| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | diethyl propanedioate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | IYXGSMUGOJNHAZ-UHFFFAOYAC | |||||||||||||||||||||||||||||||||
| SMILES : | CCOC(=O)CC(=O)OCC | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fruity green apple sweet | |||||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Sweet and fruity with apple and pineapple nuances | |||||||||||||||||||||||||||||||||
| substantivity : | 4 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.05300 - 1.05600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.762 to 8.787 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.41300 - 1.41600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| melting point : | -51.00 - -50.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 199.00 - 200.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 82.00 - 83.00 °C. @ 11.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 0.96 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 14900.00 mg/kg (Smyth et al., 1969a) Gavage-Mouse 5400.00 mg/kg (Wolven & Levenstein, 1969) | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >16.00 ml/kg AIHAAP 30,470,1969 | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 650.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for diethyl malonate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for diethyl malonate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 50.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-305-9 | |||||||||||||||||||||||||||||||||
| rtecs : | OO0700000 for 105-53-3 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000105533 | |||||||||||||||||||||||||||||||||
| epa-srs : | 105-53-3 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 8864 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 150852 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4282354013 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 15, No. 2, 69, (1990)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| carbethoxyacetic ester | |
| dicarbethoxymethane | |
| diethyl malonate | |
| ethyl malonate | |
| ethyl methane dicarboxylate | |
| ethyl propane dioate | |
| malonic acid diethyl ester | |
| malonic ester | |
| methane dicarboxylic acid diethyl ester | |
| propane dioic acid diethyl ester | |
| soluble in : | |
| alcohol | |
| fixed oils | |
| propylene glycol | |
| water, 23200 mg/L @ 37C | |
| insoluble in : | |
| paraffin oil | |
| glycerin | |
| water | |
| mineral oil | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl benzoate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| cassia bark oil | |
| cinnamyl alcohol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| ethyl (E,Z)-2,4-decadienoate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| eucalyptus oil | |
| fir needle oil | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| hexyl isovalerate | |
| hexyl tiglate | |
| leaf acetal | |
| lemon oil | |
| lime oil | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| neryl acetate | |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| orange oil | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| spearmint oil | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| gamma- | undecalactone |
| verbena oil | |
| violet methyl carbonate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| apple | |
| apple blossom | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arrack | |
| banana | |
| bark | |
| berry jam | |
| blossom tropical blossom | |
| bramble arctic bramble blackberry | |
| brandy | |
| briar sweet briar eglantine | |
| cassis black currant bud | |
| cheese romano cheese | |
| cheese swiss cheese | |
| cherry black cherry | |
| cherry blossom | |
| cider | |
| citronella | |
| cloudberry bakeapple | |
| crabapple blossom | |
| date | |
| elderberry | |
| foliage | |
| gingergrass | |
| gooseberry | |
| grape | |
| grape white grape | |
| grapefruit | |
| grass green grass | |
| hibiscus | |
| iris blossom | |
| jackfruit | |
| kiwi | |
| kiwi blossom | |
| kumquat | |
| licorice | |
| lychee soapberry | |
| mandarin | |
| mango | |
| marigold tagete | |
| mate | |
| melon watermelon muskmelon cantaloupe | |
| myrtle | |
| nectarine | |
| orange | |
| osmanthus | |
| papaya | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear bartlett pear | |
| pear blossom | |
| pear emperor pear | |
| pineapple | |
| plum | |
| plum blossom | |
| plum greengage plum | |
| plum mirabelle plum | |
| plum mirabille blossom | |
| pomegranate | |
| rose wild rose | |
| rue | |
| rum butter rum | |
| sarsaparilla | |
| spearmint | |
| starfruit | |
| tangerine | |
| tarragon | |
| tea | |
| tropical | |
| tutti frutti | |
| wine | |
| wintergreen | |
| natural occurrence in : | |
| brandy grape brandy | |
| cider | |
| whiskey | |
| wine strawberry wine | |