Notes :
Allyl caproate is employed principally in the formulation of pineapple flavors but it canas als be used for peach and apricot essences and for apple blossom, peach blossom, and wisteria perfume compositions. Allyl caproate is an ingredient of some lipstick perfumes. Adds a sweet juicy note to citrus flavors.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | prop-2-enyl hexanoate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H16O2/c1-3-5-6-7-9(10)11-8-4-2/h4H,2-3,5-8H2,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | RCSBILYQLVXLJG-UHFFFAOYAX | |||||||||||||||||||||||||||||||||
| SMILES : | CCCCCC(=O)OCC=C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.90.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet fruity pineapple tropical rum arrack fatty | |||||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Sweet, fresh, juicy pineapple and fruity | |||||||||||||||||||||||||||||||||
| substantivity : | < 1 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.88300 - 0.89100 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.347 to 7.414 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.88400 - 0.89200 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.364 to 7.431 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.42200 - 1.42600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 190.00 - 191.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 75.00 - 76.00 °C. @ 15.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 3.12 | |||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn N - Harmful, Dangerous for the environment. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 218.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 300.00 mg/kg FCTXAV 11,489,1973 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 151.00 °F. TCC ( 66.11 °C. ) | |||||||||||||||||||||||||||||||||
| IFRA purity specification : | < 0.1% free allyl alcohol | |||||||||||||||||||||||||||||||||
| recommendation for allyl hexanoate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for allyl hexanoate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 210.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-642-4 | |||||||||||||||||||||||||||||||||
| rtecs : | MO6125000 for 123-68-2 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000123682 | |||||||||||||||||||||||||||||||||
| epa-srs : | 123-68-2 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 20962 | |||||||||||||||||||||||||||||||||
| ifra : | ifra - ( Found under : Allyl esters ) | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 173308 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4250796658 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 18, No. 2, 38, (1993)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| allyl caproate | |
| allyl capronate | |
| allyl hexanoate | |
| hexanoic acid 2-propenyl ester | |
| hexanoic acid allyl ester | |
| 2- | propenyl hexanoate |
| 2- | propenyl N-hexanoate |
| soluble in : | |
| benzyl alcohol | |
| ethyl alcohol, 1:2 in 80% alcohol | |
| fixed oils | |
| paraffin oil | |
| insoluble in : | |
| water | |
| propylene glycol | |
| stability : | |
| stable in most media | |
| (odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| iso | butyl 3-(2-furan) propionate |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydromyrcenol | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| geraniol | |
| green acetate | |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| apple | |
| apple blossom | |
| apple green apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bubblegum | |
| cabochard | |
| cherry wild cherry | |
| citrus | |
| coconut | |
| floral | |
| fruit | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| green | |
| moss | |
| orange | |
| passion fruit | |
| peach | |
| peach blossom | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| pomegranate | |
| potato baked potato | |
| quince | |
| rose | |
| rum | |
| tutti frutti | |
| wistaria wisteria glycine | |
| natural occurrence in : | |
| mushroom | |
| pineapple | |
| potato baked potato | |