| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2-butan-2-yl-4,5-dimethyl-2,5-dihydro-1,3-thiazole |
| InChI : | InChI=1/C9H17NS/c1-5-6(2)9-10-7(3)8(4)11-9/h6,8-9H,5H2,1-4H3 |
| InChIKey : | FLBOQJFNAYJWIA-UHFFFAOYAO |
| SMILES : | CCC(C)C1N=C(C(S1)C)C |
| (EINECS) number : | 265-968-0 |
| cas number : | 65894-82-8 |
| fema number : | 3619 |
| jecfa number : | 1059 |
| fl. number : | 15.029 |
| molar refractivity : | 51.59 ± 0.5 cm3 |
| parachor : | 386.2 ± 8.0 cm3 |
| index of refraction : | 1.539 ± 0.05 |
| surface tension : | 30.3 ± 7.0 dyne/cm |
| density : | 1.04 ± 0.1 g/cm3 |
| polarizability : | 20.45 ± 0.5 10-24cm3 |
| xlogp : | 2.30 |
| molecular weight : | 171.3029800 |
| formula : | C9 H17 N S |
|
|
| |
| |
| fda reg : | unspecified |
h. number : | 2934.10.0000 |
| organoleptics : | |
| odor type : | meaty |
| odor strength : | high ,
recommend smelling in a 0.10 % solution or less |
odor description :
at 0.10 % in dipropylene glycol. | meaty spicy vegetable |
| properties : | |
| appearence : | pale yellow clear liquid |
| assay : | 98.00 - 100.00 % sum of isomers
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.95000 - 0.95500 @ 25.00 °C.
|
| pounds per gallon - calc. : | 7.905 to 7.947
|
| refractive index : | 1.48300 - 1.48800 @ 20.00 °C.
|
| boiling point : | 71.00 °C. @ 4.00 mm Hg
|
| boiling point : | 228.00 - 230.00 °C. @ 760.00 mm Hg
|
| logp : | 3.95 |
| safety : | |
| Oral Toxicity(LD50) : |
Oral-Mouse 2827.00 mg/kg
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 202.00 °F. TCC ( 94.44 °C. )
|
| | |
| recommendation for 2-(2-butyl)-4,5-dimethyl-3-thiazoline usage levels up to : | | | 0.0500 % in the fragrance concentrate.
|
| | |
| safety links : | |
| (EINECS) number : | 265-968-0 |
| chemidplus : | 065894828 |
| epa-srs : | 65894-82-8 |
| | |
| other : | |
| |
|
| references : | |
| jecfa number : | 1059 |
| fl. number : | 15.029 |
| pubchem : | 198978 |
| | |
|
| synonyms : |
| 2- | butan-2-yl-4,5-dimethyl-2,5-dihydro-1,3-thiazole | | 2-sec- | butyl-4,5-dimethyl-2,5-dihydrothiazole | | 2-(2- | butyl)-4,5-dimethyl-3-thiazoline | | 2-(sec- | butyl)-4,5-dimethyl-3-thiazoline | | 2,5- | dihydro-4,5-dimethyl-2-(1-methyl propyl) thiazole | | 2,5- | dihydro-4,5-dimethyl-2-1-methyl propyl thiazole |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| 4- | acetyl-2-methyl pyrimidine |
| 2- | acetyl-3-methyl pyrazine |
| 4- | allyl-2,6-dimethoxyphenol |
| 4- | aminobutyric acid |
| | amyl mercaptan |
| | asafetida oil |
| | bacon dithiazine |
| | benzothiazole |
| 1,3- | butane dithiol |
| 2,3- | butane dithiol |
| iso | butyl mercaptan |
| | butyraldehyde |
| | coffee difuran |
| | cortex pyridine |
| | cyclopentyl mercaptan |
| | cyclopropyl (E,Z)-2,6-nonadienamide |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| | difurfuryl sulfide |
| 2,5- | dihydroxy-1,4-dithiane |
| | dihydroxyacetophenone |
| | diisopropyl sulfide |
| N-(2,4- | dimethoxybenzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N-(2-(3,4- | dimethoxyphenyl)ethyl)-3,4-dimethoxycinnamic acid amide |
| | dimethyl disulfide |
| 2,5- | dimethyl furan |
| | dimethyl sulfide |
| | dimethyl tetrasulfide |
| 2,6- | dimethyl thiophenol |
| | dimethyl trisulfide |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 3,7- | dimethyl-2,6-octadien-1-yl cyclopropyl carboxamide |
| 2,6- | dimethyl-3-((2-methyl-3-furyl)thio)-4-heptanone |
| 2,5- | dimethyl-3-furan thiol |
| bis(2,5- | dimethyl-3-furyl) disulfide |
| 2,5- | dimethyl-3-thiofuroyl furan |
| 1,1- | ethane dithiol 1% in ethanol |
| 2- | ethoxythiazole |
| | ethyl (E,Z)-2,6-nonadienamide |
| | ethyl (E)-2-hexenoate |
| S- | ethyl 2-acetyl aminoethane thioate |
| | ethyl 3-(furfuryl thio) propionate |
| | ethyl 3-mercaptopropionate |
| | ethyl 4-(acetyl thio) butyrate |
| | ethyl pyruvate |
| S- | ethyl thioacetate |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| 2- | ethyl-4,5-dimethyl oxazole |
| | fish thiol |
| | furfuryl isopropyl sulfide |
| | furfuryl methyl sulfide |
| 1- | furfuryl pyrrole |
| 4- | furfuryl thio-2-pentanone |
| | geranium thiazole |
| | grapefruit menthane |
| | hazelnut pyrazine |
| (E,E)-2,4- | heptadien-1-al |
| N-( | heptan-4-yl)benzo(D)(1,3)dioxole-5-carboxamide |
| (E)-2- | hepten-1-al |
| (Z)-4- | hepten-1-al |
| | hexanal propylene glycol acetal |
| 1,6- | hexane dithiol |
| (E)-4- | hexen-1-al |
| 2- | hexen-1-al |
| 4- | hexen-1-ol |
| (Z)-3- | hexen-1-yl (E)-crotonate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl lactate |
| (Z)-3- | hexen-1-yl phenyl acetate |
| (Z)-3- | hexen-1-yl pyruvate |
| (Z)-3- | hexen-1-yl tiglate |
| | hexyl hexanoate |
| | hexyl mercaptan |
| | jalapeno oleoresin |
| | lychee mercaptan acetate |
| | meaty dithiane |
| | melon nonenoate |
| 4- | mercapto-2-pentanone 1% in acetoin |
| 3- | mercapto-3-methyl butanol |
| 2- | mercapto-3-pentanone |
| 3- | mercaptohexyl butyrate |
| 2- | mercaptomethyl pyrazine |
| 2- | mercaptopropionic acid |
| | mesityl oxide |
| | methional |
| N1-(2- | methoxy-4-methyl benzyl)-N2-(2-(pyridin-2-yl)ethyl) oxalamide |
| N1-(2- | methoxy-4-methyl benzyl)-N2-2(2-(5-methyl pyridin-2-yl)ethyl) oxalamide |
| | methyl 2-methyl-3-furyl disulfide |
| 2- | methyl 3-(methyl thio) furan 10% in triacetin |
| | methyl 3-(methyl thio) propionate |
| 4- | methyl 4-mercaptopentan-2-one 1% in pg |
| | methyl benzyl disulfide |
| | methyl dihydrofuran thiol |
| | methyl furfuryl disulfide |
| 4- | methyl nonanoic acid |
| | methyl octanoate |
| 2- | methyl pyrazine |
| 2- | methyl thiazole |
| 2- | methyl thiazolidine |
| 2- | methyl thio-3,5 or 6-methyl pyrazine |
| 2-( | methyl thio) acetaldehyde |
| 4-( | methyl thio) butanol |
| 2-( | methyl thio) ethanol |
| 3-( | methyl thio) hexanol |
| | methyl thiomethyl butyrate |
| 12- | methyl tridecanal |
| 2- | methyl-1-methyl thio-2-butene |
| 2- | methyl-1,3-dithiolane |
| 3- | methyl-2-butane thiol |
| 3-(5- | methyl-2-furyl) butanal |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-furyl tetrasulfide |
| bis(2- | methyl-3-furyl) disulfide |
| S-(2- | methyl-3-furyl) ethane thioate |
| 3-((2- | methyl-3-furyl)thio)-4-heptanone |
| 4-((2- | methyl-3-furyl)thio)-5-nonanone |
| 2- | methyl-3-tetrahydrofuran thiol |
| 5- | methyl-5-hexen-2-one |
| 2- | methyl-5-methoxythiazole |
| 2- | naphthyl mercaptan |
| 2,6- | nonadien-1-ol |
| 1,9- | nonane dithiol |
| (Z)-6- | nonen-1-ol |
| | nutty thiazole |
| 2,4- | octadien-1-al |
| 1,8- | octane dithiol |
| 2- | octen-1-ol |
| 1- | octen-3-ol |
| (E)-2- | octenoic acid |
| | peanut dithiazine |
| 4- | penten-1-yl acetate |
| 1- | penten-3-ol |
| 2- | pentyl furan |
| 1- | phenethyl mercaptan |
| | potato butanone |
| 1,3- | propane dithiol |
| 2- | propionyl-2-thiazoline |
| | propyl 2-mercaptopropionate |
| | propyl 2-methyl-3-furyl disulfide |
| iso | propyl disulfide |
| iso | propyl mercaptan |
| 2- | propyl pyrazine |
| | propyl thioacetate |
| iso | propyl tiglate |
| 2-iso | propyl-3-(methyl thio) pyrazine |
| | propylene glycol acetone ketal |
| | pyrazinyl ethane thiol |
| 2- | pyridinyl methane thiol |
| | pyrrolidino-(1,2E)-4H-2,4-dimethyl-1,3,5-dithiazine |
| | radish isothiocyanate |
| | roasted butanol |
| | rum ether |
| | sulfuryl acetate |
| | tetrahydrofurfuryl alcohol |
| 3- | tetrahydrothiophenone |
| | thialdine |
| 3- | thienyl mercaptan |
| 1-(2- | thienyl) butanone |
| ortho- | thiocresol |
| | thioguaiacol |
| 2,4,5- | trimethyl thiazole |
| | tropical thiazole |
| | tyramine |
| | vinyl sulfurol |
| | yeast thiazoline |
| (odor and/or flavor) used in : |
| | meat | | | spice | | | vegetable |
| natural occurrence in : |
| not found in nature |
|