Notes :
Maybe used as a prefixer for alcohol. To tone down the alcohol smell.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | (9Z)-17-oxacycloheptadec-9-en-1-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H28O2/c17-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-16/h1,3H,2,4-15H2/b3-1- | |||||||||||||||||||||||||||||||
| InChIKey : | QILMAYXCYBTEDM-IWQZZHSRBZ | |||||||||||||||||||||||||||||||
| SMILES : | C1CCC\C=C/CCCCCCOC(=O)CCC1 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| export tariff code : | 2932.29.6000 | |||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||
| Charabot : | ambrettolide | |||||||||||||||||||||||||||||||
| Givaudan : | ambrettolide
Odor: Musky, Powerful, Warm, Ambrette seed, Fruity | |||||||||||||||||||||||||||||||
| IFF : | Ambrettolide
Odor: Intensely powerful substantive musk odor with depth and richness. | |||||||||||||||||||||||||||||||
| John D. Walsh : | Ambrettolide | |||||||||||||||||||||||||||||||
| Mane : | ambrettolide | |||||||||||||||||||||||||||||||
| Moellhausen : | ambrettolide
98% min. artifical kosher Odor: strongly musk, vegetable, fruity. | |||||||||||||||||||||||||||||||
| Symrise : | Ambrettolide | |||||||||||||||||||||||||||||||
| Vigon : | Ambrettolide | |||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | sweet musk ambrette fruity waxy | |||||||||||||||||||||||||||||||
| odor sample from : | Charabot & Company Inc. | |||||||||||||||||||||||||||||||
| substantivity : | 248 Hour(s) | |||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 0.94800 to 0.95600 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.888 to 7.955 | |||||||||||||||||||||||||||||||
| specific gravity : | 0.94900 to 0.95700 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.906 to 7.972 | |||||||||||||||||||||||||||||||
| refractive index : | 1.47700 to 1.48200 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 185.00 to 190.00 °C. @ 16.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 307.00 to 308.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| flash point : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||
| logP (o/w) : | 6.51 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
|
R 36 - Irritating to eyes. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||||
| Human experience : | 1 % solution: no irritation or sensitization. | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Oral-Rat >5000.00 mg/kg | ||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||
|
Skin-Rabbit >5000.00 mg/kg | ||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||
| recommendation for isoambrettolide usage levels up to : | ||||||||||||||||||||||||||||||||
| 4.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||||||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA on the "LIBRARY" link. | ||||||||||||||||||||||||||||||||
| publication number : 22 | ||||||||||||||||||||||||||||||||
| average usual ppm | average maximum ppm | |||||||||||||||||||||||||||||||
| baked goods : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| beverages(nonalcoholic) : | 0.05000 | 0.50000 | ||||||||||||||||||||||||||||||
| beverages(alcoholic) : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||||||
| breakfast cereal : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| cheese : | - | - | ||||||||||||||||||||||||||||||
| chewing gum : | 1.00000 | 5.00000 | ||||||||||||||||||||||||||||||
| condiments / relishes : | - | - | ||||||||||||||||||||||||||||||
| confectionery froastings : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||||||
| fats / oils : | - | - | ||||||||||||||||||||||||||||||
| fish products : | - | - | ||||||||||||||||||||||||||||||
| frozen dairy : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| fruit ices : | 0.10000 | 2.00000 | ||||||||||||||||||||||||||||||
| gelatins / puddings : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||||||
| gravies : | - | - | ||||||||||||||||||||||||||||||
| hard candy : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||||||
| imitation dairy : | - | - | ||||||||||||||||||||||||||||||
| instant coffee / tea : | - | - | ||||||||||||||||||||||||||||||
| jams / jellies : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| meat products : | - | - | ||||||||||||||||||||||||||||||
| milk products : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||||||
| other grains : | - | - | ||||||||||||||||||||||||||||||
| poultry : | - | - | ||||||||||||||||||||||||||||||
| processed fruits : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||||||
| seasonings / flavors : | - | - | ||||||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||||||
| soft candy : | 0.20000 | 2.00000 | ||||||||||||||||||||||||||||||
| soups : | - | - | ||||||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||||||
| sweet sauces : | 0.10000 | 1.00000 | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||||||
| (9Z)-17-oxacycloheptadec-9-en-1-one | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 249-120-7 | |||||||||||||||||||||||||||||||
| chemidplus : | 028645514 | |||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 28645-51-4 | |||||||||||||||||||||||||||||||
| dtp/nci : | 31697 | |||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||
| (9Z)-17-oxacycloheptadec-9-en-1-one | ||||||||||||||||||||||||||||||||
| fl. number : | 10.063 | |||||||||||||||||||||||||||||||
| pubchem : | 671490 | |||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1992)¹ | |||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| FDA Everything Added to Food in the United States (EAFUS) | View | |||||||||||||||||||||||||||||||
| synonyms : | |
| delta-9-iso | ambrettolic acid lactone |
| ambrettolide (so called) | |
| oxa | cyclo heptadec-10-en-2-one |
| (9Z)-17-oxa | cycloheptadec-9-en-1-one |
| oxa | cycloheptadec-10-en-2-one |
| hexadec-9-en-1,16 lactone | |
| 16- | hydroxy-9-hexadecenoic acid omega-lactone |
| moschus lactone | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| acid cleaner | |
| antiperspirant | |
| candle, moderate | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| hard surface cleaner | |
| liquid detergent | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| soap | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| allyl amyl glycolate | |
| amber carbinol | |
| ambrette seed oil | |
| ambrettolide | |
| ambroxan | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| angelica seed oil CO2 extract | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| armoise oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bois de rose oil | |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| iso | butyl quinoline |
| carrot seed oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| creamy lactone | |
| para- | cresyl caprylate |
| cuminaldehyde | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanol | |
| decyl acetate | |
| dewy propionate | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| ethylene brassylate | |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| (E)- | geranyl acetone |
| guaiacwood oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| lilyall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| longifolene | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| muguet carboxaldehyde | |
| musk ambrette | |
| musk propanoate | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| 2,4- | octadien-1-ol |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose petal acetate | |
| santall | |
| strawberry furanone | |
| alpha- | terpineol |
| delta- | tetradecalactone |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanoic acid | |
| vanilla absolute | |
| vanillyl acetate | |
| versalide | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
(odor and/or flavor) used in : | |
| aldehydic | |
| amber | |
| ambergris | |
| ambrette | |
| angelica | |
| animal | |
| apple crabapple | |
| ash mountain ash blossom | |
| azalea | |
| balsam | |
| bark | |
| bayberry | |
| blueberry | |
| bouquet | |
| briar sweet briar eglantine | |
| broom genet genista | |
| burberry | |
| butter | |
| cabreuva | |
| calamus | |
| candy | |
| caramel | |
| carnation dianthus oeillet | |
| cassia blossom | |
| cedar | |
| cedar forest | |
| champaca champak | |
| chestnut blossom | |
| chocolate cacao | |
| chypre | |
| citrus | |
| civet | |
| cloth clean cloths | |
| clover trefle le'trefle incarnat | |
| coconut | |
| cologne | |
| coronilla | |
| crabapple blossom | |
| cream | |
| cyclamen | |
| daffodil narcissus | |
| dahlia | |
| daisy | |
| daphne | |
| dogwood | |
| fagonia | |
| fern fougere | |
| fidji | |
| fig | |
| fir balsam | |
| fixer | |
| flouve blossom | |
| foliage | |
| forest | |
| fruit punch | |
| fruit tropical fruit | |
| ginger white ginger | |
| grass sweet grass | |
| habuba | |
| hay new mown hay foin coupe | |
| herbal | |
| hinoki | |
| hugonia | |
| incense | |
| kewda | |
| lavender | |
| leaf autumn leaf | |
| leather | |
| lotus | |
| marshmallow | |
| meadow | |
| mimosa wattle | |
| molasses | |
| moss | |
| muguet lily of the valley | |
| musk | |
| narcissus narcisse | |
| nut | |
| oakwood | |
| ocean sea | |
| oscar de larenta | |
| outdoors fresh outdoors | |
| passion fruit | |
| pear prickly pear | |
| petunia | |
| phlox | |
| pinon cone | |
| pomegranate | |
| powder | |
| rain | |
| raspberry | |
| rhubarb | |
| rose d'orient | |
| rose moss rose | |
| rose white rose | |
| sandalwood | |
| stephanotis | |
| stock evening scented stock | |
| straw | |
| strawberry | |
| timber | |
| tobacco tabac tabaco | |
| toffee | |
| tulip | |
| valerian | |
| vanilla | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| data page | ambrette seed concrete @ 5.10% |