Notes :
rose accord:
0.01 - dihydromyrcenol
0.05 - benzyl propionate
0.05 - linalyl acetate
0.05 - phenethyl alcohol
0.01 - aldehyde C-14 10%
0.20 - amyl cinnamaldehyde
0.01 - ma/hy shiff
0.05 - naphthyl ethyl ether
0.01 - aldehyde C-16 10%
0.05 - geraniol
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-(phenylmethylidene)heptanal | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | HMKKIXGYKWDQSV-UHFFFAOYAT | |||||||||||||||||||||||||||||||||
| SMILES : | CCCCCC(=CC1=CC=CC=C1)C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| IUPAC name : | (2E)-2-(phenylmethylidene)heptanal | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3/b14-11+ | |||||||||||||||||||||||||||||||||
| InChIKey : | HMKKIXGYKWDQSV-SDNWHVSQBM | |||||||||||||||||||||||||||||||||
| SMILES : | CCCCC/C(=C\C1=CC=CC=C1)/C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| IUPAC name : | (2Z)-2-(phenylmethylidene)heptanal | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H18O/c1-2-3-5-10-14(12-15)11-13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3/b14-11- | |||||||||||||||||||||||||||||||||
| InChIKey : | HMKKIXGYKWDQSV-KAMYIIQDBT | |||||||||||||||||||||||||||||||||
| SMILES : | CCCCC/C(=C/C1=CC=CC=C1)/C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2912.29.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet floral oily fruity herbal jasmin | |||||||||||||||||||||||||||||||||
| taste description³ : | at 2.50 ppm. Tropical, waxy, floral, rosy and honey-like with a fruity nuance and body | |||||||||||||||||||||||||||||||||
| substantivity : | 256 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | pale yellow to yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.96300 - 0.97100 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.013 to 8.080 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.96400 - 0.97200 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.031 to 8.097 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.55500 - 1.55900 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 287.00 - 290.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 4.80 | |||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| Storage : | refrigerate in tightly sealed containers. store under nitrogen. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3730.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||||||||
| Category 1 : | 0.70 % (1) | Category 2 : | 0.90 % | |||||||||||||||||||||||||||||||
| Category 3 : | 3.60 % | Category 4 : | 10.70 % | |||||||||||||||||||||||||||||||
| Category 5 : | 5.60 % | Category 6 : | 17.10 % (1) | |||||||||||||||||||||||||||||||
| Category 7 : | 1.80 % | Category 8 : | 2.00 % | |||||||||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case alpha-amyl cinnamaldehyde) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||||||||
| recommendation for alpha-amyl cinnamaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||
| 15.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-541-5 | |||||||||||||||||||||||||||||||||
| rtecs : | GD6825000 for 122-40-7 | |||||||||||||||||||||||||||||||||
| chemidplus : | 122-40-7 | |||||||||||||||||||||||||||||||||
| epa-srs : | 122-40-7 | |||||||||||||||||||||||||||||||||
| chemidplus : | 001331926 | |||||||||||||||||||||||||||||||||
| epa-srs : | 1331-92-6 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 6649 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000122407 | |||||||||||||||||||||||||||||||||
| epa-srs : | 122-40-7 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 34673372 | |||||||||||||||||||||||||||||||||
| pubchem : | 742288 | |||||||||||||||||||||||||||||||||
| pubchem : | 173240 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3319277407 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 22, No. 6, 41, (1997)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| amyl cinnamal | |
| alpha- | amyl cinnamaldehyde |
| amyl cinnamic acid aldehyde | |
| amyl cinnamic aldehyde | |
| alpha- | amyl-beta-phenyl acrolein |
| 2- | benzylidene heptanal |
| buxine | |
| jasmin aldehyde | |
| jasminal | |
| jasminaldehyde | |
| 2- | pentyl cinnamaldehyde |
| alpha- | pentyl cinnamaldehyde |
| alpha- | pentyl-beta-phenyl acrolein |
| 2-( | phenyl methylene) heptanal |
| soluble in : | |
| ethyl alcohol, 4 vol. of 80% alcohol | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| stability : | |
| alcoholic lotion | |
| alkalis | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| amyris wood oil | |
| para- | anisaldehyde |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| bois de rose oil | |
| cassia bark oil | |
| cedarwood oils | |
| chamomile oil | |
| citronella oils | |
| coconut absolute | |
| copaiba balsam oil | |
| costus valerolactone | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| ethyl laurate | |
| iso | eugenol |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| green acetate | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| labdanum resinoid | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| musks | |
| nerolidol | |
| nonanal | |
| nonanol | |
| ocean propanal | |
| olibanum oil | |
| patchouli ethanone | |
| petitgrain oil | |
| raspberry ketone methyl ether | |
| rose butanoate | |
| santall | |
| strawberry glycidate 1 | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| a suma | |
| acacia | |
| aimant | |
| aldehydic | |
| almond | |
| anais anais | |
| apple | |
| apple blossom | |
| apricot | |
| blue grass | |
| blue mist | |
| bluebell | |
| bouquet | |
| bubblegum | |
| cedar | |
| chanel #5 | |
| charlie | |
| cherry | |
| chloe | |
| christmas blends | |
| cinnamon | |
| cinq fleurs forvil | |
| citrus | |
| cologne | |
| cyclamen | |
| estee | |
| fidji | |
| floral | |
| fresh | |
| gardenia | |
| grass sweet grass | |
| heather | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| jasmin | |
| jicky | |
| jonquil narcissus jonquilla | |
| joy | |
| l'air du temps | |
| leather | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| lux beauty shower soap | |
| magnolia | |
| mimosa wattle | |
| muguet lily of the valley | |
| musk | |
| my sin | |
| neroli | |
| norell | |
| orange | |
| orchid | |
| oriental | |
| paris | |
| peach | |
| pine | |
| popcorn | |
| potpourri | |
| powder | |
| presence | |
| rose | |
| rose white rose | |
| scandal | |
| shalimar | |
| sherry | |
| spice | |
| strawberry | |
| sweet pea pois de senteur | |
| tabu | |
| tide | |
| tuberose tubereuse | |
| violet | |
| vol de nuit | |
| wallflower giroflee | |
| wine | |
| woody | |
| natural occurrence in : | |
| soya bean | |
| tea black tea | |