| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 1-(5,5-dimethyl-1-cyclohexenyl)pent-4-en-1-one | |||||||||||||||||||||||
| InChI : | InChI=1/C13H20O/c1-4-5-8-12(14)11-7-6-9-13(2,3)10-11/h4,7H,1,5-6,8-10H2,2-3H3 | |||||||||||||||||||||||
| InChIKey : | OEVIJAZJVZDBQL-UHFFFAOYAG | |||||||||||||||||||||||
| SMILES : | CC1(CCC=C(C1)C(=O)CCC=C)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2914.29.0000 | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | green galbanum floral pineapple fruity hyacinth | |||||||||||||||||||||||
| substantivity : | 72 hour(s) at 100.00 % | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | pale yellow to yellow clear liquid | |||||||||||||||||||||||
| assay : | 95.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.92700 - 0.93400 @ 20.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 7.723 to 7.781 | |||||||||||||||||||||||
| refractive index : | 1.48700 - 1.49200 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 268.00 - 269.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||
| logp : | 4.45 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||
| recommendation for galbanum ketone usage levels up to : | ||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for galbanum ketone usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 260-486-7 | |||||||||||||||||||||||
| chemidplus : | 056973854 | |||||||||||||||||||||||
| epa-srs : | 56973-85-4 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 669501 | |||||||||||||||||||||||
| synonyms : | |
| neo | butenone alpha |
| dimethyl cyclohexenyl 3-butenyl ketone | |
| 1-(5,5- | dimethyl-1-cyclohexen-1-yl) pent-4-en-1-one |
| dynascone | |
| galbanum ketone | |
| galbascone | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydrojasmone | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| galbanum oil | |
| galbanum oxyacetate | |
| geraniol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| 2,4- | ivy carbaldehyde |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| watermelon ketone | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| apple | |
| apple red apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| bramble arctic bramble | |
| chamomile | |
| christmas blends | |
| chypre | |
| cloudberry bakeapple | |
| coconut tropical coconut | |
| fern fougere | |
| fig | |
| floral | |
| fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| galbanum | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| lavender | |
| lilac lilas syringa | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| papaya | |
| passion fruit | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| plum mirabelle plum | |
| pomegranate | |
| quince | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tomato | |
| tropical | |
| tutti frutti | |
| woody | |
| natural occurrence in : | |
| not found in nature | |