Notes :
Maybe used as a prefixer for alcohol. To tone down the alcohol smell.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | (10Z)-1-oxacycloheptadec-10-en-2-one | |||||||||||||||||||||||||||
| InChI : | InChI=1/C16H28O2/c17-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-16/h1,3H,2,4-15H2/b3-1- | |||||||||||||||||||||||||||
| InChIKey : | QILMAYXCYBTEDM-IWQZZHSRBZ | |||||||||||||||||||||||||||
| SMILES : | C1CCC\C=C/CCCCCCOC(=O)CCC1 | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2932.29.6000 | |||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet musk ambrette fruity | |||||||||||||||||||||||||||
| substantivity : | 248 Hour(s) | |||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| specific gravity : | 0.94800 - 0.95600 @ 25.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.888 to 7.955 | |||||||||||||||||||||||||||
| specific gravity : | 0.94900 - 0.95700 @ 20.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.906 to 7.972 | |||||||||||||||||||||||||||
| refractive index : | 1.47700 - 1.48200 @ 20.00 °C. | |||||||||||||||||||||||||||
| boiling point : | 185.00 - 190.00 °C. @ 16.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 307.00 - 308.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 6.51 | |||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| recommendation for ambrettolide usage levels up to : | ||||||||||||||||||||||||||||
| 4.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||
| publication number : 22. | ||||||||||||||||||||||||||||
| 4145 | average usual ppm | average maximum ppm | ||||||||||||||||||||||||||
| baked goods : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| beverages(nonalcoholic) : | 0.05000 | 0.50000 | ||||||||||||||||||||||||||
| beverages(alcoholic) : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||
| breakfast cereal : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| cheese : | - | - | ||||||||||||||||||||||||||
| chewing gum : | 1.00000 | 5.00000 | ||||||||||||||||||||||||||
| condiments / relishes : | - | - | ||||||||||||||||||||||||||
| confectionery froastings : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||
| fats / oils : | - | - | ||||||||||||||||||||||||||
| fish products : | - | - | ||||||||||||||||||||||||||
| frozen dairy : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| fruit ices : | 0.10000 | 2.00000 | ||||||||||||||||||||||||||
| gelatins / puddings : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||
| gravies : | - | - | ||||||||||||||||||||||||||
| hard candy : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||
| imitation dairy : | - | - | ||||||||||||||||||||||||||
| instant coffee / tea : | - | - | ||||||||||||||||||||||||||
| jams / jellies : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| meat products : | - | - | ||||||||||||||||||||||||||
| milk products : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||
| other grains : | - | - | ||||||||||||||||||||||||||
| poultry : | - | - | ||||||||||||||||||||||||||
| processed fruits : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||
| seasonings / flavors : | - | - | ||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||
| soft candy : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||
| soups : | - | - | ||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||
| sweet sauces : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||
| (EINECS) number : | 249-120-7 | |||||||||||||||||||||||||||
| chemidplus : | 028645514 | |||||||||||||||||||||||||||
| epa-srs : | 28645-51-4 | |||||||||||||||||||||||||||
| dtp/nci : | 31697 | |||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||
| fl. number : | 10.063 | |||||||||||||||||||||||||||
| pubchem : | 671490 | |||||||||||||||||||||||||||
| synonyms : | |
| delta-9-iso | ambrettolic acid lactone |
| ambrettolide | |
| iso | ambrettolide |
| oxa | cycloheptadec-10-en-2-one |
| 16- | hydroxy-9-hexadecenoic acid omega-lactone |
| moschus lactone | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| antiperspirant | |
| candle, moderate | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| hard surface cleaner | |
| liquid detergent | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| allyl amyl glycolate | |
| amber carbinol | |
| ambrette seed oil | |
| ambrettolide | |
| ambroxan | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| angelica seed oil CO2 extract | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| armoise oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bois de rose oil | |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| iso | butyl quinoline |
| carrot seed oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| creamy lactone | |
| para- | cresyl caprylate |
| cuminaldehyde | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanol | |
| decyl acetate | |
| dewy propionate | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| ethylene brassylate | |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| (E)- | geranyl acetone |
| glyceryl tributyrate | |
| guaiacwood oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| lilyall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| longifolene | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| muguet carboxaldehyde | |
| musk ambrette | |
| musk propanoate | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| 2,4- | octadien-1-ol |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose petal acetate | |
| santall | |
| strawberry furanone | |
| alpha- | terpineol |
| delta- | tetradecalactone |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanoic acid | |
| vanilla absolute | |
| vanillyl acetate | |
| versalide | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| aldehydic | |
| amber | |
| ambergris | |
| ambrette | |
| angelica | |
| animal | |
| apple crabapple | |
| ash mountain ash blossom | |
| azalea | |
| balsam | |
| bark | |
| bayberry | |
| blueberry | |
| bouquet | |
| briar sweet briar eglantine | |
| broom genet genista | |
| burberry | |
| butter | |
| cabreuva | |
| calamus | |
| candy | |
| caramel | |
| carnation dianthus oeillet | |
| cassia blossom | |
| cedar | |
| cedar forest | |
| champaca champak | |
| chestnut blossom | |
| chocolate cacao | |
| chypre | |
| citrus | |
| civet | |
| cloth clean cloths | |
| clover trefle le'trefle incarnat | |
| coconut | |
| cologne | |
| coronilla | |
| crabapple blossom | |
| cream | |
| cyclamen | |
| daffodil narcissus | |
| dahlia | |
| daisy | |
| daphne | |
| dogwood | |
| fagonia | |
| fern fougere | |
| fidji | |
| fig | |
| fir balsam | |
| fixer | |
| flouve blossom | |
| foliage | |
| forest | |
| fruit punch | |
| fruit tropical fruit | |
| ginger white ginger | |
| grass sweet grass | |
| habuba | |
| hay new mown hay foin coupe | |
| herbal | |
| hinoki | |
| hugonia | |
| incense | |
| kewda | |
| lavender | |
| leaf autumn leaf | |
| leather | |
| lotus | |
| marshmallow | |
| meadow | |
| mimosa wattle | |
| molasses | |
| moss | |
| muguet lily of the valley | |
| musk | |
| narcissus narcisse | |
| nut | |
| oakwood | |
| ocean sea | |
| oscar de larenta | |
| outdoors fresh outdoors | |
| passion fruit | |
| pear prickly pear | |
| petunia | |
| phlox | |
| pinon cone | |
| pomegranate | |
| powder | |
| rain | |
| raspberry | |
| rhubarb | |
| rose d'orient | |
| rose moss rose | |
| rose white rose | |
| sandalwood | |
| stephanotis | |
| stock evening scented stock | |
| straw | |
| strawberry | |
| timber | |
| tobacco tabac tabaco | |
| toffee | |
| tulip | |
| valerian | |
| vanilla | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| data page | ambrette seed concrete @ 5.10% |