| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 1-(5,5-dimethyl-1-cyclohexenyl)pent-4-en-1-one | |||||||||||||||||||||||||
| InChI : | InChI=1/C13H20O/c1-4-5-8-12(14)11-7-6-9-13(2,3)10-11/h4,7H,1,5-6,8-10H2,2-3H3 | |||||||||||||||||||||||||
| InChIKey : | OEVIJAZJVZDBQL-UHFFFAOYAG | |||||||||||||||||||||||||
| SMILES : | CC1(CCC=C(C1)C(=O)CCC=C)C | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| export tariff code : | 2914.29.0000 | |||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||
| Firmenich : | DYNASCONE®
≥90% Odor: Green, fruity, floral. An extremely powerful and diffusive material that has an odour reminiscent of galbanum, with a pineapple and hyacinth character. | |||||||||||||||||||||||||
| Firmenich : | NEOBUTENONE® ALPHA
≥98% Odor: Intense green galbanum odor with an earthy, ozonic, pineapple note. | |||||||||||||||||||||||||
| IFF : | Galbascone High Alpha
82% Alpha Isomer | |||||||||||||||||||||||||
| IFF : | Galbascone
≥95% (sum of isomers) Odor: Intense green galbanum odor with an earthy, ozonic, pineapple note. | |||||||||||||||||||||||||
| Penta : | 1-(5,5-dimethyl-1-cyclohexen-1-yl)-4-penten-1-one | |||||||||||||||||||||||||
| Vigon : | Dynascone
Odor: GREEN, HERBACEOUS | |||||||||||||||||||||||||
| Vigon : | Dynascone
10% DIPG Odor: SHARP, GREEN, HERBACEOUS | |||||||||||||||||||||||||
| Vigon : | Neobutenone Alpha | |||||||||||||||||||||||||
| Vigon : | Neobutenone Alpha
10% DIPG | |||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | green galbanum floral pineapple fruity hyacinth | |||||||||||||||||||||||||
| substantivity : | > 48 hour(s) at 100.00 % | |||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||
| appearence : | pale yellow to yellow clear liquid | |||||||||||||||||||||||||
| assay : | 95.00 to 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| specific gravity : | 0.92100 to 0.93100 @ 20.00 °C. | |||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.673 to 7.756 | |||||||||||||||||||||||||
| refractive index : | 1.48700 to 1.49200 @ 20.00 °C. | |||||||||||||||||||||||||
| boiling point : | 268.00 to 269.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||
| flash point : | 235.00 °F. TCC ( 112.78 °C. ) | |||||||||||||||||||||||||
| logP (o/w) : | 4.45 | |||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
|
R 43 - May cause sensitisation by skin contact. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||
| Human experience : | no skin, eye, irritation or sensitization at 10%. | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||
|
Oral-Rat >5000.00 mg/kg | ||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||
|
Skin-Rabbit >2000.00 mg/kg | ||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||
| recommendation for galbanum ketone usage levels up to : | ||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for galbanum ketone usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||
| 1-(5,5-dimethyl-1-cyclohexenyl)pent-4-en-1-one | ||||||||||||||||||||||||||
| (EINECS) number : | 260-486-7 | |||||||||||||||||||||||||
| chemidplus : | 056973854 | |||||||||||||||||||||||||
| EPA Substance Registry Services : | 56973-85-4 | |||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||
| 1-(5,5-dimethyl-1-cyclohexenyl)pent-4-en-1-one | ||||||||||||||||||||||||||
| pubchem : | 669501 | |||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||
| synonyms : | |
| neo | butenone alpha |
| dimethyl cyclohexenyl 3-butenyl ketone | |
| 1-(5,5- | dimethyl-1-cyclohexen-1-yl) pent-4-en-1-one |
| 1-(5,5- | dimethyl-1-cyclohexenyl)pent-4-en-1-one |
| dynascone | |
| galbascone | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| galbanum oil | |
| galbanum oxyacetate | |
| geraniol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| 2,4- | ivy carbaldehyde |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
(odor and/or flavor) used in : | |
| apple | |
| apple red apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| bramble arctic bramble | |
| chamomile | |
| christmas blends | |
| chypre | |
| cloudberry bakeapple | |
| coconut tropical coconut | |
| fern fougere | |
| fig | |
| floral | |
| fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| galbanum | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| lavender | |
| lilac lilas syringa | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| papaya | |
| passion fruit | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| plum mirabelle plum | |
| pomegranate | |
| quince | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tomato | |
| tropical | |
| tutti frutti | |
| woody | |
natural occurrence in : | |
| not found in nature | |