| | guaiacwood oil |
| | gurjun balsam oil |
| | hay absolute |
| | heliotropin |
| | heliotropyl diethyl acetal |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| alpha- | hexyl cinnamaldehyde |
| | hexyl tiglate |
| | ho leaf oil |
| | hyacinth ether |
| | hydroxycitronellal |
| | ionones |
| | labdanum resinoid |
| | lavender absolute |
| | leaf acetal |
| | leerall |
| | linalool |
| laevo- | linalool |
| | linalool oxide |
| | linalyl acetate |
| | marine pyridine |
| | melon heptenal |
| | melon nonenoate |
| | methyl anthranilate |
| | methyl cedryl ketone |
| | methyl cinnamate |
| | methyl dihydrojasmonate |
| | methyl heptine carbonate |
| | methyl ionones |
| | methyl isoeugenol |
| | methyl octine carbonate |
| | methyl undecylenate |
| | mimosa absolute |
| | muguet octadienol |
| | musks |
| beta- | naphthyl ethyl ether |
| | narcissus absolute |
| | nerol |
| (E,Z)-2,6- | nonadien-1-ol |
| | nonanal |
| | nonanol |
| (Z)-6- | nonen-1-al |
| | oakmoss absolute |
| | ocean propanal |
| gamma- | octalactone |
| (Z)-5- | octen-1-ol |
| | orris pyridine |
| | patchouli ethanone |
| | patchouli oil |
| | peony alcohol |
| | phenethyl acetate |
| | phenethyl alcohol |
| | phenethyl phenyl acetate |
| | phenethyl salicylate |
| | phenyl acetaldehyde dimethyl acetal |
| 3- | phenyl propionaldehyde |
| | raspberry ketone |
| | raspberry ketone acetate |
| | raspberry ketone methyl ether |
| | rhodinol |
| | rose butanoate |
| | rose oxides |
| | santall |
| | styralyl acetate |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| | tetrahydrolinalool |
| | tetrahydromyrcenol |
| | tobacco dodecane |
| | tonka bean absolute |
| gamma- | undecalactone |
| | undecanol |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| | vanillyl acetate |
| | verymoss |
| | vetiver oil |
| | violet leaf absolute |
| | violet methyl carbonate |
| | watermelon ketone |
| | woody acetate |
| | woody amylene |
| | ylang ylang oil |
| (odor and/or flavor) used in : |
| | agrumen | | | aldehydic | | | algae | | | animal | | | apple | | | apple crabapple | | | apple green apple | | | ash mountain ash | | | avocado | | | azalea | | | balsam | | | blossom tropical blossom | | | boronia | | | bouquet | | | boxwood | | | boxwood blossom | | | boxwoodberry | | | boysenberry | | | bramble arctic bramble blackberry | | | broom genet genista | | | burberry | | | calamus | | | candy cotton candy | | | carnation dianthus oeillet | | | cassis black currant bud | | | cedar forest | | | celery | | | champaca champak | | | cherry blossom | | | cherry wild cherry | | | chestnut blossom | | | chocolate cacao | | | chypre | | | citrus | | | clean | | | clematis | | | cloudberry bakeapple | | | clover trefle le'trefle incarnat | | | coconut | | | colonia | | | cortex | | | crabapple blossom | | | cucumber | | | curacao | | | cyclamen | | | daffodil narcissus | | | elder blossom | | | elderberry | | | fantasy blends | | | fern fougere | | | fetes | | | fig | | | fir balsam | | | fir needle | | | floral | | | foliage | | | freesia | | | fruit tropical fruit | | | ginger white ginger | | | gooseberry | | | grass sweet grass | | | green | | | guava | | | habuba | | | heather | | | herbal | | | hibiscus | | | honey miel | | | hyacinth jacinthe | | | hydrangea | | | jackfruit | | | jasmin | | | jonquil narcissus jonquilla | | | kewda | | | kiwi | | | kiwi blossom | | | leather | | | lemon | | | lily | | | linden blossom limeflower tilleul | | | lotus | | | lovage | | | magnolia | | | mango | | | mango blossom | | | meadow | | | melon | | | melon watermelon muskmelon cantaloupe | | | millefleurs | | | mimosa wattle | | | moss | | | muguet lily of the valley | | | mulberry | | | musk | | | narcissus narcisse | | | new car | | | ocean sea | | | orchid | | | outdoors fresh outdoors | | | ozone | | | pansy | | | passion blossom | | | peach | | | peach blossom | | | pear | | | pear blossom | | | pear prickly pear | | | peony | | | petunia | | | plum | | | plum blossom | | | poppy | | | privet blossom | | | quince | | | rain | | | reseda mignonette | | | rhubarb | | | rose | | | rose tea rose | | | rose white rose | | | sandalwood | | | savin | | | starfruit | | | stephanotis | | | stock evening scented stock | | | toffee | | | tropical | | | tulip | | | vanilla | | | verbena verveine | | | wallflower giroflee | | | wintergreen | | | wistaria wisteria glycine | | | woody | | | yew |
| natural occurrence in : |
| not found in nature |
|