Notes :
It imparts an original vibrant top note to fruity, chypre, green and lavender compositions and is used in all types of perfumery.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | prop-2-enyl 3-cyclohexylpropanoate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H20O2/c1-2-10-14-12(13)9-8-11-6-4-3-5-7-11/h2,11H,1,3-10H2 | |||||||||||||||||||||||||||||||||
| InChIKey : | TWXUTZNBHUWMKJ-UHFFFAOYAR | |||||||||||||||||||||||||||||||||
| SMILES : | C=CCOC(=O)CCC1CCCCC1 | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.20.5000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet fruity pineapple fatty waxy | |||||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 ppm. Fruity, pineapple, waxy, with green sweet apple nuances | |||||||||||||||||||||||||||||||||
| substantivity : | 251 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.94500 - 0.95300 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.863 to 7.930 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.94600 - 0.95400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.881 to 7.947 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.45800 - 1.46300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 91.00 °C. @ 1.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 264.00 - 265.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 4.12 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 585.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| IFRA purity specification : | < 0.1% free allyl alcohol | |||||||||||||||||||||||||||||||||
| recommendation for allyl cyclohexyl propionate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for allyl cyclohexyl propionate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 30.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 220-292-5 | |||||||||||||||||||||||||||||||||
| rtecs : | GV6735000 for 2705-87-5 | |||||||||||||||||||||||||||||||||
| chemidplus : | 002705875 | |||||||||||||||||||||||||||||||||
| epa-srs : | 2705-87-5 | |||||||||||||||||||||||||||||||||
| ifra : | ifra - ( Found under : Allyl esters ) | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 160764 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3374656467 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 15, No. 3, 51, (1990)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| allyl 3-cyclohexyl propionate | |
| allyl 3-cyclohexylpropionate | |
| allyl beta-cyclohexyl propionate | |
| allyl beta-cyclohexylpropionate | |
| allyl cyclohexane propionate | |
| allyl cyclohexanepropionate | |
| 3- | allyl cyclohexanol propionate |
| allyl cyclohexyl propionate | |
| 3- | allyl cyclohexyl propionate |
| allyl hexahydrophenyl propionate | |
| allyl hexahydrophenylpropionate | |
| cyclohexane propanoic acid 2-propenyl ester | |
| cyclohexane propionic acid allyl ester | |
| cyclohexanepropanoic acid 2-propenyl ester | |
| 2- | propen-1-yl cyclohexane propionate |
| 2- | propenyl 3-cyclohexyl propanoate |
| 2- | propenyl 3-cyclohexylpropanoate |
| 2- | propenyl cyclohexane propanoate |
| 2- | propenyl cyclohexanepropanoate |
| soluble in : | |
| essential oils | |
| ethyl alcohol, 1:4 in 80% alcohol | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| detergent | |
| moderate in soap and detergent | |
| soap | |
| (odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| geraniol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| rose butanoate | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| apple | |
| apple red apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| bramble arctic bramble | |
| bubblegum | |
| chamomile | |
| christmas blends | |
| chypre | |
| cloudberry bakeapple | |
| coconut tropical coconut | |
| fig | |
| fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| jasmin | |
| lavender | |
| lilac lilas syringa | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| papaya | |
| passion fruit | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| plum mirabelle plum | |
| pomegranate | |
| quince | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tomato | |
| tropical | |
| tutti frutti | |
| natural occurrence in : | |
| not found in nature | |