| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan |
| InChI : | InChI=1/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3 |
| InChIKey : | YPZUZOLGGMJZJO-UHFFFAOYAI |
| SMILES : | CC1(CCC[C@]2([C@H]1CC[C@@]3([C@@H]2CCO3)C)C)C |
| cas number : | 6790-58-5 |
| (EINECS) number : | 229-861-2 |
| fema number : | 3471 |
| coe number : | 10514 |
| molar refractivity : | 71.59 ± 0.3 cm3 |
| parachor : | 610.4 ± 4.0 cm3 |
| index of refraction : | 1.480 ± 0.02 |
| surface tension : | 34.6 ± 3.0 dyne/cm |
| density : | 0.939 ± 0.06 g/cm3 |
| polarizability : | 28.38 ± 0.5 10-24cm3 |
| XlogP : | 5.80 |
| molecular weight : | 236.3929200 |
| formula : | C16 H28 O |
|
|
| |
| |
| export tariff code : | 2932.90.5000 |
| fda reg : | unspecified |
Suppliers :
|
| Advanced Biotech : | amberol
99% min. synthetic Odor: Incense, Oriental |
| AROMOR : | AMBERMOR
NATURE-IDENTICAL Odor: STRONG WOODY-AMBER, SWEET-EARTH, MUSKY ODOR WITH A DELICATE ANIMAL TONALITY. |
| Givaudan : | Ambrofix
Odor: Ambery, Woody, Tobacco, Dry |
| Mane : | orcanox
|
| Moellhausen : | ambermox
99% min. artifical kosher Odor: strongly amber, woody and dry notes. Flavor: balsamic amber-like, woody and fresh with a piney and nutty notes. |
| Sigma-Aldrich-SAFC : | (-)-Ambroxide
≥99% |
| Symrise : | Ambroxide cryst.
|
| Vigon : | Ambrofix
|
organoleptics :
|
| odor type : | amber |
| odor strength : | very high , recommend smelling in a 1.00 % solution or less |
odor description :¹ at 1.00 % in dipropylene glycol. | ambergris old paper sweet labdanum dry |
| odor sample from : | Henkel Corporation |
| substantivity : | > 400 hour(s) at 10.00 % in dipropylene glycol |
properties :
|
| appearence : | white crystals |
| assay : | 98.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| melting point : | 74.00 to 75.00 °C. @ 760.00 mm Hg
|
| melting point : | 73.00 to 74.00 °C. @ 760.00 mm Hg
|
| boiling point : | 120.00 to 121.00 °C. @ 1.40 mm Hg
|
| flash point : | 322.00 °F. TCC ( 161.11 °C. )
|
| logP (o/w) : | 5.41 |
| shelf life : | 48.00 month(s) or longer if stored properly. |
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. |
safety :
|
| most important hazard(s) : | None - None found. |
| |
S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes.
|
| Oral Toxicity(LD50) : | | |
Oral-Mouse >3.10 gm/kg
|
| Dermal Toxicity(LD50) : | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | |
Not determined
|
| |
safety in use :
|
| |
| recommendation for ambroxan usage levels up to : | | | 1.0000 % in the fragrance concentrate.
|
safety references :
|
| msds : | msds |
| EPI System : | view |
| Canada Domestic Sub. List : | Yes |
| EPA Chem. Sub. Inventory : | Yes |
| |
| WGK Germany : | 1 |
| |
| | | |
| | (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan
|
| (EINECS) number : | 229-861-2 |
| chemidplus : | 006790585 |
| EPA Substance Registry Services : | 6790-58-5 |
references :
|
| | (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan
|
| NIST Chemistry WebBook : | 6790585 |
| pubchem : | 42037676 |
Cosmetics :
|
| Cosmetic uses : |
perfuming agents
|
other :
|
| reference : | Luebke, William tgsc, (1987)¹ |
| CosIng : | cosmetic data |
| VCF-Online: | VCF Volatile Compounds in Food |
| | C of A |
|
synonyms :
|
| | ambermox | | | ambrofix | | (-)- | ambroxide | | 8alpha-12-oxi | do-13,14,15,16-tetranorlabdane | | (3aR- (3aalpha,5abeta, 9aalpha,9bbeta))- | dodecahydro-3a,6,6,9a-tetramethyl naphtho(2,1-b)furan | | (3ar- (3aalpha,5abeta, 9aalpha,9bbeta))- | dodecahydro-3a,6,6,9a-tetramethyl naphtho(2,1-b)furan | | (-)- | dodecahydrotetramethyl naphthofuran | | | orcanox | | (3aR,5aS,9aS,9bR)-3a,6,6,9a- | tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan |
soluble in :
|
| | alcohol | | | dipropylene glycol |
insoluble in :
|
| | water |
stability :
|
| | antiperspirant spray, good | | | candle, good | | | deo stick | | | detergent | | | hair spray | | | liquid bleach, good | | | most media | | | ph = 10, good | | | ph = 2, good | | | powder detergent, good | | | soap, good |
(odor and/or flavor) blends with :
|
| | acetophenone |
| | ambergris |
| iso | amyl salicylate |
| | amyris wood oil |
| | angelica root oil |
| | animal carbolactone |
| | beeswax absolute |
| | benzoin resinoid |
| | bois de rose oil |
| iso | butyl salicylate |
| | caramel furanone |
| | carrot seed oil |
| | cassia bark oil |
| | cedarwood oils |
| | cistus oil |
| | costus valerolactone |
| | currant bud absolute black |
| | cyclamen aldehyde |
| gamma- | decalactone |
| | decanol |
| | dihydrojasmone |
| | diphenyl oxide |
| | dodecanal |
| | dodecanol |
| | ethyl laurate |
| | ethyl maltol |
| iso | eugenyl acetate |
| | floral pyranol |
| | frankincense oil |
| | galbanum oil |
| | guaiacwood oil |
| | gurjun balsam oil |
| | heliotropyl acetone |
| alpha- | hexyl cinnamaldehyde |
| | immortelle absolute |
| | indole |
| | labdanum resinoid |
| | lilyall |
| laevo- | linalool |
| | maltol |
| | melon heptenal |
| | methyl cedryl ketone |
| | methyl dihydrojasmonate |
| | methyl heptine carbonate |
| 2- | methyl undecanal |
| | musks |
| | nerolidol |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| | nonanol |
| (Z)-6- | nonen-1-al |
| | ocean propanal |
| gamma- | octalactone |
| | patchouli ethanone |
| | patchouli oil |
| | phenethyl phenyl acetate |
| | raspberry ketone |
| | santall |
| | spruce oil |
| | tonka bean absolute |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| | verymoss |
| | violet leaf absolute |
| | watermelon ketone |
| | woody acetate |
(odor and/or flavor) used in :
|
| | agate | | | amber | | | ambergris | | | ambreine | | | ambrette | | | animal | | | azzaro | | | baby powder | | | balsam | | | bay rum | | | bayberry | | | blue grass | | | bouquet | | | cabreuva | | | castoreum | | | cedar forest | | | christmas blends | | | cigar box | | | cloth clean cloths | | | cool water | | | coronilla | | | deertongue | | | dry | | | earth humus | | | fantasy blends | | | fern fougere | | | fir balsam | | | floral | | | forest pine forest | | | grass sweet grass | | | guaiacwood | | | habuba | | | hay new mown hay foin coupe | | | heather | | | herbal | | | hollyberry | | | incense | | | juniperberry | | | labdanum | | | leather | | | leather russian leather | | | maja | | | moss | | | musk | | | ocean sea | | | ocean sea breeze | | | oriental | | | patchouli | | | powder | | | rain | | | rain spring rain | | | sandalwood | | | spice | | | tobacco tabac tabaco | | | tonka | | | tweed | | | vanilla | | | woodruff asperula | | | woody |
natural occurrence in :
|
| ambergris |
|