Notes :
5 parts anisic alcohol to 7 parts cinnamic alcohol. Blend with eugenyl methyl ether to make lilacs. Naphthyl ethyl ether or naphthyl methyl ether removes the chemical note.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | (4-methoxyphenyl)methanol | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2-5,9H,6H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | MSHFRERJPWKJFX-UHFFFAOYAE | |||||||||||||||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)CO | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2909.49.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | powdery | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet powdery hawthorn lilac rose floral hyacinth | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Cherry, vanilla, creamy nuances, cocoa, licorice, anise | |||||||||||||||||||||||||||||||||||
| substantivity : | 82 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow liquid to solid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.10800 - 1.11600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.220 to 9.286 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.10900 - 1.11700 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.239 to 9.305 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.54200 - 1.54600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 23.00 - 25.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 259.00 - 260.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 0.95 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1200.00 ul/kg JPETAB 93,26,1948 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 3.00 gm/kg FCTXAV 12,825,1974 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||||||||||
| Category 1 : | 0.04 % (1) | Category 2 : | 0.10 % | |||||||||||||||||||||||||||||||||
| Category 3 : | 0.20 % | Category 4 : | 0.70 % | |||||||||||||||||||||||||||||||||
| Category 5 : | 0.40 % | Category 6 : | 1.10 % (1) | |||||||||||||||||||||||||||||||||
| Category 7 : | 0.10 % | Category 8 : | 1.50 % | |||||||||||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case para-anisyl alcohol) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||||||||||
| recommendation for para-anisyl alcohol usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 12.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-273-6 | |||||||||||||||||||||||||||||||||||
| rtecs : | DO8925000 for 105-13-5 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000105135 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 105-13-5 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 2151 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150829 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3611667559 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 24, No. 2, 49, (1999)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| anisalcohol | |
| anise alcohol | |
| anisic alcohol | |
| para- | anisol alcohol |
| anisyl alcohol | |
| para- | anisyl alcohol |
| 4- | methoxybenzene methanol |
| 4- | methoxybenzyl alcohol |
| para- | methoxybenzyl alcohol |
| soluble in : | |
| benzyl alcohol | |
| ethyl alcohol, 1 vol of 50% alcohol | |
| fixed oils | |
| water, 2000 mg/L @ 20C | |
| insoluble in : | |
| paraffin oil | |
| water | |
| stability : | |
| cream | |
| detergent | |
| hair spray | |
| lotion | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| allyl cyclohexyl propionate | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| animal carbolactone | |
| para- | anisaldehyde |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| caramel furanone | |
| caraway seed oil | |
| cassia absolute | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| clove bud oil | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| elderflower oil | |
| ethyl cinnamate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| floral pyranol | |
| gurjun balsam oil | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| indole | |
| ionones | |
| labdanum resinoid | |
| laevo- | linalool |
| maltol | |
| methyl eugenol | |
| 2- | methyl undecanal |
| mimosa absolute | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| orris absolute | |
| patchouli ethanone | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| raspberry ketone methyl ether | |
| rose butanoate | |
| santall | |
| alpha- | terpineol |
| tonka bean absolute | |
| vanilla absolute | |
| verymoss | |
| watermelon ketone | |
| (odor and/or flavor) used in : | |
| anise | |
| apple blossom | |
| apricot | |
| banana | |
| broom genet genista | |
| carnation dianthus oeillet | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| chocolate | |
| chocolate cocoa | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cream | |
| fern fougere | |
| floral | |
| florida breeze | |
| gardenia | |
| ginger white ginger | |
| gingerbread | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| heliotrope | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| licorice | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| mimosa wattle | |
| muguet lily of the valley | |
| orange | |
| peach | |
| powder | |
| sherry | |
| sweet pea pois de senteur | |
| tuberose tubereuse | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| anise seed oil | |
| honey | |
| vanilla pods | |
| whiskey bourbon whiskey | |