| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2,5-diethyloxolane |
| InChI : | InChI=1/C8H16O/c1-3-7-5-6-8(4-2)9-7/h7-8H,3-6H2,1-2H3 |
| InChIKey : | YKWLEIXVUHRKEF-UHFFFAOYAH |
| SMILES : | CCC1CCC(O1)CC |
| (EINECS) number : | 255-274-6 |
| cas number : | 41239-48-9 |
| fema number : | 3743 |
| coe number : | 11882 |
| jecfa number : | 1453 |
| fl. number : | 13.095 |
| molar refractivity : | 38.70 ± 0.3 cm3 |
| parachor : | 353.0 ± 4.0 cm3 |
| index of refraction : | 1.413 ± 0.02 |
| surface tension : | 26.9 ± 3.0 dyne/cm |
| density : | 0.827 ± 0.06 g/cm3 |
| polarizability : | 15.34 ± 0.5 10-24cm3 |
| xlogp : | 2.20 |
| molecular weight : | 128.2120400 |
| formula : | C8 H16 O |
|
|
| |
| |
| fda reg : | 172.515 |
h. number : | 2932.19.0000 |
| |
| organoleptics : | |
| odor type : | herbal |
| odor strength : | medium ,
recommend smelling in a 0.10 % solution or less |
odor description :
at 0.10 % in propylene glycol. | sweet herbal caramel |
| properties : | |
| appearence : | colorless clear liquid |
| assay : | 97.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.82700 - 0.83300 @ 25.00 °C.
|
| pounds per gallon - calc. : | 6.881 to 6.931
|
| refractive index : | 1.40100 - 1.40700 @ 20.00 °C.
|
| boiling point : | 116.00 °C. @ 760.00 mm Hg
|
| logp : | 2.37 |
| safety : | |
| Oral Toxicity(LD50) : |
Oral-Rat 3400.00 mg/kg
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 102.00 °F. TCC ( 38.89 °C. )
|
| | |
| recommendation for 2,5-diethyl tetrahydrofuran usage levels up to : | | | not for fragrance use.
|
| | |
| safety links : | |
| (EINECS) number : | 255-274-6 |
| chemidplus : | 041239489 |
| epa-srs : | 41239-48-9 |
| | |
| other : | |
| |
|
| references : | |
| jecfa number : | 1453 |
| fl. number : | 13.095 |
| pubchem : | 205099 |
| | |
|
| synonyms : |
| 2,5- | diethyl oxolane | | 2,5- | diethyl tetrahydrofuran |
| soluble in : |
| | alcohol | | | water, slightly |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| | acetoin |
| 2- | acetyl-3,4,5,6-tetrahydropyridine |
| | allyl 2-furoate |
| | caramel dione |
| | caramel furanone |
| | caramel pentadione |
| alpha,alpha- | dimethyl anisyl acetone |
| | ethyl 2-hydroxy-2-methyl butyrate |
| | ethyl cyclopentenolone |
| | ethyl maltol |
| 5- | ethyl-2,3,4,5-tetramethyl-2-cyclohexen-1-one |
| 5- | ethyl-3,4,5,6-tetramethyl cyclohexen-2-one |
| | fenugreek absolute |
| | geranyl crotonate |
| | immortelle absolute |
| | maltol |
| | maltyl propionate |
| | maple furanone |
| | maple lactone |
| | menthone lactone |
| | mesitene lactone |
| | methyl cyclopentenolone |
| 2- | pentanoyl furan |
| | rosefuran |
| | shoyu furanone |
| | strawberry furanone |
| | toffee furanone |
| | tonka bean resinoid |
| (E,E)-2,4- | undecadien-1-al |
| 2,4- | undecadien-1-al |
| iso | valeraldehyde propylene glycol acetal |
| (odor and/or flavor) used in : |
| | caramel | | | mint |
| natural occurrence in : |
| data page | melissa oil slovak republic @ 0.08% |
|