| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl 2-hydroxypropanoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | LZCLXQDLBQLTDK-UHFFFAOYAV | |||||||||||||||||||||||||||||||||||
| SMILES : | CCOC(=O)C(C)O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 175.105 |
h. number : | 2915.50.3000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in propylene glycol. | sharp tart fruity buttery butterscotch | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Sweet, fruity, creamy, pineapple-like with a caramellic brown nuance | |||||||||||||||||||||||||||||||||||
| substantivity : | 4 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.02900 - 1.03200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.562 to 8.587 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.41000 - 1.42000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -26.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 154.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | -0.18 | |||||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Muskrat 2500.00 mg/kg JPETAB 65,89,1939 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTOD7 20,677,1982 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 120.00 °F. TCC ( 48.89 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for ethyl lactate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 12.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for ethyl lactate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 3100.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-598-0 | |||||||||||||||||||||||||||||||||||
| rtecs : | OD5075000 for 97-64-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000097643 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 97-64-3 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8850 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150406 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2054125992 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 18, No. 4, 51, (1993)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| actylol | |
| acytol | |
| ethyl 2-hydroxypropanoate | |
| ethyl 2-hydroxypropionate | |
| ethyl alpha-hydroxypropionate | |
| ethyl lactate | |
| 2- | hydroxypropanoic acid ethyl ester |
| lactic acid ethyl ester | |
| solactol | |
| soluble in : | |
| alcohol | |
| isopropyl myristate | |
| water, 1000000 mg/L @ 25C | |
| insoluble in : | |
| paraffin oil | |
| (odor and/or flavor) blends with : | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| anise seed oil | |
| benzaldehyde | |
| benzyl acetate | |
| benzyl propionate | |
| blood orange oil | |
| cassia bark oil | |
| citral | |
| citronella oils | |
| citrus carbaldehyde | |
| clary sage oil | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| decanal | |
| decanol | |
| (E)-4- | decen-1-al |
| decyl acetate | |
| diacetyl | |
| diethyl malonate | |
| dihydromyrcenol | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl heptanoate | |
| ethyl phenyl acetate | |
| eucalyptus oil | |
| fennel seed oil | |
| fir needle oil | |
| galbanum oil | |
| geranyl acetate | |
| green acetate | |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl acetate | |
| hexyl isovalerate | |
| 2,4- | ivy carbaldehyde |
| lemon oil | |
| lime oil | |
| linalyl acetate | |
| litsea cubeba oil | |
| melon heptenal | |
| methyl heptenone | |
| methyl phenyl acetate | |
| neryl acetate | |
| nonanal | |
| nonanol | |
| nopyl acetate | |
| octanal | |
| orange oil | |
| pepper oil black | |
| petitgrain oil | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| spruce oil | |
| styralyl acetate | |
| alpha- | terpinyl acetate |
| tetrahydromyrcenol | |
| (odor and/or flavor) used in : | |
| almond | |
| apple | |
| apple crabapple | |
| apple green apple | |
| beer bantu beer | |
| bread white bread | |
| butterscotch | |
| caramel | |
| cheese | |
| cherry | |
| cherry maraschino cherry | |
| chervil | |
| chestnut blossom | |
| chocolate cocoa | |
| cider | |
| cilantro | |
| clary sage | |
| cloudberry bakeapple | |
| coconut | |
| cognac | |
| cologne | |
| cranberry | |
| dogwood | |
| ethereal | |
| fig | |
| grape | |
| grapefruit | |
| horseradish | |
| ivy leaf | |
| lychee soapberry | |
| mustard | |
| nut | |
| orange bitter orange | |
| palmarosa | |
| patchouli | |
| pea green pea | |
| pear brandy | |
| peel | |
| pineapple | |
| plum brandy | |
| plum greengage plum | |
| radish | |
| rhubarb | |
| rum | |
| saki | |
| sauerkraut | |
| sherry | |
| spruce | |
| strawberry | |
| strawberry leaf | |
| tobasco | |
| vinegar | |
| wasabi | |
| watercress nasturtium | |
| wormwood absinthium | |
| natural occurrence in : | |
| apple | |
| apricot | |
| chicken | |
| cocoa | |
| grape | |
| pineapple | |
| plum | |
| raspberry | |