| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 2-phenylethyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C15H14O3/c16-14-9-5-4-8-13(14)15(17)18-11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2 | |||||||||||||||||||||||||||||||
| InChIKey : | YNMSDIQQNIRGDP-UHFFFAOYAX | |||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)CCOC(=O)C2=CC=CC=C2O | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2918.23.0000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||
| odor strength : | low | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | balsam floral rose hyacinth carnation | |||||||||||||||||||||||||||||||
| substantivity : | 232 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| melting point : | 39.00 - 41.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 370.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 4.31 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for phenethyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for phenethyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||
| 15.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 201-732-5 | |||||||||||||||||||||||||||||||
| chemidplus : | 000087229 | |||||||||||||||||||||||||||||||
| epa-srs : | 87-22-9 | |||||||||||||||||||||||||||||||
| dtp/nci : | 72035 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| jecfa number : | 905 | |||||||||||||||||||||||||||||||
| fl. number : | 09.753 | |||||||||||||||||||||||||||||||
| pubchem : | 203612 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 518388908 | |||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl carbinyl 2-hydroxybenzoate | |
| benzyl carbinyl salicylate | |
| 2- | hydroxybenzoic acid 2-phenethyl ester |
| 2- | hydroxybenzoic acid 2-phenyl ethyl ester |
| phenethyl salicylate | |
| 2- | phenyl ethyl 2-hydroxybenzoate |
| 2- | phenyl ethyl salicylate |
| salicylic acid phenethyl ester | |
| salicylic acid phenyl ethyl ester | |
| soluble in : | |
| alcohol | |
| paraffin oil | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| cinnamyl alcohol | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| ethyl cinnamate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| gardenia oxide | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| leerall | |
| linalool oxide | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| santall | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| alpine bouquet | |
| amber | |
| apricot | |
| artichoke | |
| ash mountain ash | |
| asparagus | |
| azalea | |
| balsam | |
| bark | |
| bayberry | |
| bouquet | |
| broom genet genista | |
| cabreuva | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| chestnut blossom | |
| cilantro | |
| clematis | |
| clover trefle le'trefle incarnat | |
| coronilla | |
| crabapple blossom | |
| cucumber | |
| cyclamen | |
| daffodil narcissus | |
| earth humus | |
| elder blossom | |
| fern fougere | |
| fir balsam | |
| fixer | |
| freesia | |
| gardenia | |
| hawthorn | |
| heather | |
| herbal | |
| honeysuckle chevrefeuille | |
| hugonia | |
| hyacinth jacinthe | |
| incense | |
| kewda | |
| leaf autumn leaf | |
| leather | |
| lettuce | |
| lilac lilas syringa | |
| lily | |
| lotus | |
| meadow | |
| mimosa wattle | |
| muguet lily of the valley | |
| narcissus narcisse | |
| orchid | |
| pansy | |
| peach | |
| pear prickly pear | |
| petunia | |
| pineapple | |
| poppy | |
| poppy red poppy | |
| privet blossom | |
| redwood | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose tea rose | |
| stephanotis | |
| stock evening scented stock | |
| styrax | |
| sweet pea pois de senteur | |
| tea | |
| tuberose tubereuse | |
| violet leaf | |
| wintergreen | |
| woody | |
| yew | |
| ylang ylang cananga | |
| natural occurrence in : | |
| not found in nature | |