| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | 4-propan-2-ylquinoline | |||||||||||||||||||||||||||
| InChI : | InChI=1/C12H13N/c1-9(2)10-7-8-13-12-6-4-3-5-11(10)12/h3-9H,1-2H3 | |||||||||||||||||||||||||||
| InChIKey : | HFYWOOUKPVJGBA-UHFFFAOYAN | |||||||||||||||||||||||||||
| SMILES : | CC(C)C1=CC=NC2=CC=CC=C12 | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Vigon : | Isopropyl Quinoline
Odor: EARTHY, WOODY, ROOT-LIKE | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | green metallic earthy leafy | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | pale yellow to yellow clear liquid | |||||||||||||||||||||||||||
| assay : | 97.00 to 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| boiling point : | 277.00 to 279.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| vapor pressure : | 0.01000 mm/Hg @ 20.00 °C. | |||||||||||||||||||||||||||
| vapor density : | >1 ( Air = 1 ) | |||||||||||||||||||||||||||
| flash point : | 238.00 °F. TCC ( 114.44 °C. ) | |||||||||||||||||||||||||||
| logP (o/w) : | 3.42 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | T - Toxic. | |||||||||||||||||||||||||||
|
R 22 - Harmful if swallowed. R 38 - Irritating to skin. S 02 - Keep out of the reach of children. S 20/21 - When using do not eat, drink or smoke. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 37/39 - Wear suitable gloves and eye/face protection. | ||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Oral-Rat 940.00 mg/kg Food and Cosmetics Toxicology. Vol. 13, Pg. 821, 1975. | ||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Skin-Rabbit 160.00 mg/kg Food and Cosmetics Toxicology. Vol. 13, Pg. 821, 1975. | ||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||
| recommendation for 4-isopropyl quinoline usage levels up to : | ||||||||||||||||||||||||||||
| 0.2000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||
| WISER : | UN 2810 | |||||||||||||||||||||||||||
| WGK Germany : | 3 | |||||||||||||||||||||||||||
| 4-propan-2-ylquinoline | ||||||||||||||||||||||||||||
| (EINECS) number : | 215-595-4 | |||||||||||||||||||||||||||
| chemidplus : | 001333535 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 1333-53-5 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| 4-propan-2-ylquinoline | ||||||||||||||||||||||||||||
| fl. number : | 14.153 | |||||||||||||||||||||||||||
| pubchem : | 216236 | |||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||
| synonyms : | |
| lichenol | |
| (1- | methyl ethyl) quinoline |
| 4- | propan-2-ylquinoline |
| para-iso | propyl quinoline |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetaldehyde butyl phenethyl acetal | |
| acetaldehyde ethyl phenethyl acetal | |
| allyl nonanoate | |
| anisyl propanal / methyl anthranilate schiff's base | |
| benzyl disulfide | |
| 2-iso | butyl thiazole |
| cumin acetaldehyde | |
| dimethyl benzyl carbinol | |
| diphenyl oxide | |
| ethyl 3-hexenoate | |
| fresh carbaldehyde | |
| galbanum oleoresin | |
| green ether | |
| 1- | hepten-3-ol |
| herbal heptane | |
| 2- | hexen-1-al |
| (E)-2- | hexen-1-ol |
| 2- | hexen-1-ol |
| (E)-2- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl lactate |
| (Z)-3- | hexen-1-yl octanoate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl heptanoate | |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| 2,4- | ivy carbaldehyde |
| 3,6- | ivy carbaldehyde |
| ivy dioxolane | |
| leafy acetal | |
| linalool oxide | |
| methyl heptine carbonate | |
| 3- | methyl-3-pentanol |
| (E,Z)-2,6- | nonadien-1-yl acetate |
| ocean propanal / methyl anthranilate schiff's base | |
| (E)-2- | octen-1-al |
| (Z)-5- | octen-1-yl propionate |
| octyl acetate | |
| orangeflower absolute | |
| petitgrain combava oil | |
| phenethyl butyl ether | |
| phenyl acetaldehyde diisobutyl acetal | |
| 2- | phenyl propyl acetate |
| propyl cinnamate | |
| iso | propyl phenyl propionaldehyde |
| 2-iso | propyl pyridine |
| iso | propyl quinoline |
| iso | pulegyl formate |
| rose leaf absolute | |
| rosemary oleoresin | |
| tetrahydrofurfuryl cinnamate | |
(odor and/or flavor) used in : | |
| agrumen | |
| algae | |
| amaryllis | |
| apple green apple | |
| artichoke | |
| asafoetida | |
| asparagus | |
| avocado | |
| basil | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| cajuput | |
| carrot | |
| carrot seed | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| celery | |
| cilantro | |
| clematis | |
| cognac | |
| cortex | |
| costus | |
| cucumber | |
| daffodil narcissus | |
| elemi | |
| evergreen | |
| fennel | |
| fern fougere | |
| fig | |
| fir | |
| fir balsam | |
| foliage | |
| galbanum | |
| geranium | |
| grass | |
| grass green grass | |
| green | |
| guava | |
| hops houblon | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jonquil narcissus jonquilla | |
| leaf | |
| leaf green leaf | |
| lettuce | |
| liverwort | |
| lotus | |
| marjoram | |
| mimosa wattle | |
| narcissus narcisse | |
| oregano | |
| pansy | |
| parsley | |
| pea green pea | |
| pear prickly pear | |
| pepper bell pepper | |
| pine scotch pine | |
| privet | |
| privet blossom | |
| reseda mignonette | |
| rhubarb | |
| rootbeer | |
| rose geranium | |
| rose leaf | |
| stem | |
| strawberry leaf | |
| tomato | |
| tomato leaf | |
| valerian | |
| vegetable | |
| vegetation tropical hothouse vegetation | |
| vine | |
| violet leaf | |
| weedy | |
| wintergreen | |
| wormwood absinthium | |
| yew | |
natural occurrence in : | |
| not found in nature | |