Notes :
Can get some extraordinary blends if you shade it well.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 3-hydroxy-4,5-dimethyl-5H-furan-2-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H8O3/c1-3-4(2)9-6(8)5(3)7/h4,7H,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | UNYNVICDCJHOPO-UHFFFAOYAI | |||||||||||||||||||||||||||||||
| SMILES : | CC1C(=C(C(=O)O1)O)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2905.32.0000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | caramellic | |||||||||||||||||||||||||||||||
| odor strength : | very high , recommend smelling in a 0.01 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 0.01 % in propylene glycol. | extremely sweet strong caramel maple burnt sugar coffee | |||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Sweet, caramellic, maple, brown sugary and cotton candy | |||||||||||||||||||||||||||||||
| substantivity : | > 400 hour(s) at 3.00 % in propylene glycol | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow liquid to solid | |||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| refractive index : | 1.49100 - 1.49400 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| melting point : | 26.00 - 29.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 93.00 - 95.00 °C. @ 2.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 81.00 °C. @ 6.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | -0.44 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 1.80 (μg/capita/day) | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for caramel furanone usage levels up to : | ||||||||||||||||||||||||||||||||
| 0.0100 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for caramel furanone usage levels up to : | ||||||||||||||||||||||||||||||||
| 30.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 249-136-4 | |||||||||||||||||||||||||||||||
| chemidplus : | 028664359 | |||||||||||||||||||||||||||||||
| epa-srs : | 28664-35-9 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 204979 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 41925784 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 22, No. 4, 75, (1997)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| caramel furanone | |
| caramel lactone | |
| dimethyl oxyfurone | |
| 4,5- | dimethyl-3-hydroxy-2,5-dihydrofuran-2-one |
| 4,5- | dimethyl-3-hydroxy-2(5H)-furanone |
| 2,3- | dimethyl-4-hydroxy-2,5-dihydrofuran-5-one |
| fenugreek lactone | |
| 2- | hydroxy-3-methyl-2-penten-4-olide |
| 3- | hydroxy-4,5-dimethyl furan-2(5H)-one |
| soloton | |
| sotolone | |
| sugar lactone | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic fine fragrance, good | |
| antiperspirant, fair | |
| fabric softener, fair | |
| hypochlorite bleach, poor | |
| liquid detergent, fair | |
| perborate powder detergent, poor | |
| soap, fair | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| 2- | acetyl pyrazine |
| 2- | acetyl pyridine |
| 2- | acetyl-2-thiazoline |
| ambroxan | |
| para- | anisyl acetate |
| beeswax absolute | |
| benzyl salicylate | |
| blood orange oil | |
| cassia bark oil | |
| coffee furanone | |
| currant bud absolute black | |
| gamma- | decalactone |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fenugreek absolute | |
| fir balsam absolute | |
| floral pyranol | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| ionones | |
| maltol | |
| maple notes | |
| melon heptenal | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl octine carbonate | |
| methyl phenyl acetate | |
| mimosa absolute | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| osmanthus absolute | |
| 3- | phenyl propyl alcohol |
| pineapple ketone | |
| raspberry ketone | |
| rose oxides | |
| santall | |
| strawberry furanone | |
| sugar notes | |
| tonka bean absolute | |
| 2,4,5- | trimethyl thiazole |
| gamma- | undecalactone |
| vanillin | |
| verymoss | |
| violet leaf absolute | |
| (odor and/or flavor) used in : | |
| allspice | |
| banana | |
| bay rum | |
| blackberry | |
| butterscotch | |
| candy cotton candy | |
| caramel | |
| cinnamon | |
| coconut | |
| coffee | |
| cranberry | |
| fenugreek | |
| fig | |
| fir | |
| fir balsam | |
| gingerbread | |
| honeysuckle chevrefeuille | |
| mango | |
| maple | |
| melon | |
| mulberry | |
| musk | |
| nut | |
| papaya | |
| passion fruit | |
| peach | |
| pina colada | |
| pineapple | |
| pomegranate | |
| pumpkin | |
| sugar brown sugar | |
| tobacco tabac tabaco | |
| toffee | |
| tonka | |
| vanilla | |
| natural occurrence in : | |
| coffee | |
| fenugreek | |
| maple | |
| pineapple | |
| sake | |
| sherry | |
| tobacco virginia | |