| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||
| IUPAC name : | 2-[2-(4-methyl-1-cyclohex-3-enyl)propyl]cyclopentan-1-one | |||||||||||||||||||||
| InChI : | InChI=1/C15H24O/c1-11-6-8-13(9-7-11)12(2)10-14-4-3-5-15(14)16/h6,12-14H,3-5,7-10H2,1-2H3 | |||||||||||||||||||||
| InChIKey : | KNHGOYVXAHUDHP-UHFFFAOYAV | |||||||||||||||||||||
| SMILES : | CC1=CCC(CC1)C(C)CC2CCCC2=O | |||||||||||||||||||||
|
| |||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||
| odor description : at 100.00 %. | ketone fruity peach apricot | |||||||||||||||||||||
| substantivity : | 380 Hour(s) | |||||||||||||||||||||
| properties : | ||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||
| assay : | 95.00 - 100.00 % sum of isomers | |||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||
| boiling point : | 287.00 - 288.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||
| logp : | 4.26 | |||||||||||||||||||||
| safety : | ||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >2000.00 mg/kg | |||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >2000.00 mg/kg | |||||||||||||||||||||
| flash point ( Deg. F. ) : | 324.00 °F. TCC ( 162.22 °C. ) | |||||||||||||||||||||
| recommendation for peach cyclopentanone usage levels up to : | ||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||
| recommendation for peach cyclopentanone usage levels up to : | ||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||
| chemidplus : | 095962144 | |||||||||||||||||||||
| epa-srs : | 95962-14-4 | |||||||||||||||||||||
| other : | ||||||||||||||||||||||
| references : | ||||||||||||||||||||||
| pubchem : | 752863 | |||||||||||||||||||||
| synonyms : | |
| 2-(para- | menthen-1-ene-9-yl) cyclopentan-1-one |
| methyl cyclohexenyl propyl cyclopentanone | |
| 2-(2-(4- | methyl-3-cyclohexen-1-yl)-propyl) cyclopentanone |
| nectaryl | |
| peach cyclopentanone | |
| soluble in : | |
| alcohol | |
| water, 4.6 mg/L @ 20C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| allyl cyclohexyl propionate | |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzophenone | |
| benzyl salicylate | |
| caramel furanone | |
| cassia bark oil | |
| citrus propanol | |
| coriander seed oil | |
| costus valerolactone | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| floral pyranol | |
| green acetate | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| lavender absolute | |
| leerall | |
| lilyall | |
| laevo- | linalool |
| linalool oxide | |
| madescol | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| 2- | methyl undecanal |
| muguet shiseol | |
| musks | |
| myrasline | |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| oakmoss absolute | |
| ocean propanal | |
| ozone propanal | |
| peru balsam oil | |
| precarone | |
| raspberry ketone | |
| raspberry ketone methyl ether | |
| rose absolute | |
| rose butanoate | |
| sandalwood oil | |
| santall | |
| strawberry glycidate 1 | |
| tonka bean absolute | |
| tuberolide | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| apple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arpege | |
| blue grass | |
| bluebell | |
| blueberry | |
| bouquet | |
| butterscotch | |
| cedar | |
| cherry | |
| cherry blossom | |
| citrus | |
| coconut | |
| coconut tropical coconut | |
| cream | |
| cucumber | |
| currant | |
| date | |
| diorella | |
| fetes | |
| fig | |
| floral | |
| flower | |
| fracas | |
| fruit | |
| fruit juicy fruit | |
| gardenia | |
| gooseberry | |
| grape | |
| green | |
| grenadine | |
| habuba | |
| herbal | |
| hibiscus | |
| jasmin | |
| kiwi | |
| leather russian leather | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| lychee soapberry | |
| magnolia | |
| mango | |
| maple | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| muguet lily of the valley | |
| mulberry | |
| neroli | |
| nut | |
| nut pistachio | |
| ocean sea breeze | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pina colada | |
| plum | |
| powder | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tropical | |
| tutti frutti | |
| vanilla | |
| violet | |
| wintergreen | |
| woody | |
| natural occurrence in : | |
| not found in nature | |