Notes :
Blends well with moss and woody notes. Ambergris substitute.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan | |||||||||||||||||||||||||||
| InChI : | InChI=1/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3 | |||||||||||||||||||||||||||
| InChIKey : | YPZUZOLGGMJZJO-UHFFFAOYAI | |||||||||||||||||||||||||||
| SMILES : | CC1(CCC[C@]2([C@H]1CC[C@@]3([C@@H]2CCO3)C)C)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | 2932.90.5000 | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Advanced Biotech : | amberol
99% min. synthetic Odor: Incense, Oriental | |||||||||||||||||||||||||||
| AROMOR : | AMBERMOR
NATURE-IDENTICAL Odor: STRONG WOODY-AMBER, SWEET-EARTH, MUSKY ODOR WITH A DELICATE ANIMAL TONALITY. | |||||||||||||||||||||||||||
| Givaudan : | Ambrofix
Odor: Ambery, Woody, Tobacco, Dry | |||||||||||||||||||||||||||
| Mane : | orcanox | |||||||||||||||||||||||||||
| Moellhausen : | ambermox
99% min. artifical kosher Odor: strongly amber, woody and dry notes. Flavor: balsamic amber-like, woody and fresh with a piney and nutty notes. | |||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | (-)-Ambroxide
≥99% | |||||||||||||||||||||||||||
| Symrise : | Ambroxide cryst. | |||||||||||||||||||||||||||
| Vigon : | Ambrofix | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||||||||
| odor strength : | very high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||
| odor description :¹ at 1.00 % in dipropylene glycol. | ambergris old paper sweet labdanum dry | |||||||||||||||||||||||||||
| odor sample from : | Henkel Corporation | |||||||||||||||||||||||||||
| substantivity : | > 400 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | white crystals | |||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| melting point : | 74.00 to 75.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| melting point : | 73.00 to 74.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 120.00 to 121.00 °C. @ 1.40 mm Hg | |||||||||||||||||||||||||||
| flash point : | 322.00 °F. TCC ( 161.11 °C. ) | |||||||||||||||||||||||||||
| logP (o/w) : | 5.41 | |||||||||||||||||||||||||||
| shelf life : | 48.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | None - None found. | |||||||||||||||||||||||||||
|
S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. | ||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||
|
Oral-Mouse >3.10 gm/kg | ||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||
| recommendation for ambroxan usage levels up to : | ||||||||||||||||||||||||||||
| 1.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||
| WGK Germany : | 1 | |||||||||||||||||||||||||||
| (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan | ||||||||||||||||||||||||||||
| (EINECS) number : | 229-861-2 | |||||||||||||||||||||||||||
| chemidplus : | 006790585 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 6790-58-5 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan | ||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 6790585 | |||||||||||||||||||||||||||
| pubchem : | 42037676 | |||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1987)¹ | |||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||
| synonyms : | |
| ambermox | |
| ambrofix | |
| (-)- | ambroxide |
| 8alpha-12-oxi | do-13,14,15,16-tetranorlabdane |
| (3aR- (3aalpha,5abeta, 9aalpha,9bbeta))- | dodecahydro-3a,6,6,9a-tetramethyl naphtho(2,1-b)furan |
| (3ar- (3aalpha,5abeta, 9aalpha,9bbeta))- | dodecahydro-3a,6,6,9a-tetramethyl naphtho(2,1-b)furan |
| (-)- | dodecahydrotetramethyl naphthofuran |
| orcanox | |
| (3aR,5aS,9aS,9bR)-3a,6,6,9a- | tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
insoluble in : | |
| water | |
stability : | |
| antiperspirant spray, good | |
| candle, good | |
| deo stick | |
| detergent | |
| hair spray | |
| liquid bleach, good | |
| most media | |
| ph = 10, good | |
| ph = 2, good | |
| powder detergent, good | |
| soap, good | |
(odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| iso | eugenyl acetate |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| indole | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
(odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| azzaro | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| cloth clean cloths | |
| cool water | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| sandalwood | |
| spice | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| ambergris | |