| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||
| IUPAC name : | 6,6,9a-trimethyl-1,2,3a,4,5,5a,7,8,9,9b-decahydronaphtho[2,1-b]furan | |||||||||||||||||||||
| InChI : | InChI=1/C15H26O/c1-14(2)8-4-9-15(3)11-7-10-16-12(11)5-6-13(14)15/h11-13H,4-10H2,1-3H3 | |||||||||||||||||||||
| InChIKey : | IPEPBOBQYDJNON-UHFFFAOYAF | |||||||||||||||||||||
| SMILES : | CC1(CCCC2(C1CCC3C2CCO3)C)C | |||||||||||||||||||||
|
| |||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2932.19.0000 | |||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | dry amber ambergris paper musk woody cedar pine green seedy | |||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||
| properties : | ||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||
| melting point : | 168.80 °C. @ 0.00 mm Hg | |||||||||||||||||||||
| boiling point : | 267.00 - 268.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||
| logp : | 4.93 | |||||||||||||||||||||
| safety : | ||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||
| recommendation for ambroxide usage levels up to : | ||||||||||||||||||||||
| 1.0000 % in the fragrance concentrate. | ||||||||||||||||||||||
| recommendation for ambroxide usage levels up to : | ||||||||||||||||||||||
| 30.0000 ppm in the flavor. | ||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||
| chemidplus : | 065588694 | |||||||||||||||||||||
| epa-srs : | 65588-69-4 | |||||||||||||||||||||
| other : | ||||||||||||||||||||||
| references : | ||||||||||||||||||||||
| pubchem : | 773655 | |||||||||||||||||||||
| synonyms : | |
| amberlyn | |
| ambrox | |
| ambroxide | |
| dodecahydro-3alpha,6,6,9alpha-tetramethyl naphtho 2,1-beta furan | |
| 3alpha,6,6,9alpha-per | hydrotetramethyl naphtho(2,1-beta)furan |
| 1,5,5,9- | tetramethyl-13-oxatricyclo(8.3.0.0)(4,9)tridecane |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| antiperspirant | |
| detergent powder | |
| inorganic acid cleaner | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| alpha- | ambrinol |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| dimethyl heptanol | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| geosmin | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| 3- | megastigmatrienone |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blackberry | |
| blue grass | |
| blueberry | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| cloth clean cloths | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| paper | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| raspberry | |
| sandalwood | |
| spice | |
| tea | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| data page | cistus oil @ 1.4% |