| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | 2-cyclohexyl-1,6-heptadien-3-one | |||||||||||||||||||||||||||
| InChI : | InChI=1/C13H20O/c1-3-4-10-13(14)11(2)12-8-6-5-7-9-12/h3,12H,1-2,4-10H2 | |||||||||||||||||||||||||||
| InChIKey : | WJWBVJLPGOYBGM-UHFFFAOYAS | |||||||||||||||||||||||||||
| SMILES : | O=C(CCC=C)C(=C)C1CCCCC1 | |||||||||||||||||||||||||||
|
||||||||||||||||||||||||||||
| IUPAC name : | 3-(3-hydroxypropoxy)propan-1-ol | |||||||||||||||||||||||||||
| InChI : | InChI=1/C6H14O3/c7-3-1-5-9-6-2-4-8/h7-8H,1-6H2 | |||||||||||||||||||||||||||
| InChIKey : | SZXQTJUDPRGNJN-UHFFFAOYAD | |||||||||||||||||||||||||||
| SMILES : | C(CO)COCCCO | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Givaudan : | Pharaone
10%/DPG Odor: Green, Pineapple, Fruity, Herbaceous | |||||||||||||||||||||||||||
| Vigon : | Pharaone
10% DPG | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | green pineapple fruity undecatriene galbanum | |||||||||||||||||||||||||||
| substantivity : | 196 Hour(s) | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||
| assay : | 10.00 to 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| vapor pressure : | 0.02400 mm/Hg @ 20.00 °C. | |||||||||||||||||||||||||||
| flash point : | 234.00 °F. TCC ( 112.22 °C. ) | |||||||||||||||||||||||||||
| logP (o/w) : | 3.52 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||
|
R 38 - Irritating to skin. R 41 - Risk of serious damage to eyes. R 51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 39 - Wear eye/face protection. S 61 - Avoid release to the environment. Refer to special instructions/safety data sheet. | ||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||
| recommendation for pineapple heptadienone 10% usage levels up to : | ||||||||||||||||||||||||||||
| 2.5000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for pineapple heptadienone 10% usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||
| WISER : | UN 3082 | |||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||
| 2-cyclohexyl-1,6-heptadien-3-one | ||||||||||||||||||||||||||||
| chemidplus : | 313973374 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 313973-37-4 | |||||||||||||||||||||||||||
| 3-(3-hydroxypropoxy)propan-1-ol | ||||||||||||||||||||||||||||
| (EINECS) number : | 246-770-3 | |||||||||||||||||||||||||||
| RTECS : | UB8765000 for 25265-71-8 | |||||||||||||||||||||||||||
| chemidplus : | 025265718 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 25265-71-8 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| 2-cyclohexyl-1,6-heptadien-3-one | ||||||||||||||||||||||||||||
| pubchem : | 3820690 | |||||||||||||||||||||||||||
| 3-(3-hydroxypropoxy)propan-1-ol | ||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 64881945 | |||||||||||||||||||||||||||
| pubchem : | 174790 | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| synonyms : | |
| 2- | cyclohexyl-1,6-heptadien-3-one |
| pharaone 10% | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| blood orange oil | |
| caramel furanone | |
| cardamom seed oil | |
| citral | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydromyrcenol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| ethyl acetoacetate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| geraniol | |
| green acetate | |
| (Z)-3- | hexen-1-yl acetate |
| alpha- | hexyl cinnamaldehyde |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| 2- | methyl undecanal |
| musks | |
| beta- | naphthyl ethyl ether |
| (E,Z)-2,6- | nonadien-1-ol |
| nonanol | |
| ocean propanal | |
| orange oil | |
| osmanthus absolute | |
| phenethyl isovalerate | |
| phenethyl propionate | |
| raspberry ketone acetate | |
| rose butanoate | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| violet leaf absolute | |
| ylang ylang oil | |
(odor and/or flavor) used in : | |
| agrumen | |
| apple | |
| apple red apple | |
| apricot | |
| blueberry whortleberry red whortleberry | |
| bouquet | |
| bramble arctic bramble | |
| bubblegum | |
| chamomile | |
| christmas blends | |
| chypre | |
| citrus | |
| cloudberry bakeapple | |
| coconut tropical coconut | |
| fern fougere | |
| fig | |
| floral | |
| fruit | |
| fruit jam | |
| fruit juicy fruit | |
| fruit punch | |
| fruit tropical fruit | |
| galbanum | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| jasmin | |
| lavender | |
| lilac lilas syringa | |
| mango | |
| natural | |
| papaya | |
| passion fruit | |
| pina colada | |
| pineapple | |
| plum greengage plum | |
| plum mirabelle plum | |
| pomegranate | |
| quince | |
| raspberry | |
| rose | |
| spice | |
| strawberry | |
| tomato | |
| tropical | |
| tutti frutti | |
| woody | |
natural occurrence in : | |
| not found in nature | |