Notes :
Accentuate peppery camphor notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10-/m1/s1 | |||||||||||||||||||||||||||||||||
| InChIKey : | DTGKSKDOIYIVQL-NQMVMOMDBK | |||||||||||||||||||||||||||||||||
| SMILES : | CC1([C@@H]2CC[C@@]1([C@@H](C2)O)C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2906.39 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| Advanced Biotech : | borneol
98% min. natural Odor: Bornyl Alcohol, Camphor | |||||||||||||||||||||||||||||||||
| Citrus and Allied Essences : | laevo-borneol crystals extra
(80-20) | |||||||||||||||||||||||||||||||||
| Citrus and Allied Essences : | laevo-borneol crystals
96% | |||||||||||||||||||||||||||||||||
| Fleurchem : | l-borneol
natural | |||||||||||||||||||||||||||||||||
| Fleurchem : | l-borneol | |||||||||||||||||||||||||||||||||
| Penta : | laevo-borneol
crystals | |||||||||||||||||||||||||||||||||
| Pfaltz & Bauer : | L_Borneol | |||||||||||||||||||||||||||||||||
| Sigma-Aldrich-Fluka : | (-)-Borneol
purum, ≥95.0% (sum of enantiomers, GC) | |||||||||||||||||||||||||||||||||
| TCI AMERICA : | (-)-Borneol
>95.0%(GC) | |||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | pine woody camphor | |||||||||||||||||||||||||||||||||
| odor sample from : | CA Aromatics Company Inc. | |||||||||||||||||||||||||||||||||
| substantivity : | 16 Hour(s) | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless crystals | |||||||||||||||||||||||||||||||||
| assay : | 80.00 to 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| optical rotation : | -20.00 to 0.00 | |||||||||||||||||||||||||||||||||
| melting point : | 206.00 to 208.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 210.00 to 212.00 °C. @ 779.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 203.00 to 204.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| vapor density : | 5.3 ( Air = 1 ) | |||||||||||||||||||||||||||||||||
| flash point : | 150.00 °F. TCC ( 65.56 °C. ) | |||||||||||||||||||||||||||||||||
| logP (o/w) : | 3.01 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||
|
R 22 - Harmful if swallowed. R 43 - May cause sensitisation by skin contact. S 02 - Keep out of the reach of children. S 22 - Do not breath dust. S 36/39 - Wear suitable clothing and eye/face protection. | ||||||||||||||||||||||||||||||||||
| Human experience : | 20 % solution: no irritation or sensitization. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||
|
Oral-Rat 5800.00 mg/kg Food and Cosmetics Toxicology. Vol. 16, Pg. 655, 1978. | ||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||||
| recommendation for laevo-borneol usage levels up to : | ||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for laevo-borneol usage levels up to : | ||||||||||||||||||||||||||||||||||
| 6.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||
| EPA GENetic TOXicology : | Search | |||||||||||||||||||||||||||||||||
| Env. Mutagen Info. Center : | Search | |||||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||||
| WISER : | UN 1312 | |||||||||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||||||||
| (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 207-353-1 | |||||||||||||||||||||||||||||||||
| RTECS : | DT5095000 for 464-45-9 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000464459 | |||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 464-45-9 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 26352 | |||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol | ||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 464459 | |||||||||||||||||||||||||||||||||
| pubchem : | 153282 | |||||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1989)¹ | |||||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||||||||
| synonyms : | |
| laevo-2- | bornanol |
| laevo-endo-2- | bornanol |
| ((1S)-endo)-(-)- | borneol |
| (1S,2R,4S)-(-)- | borneol |
| dextro- | camphanol |
| laevo-2- | camphanol |
| laevo-endo-2- | camphanol |
| laevo- | camphol |
| laevo-2- | hydroxybornane |
| laevo-endo-2- | hydroxycamphane |
| (1S-endo)-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol |
| laevo-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol |
| (1S,4R,6R)-1,7,7- | trimethylbicyclo[2.2.1]heptan-6-ol |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
| propylene glycol | |
insoluble in : | |
| water | |
stability : | |
| bath foam | |
| cream | |
| detergent | |
| lotion | |
| non-discoloring in most media | |
| shampoo | |
(odor and/or flavor) blends with : | |
| acetophenone | |
| ambrette seed oil | |
| alpha- | amyl cinnamaldehyde |
| amyris wood oil | |
| angelica root oil | |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl salicylate | |
| bornyl acetate | |
| iso | bornyl acetate |
| cangerana root bark oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarleaf oil | |
| cedarwood oil atlas | |
| cedarwood oils | |
| chamomile oil | |
| cistus oil | |
| clove bud oil | |
| coriander seed oil | |
| costus valerolactone | |
| currant bud absolute black | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| ethyl laurate | |
| fir balsam absolute | |
| frankincense oil | |
| gurjun balsam oil | |
| alpha- | hexyl cinnamaldehyde |
| juniper berry oil | |
| labdanum resinoid | |
| menthol | |
| methyl cedryl ketone | |
| methyl phenyl acetate | |
| 2- | methyl undecanal |
| musks | |
| myrrh oil | |
| patchouli ethanone | |
| patchouli oil | |
| peppermint oil | |
| santall | |
| thymol | |
| tonka bean absolute | |
| vanillin | |
| verymoss | |
| woody acetate | |
(odor and/or flavor) used in : | |
| agate | |
| balsam | |
| bayberry | |
| bouquet | |
| camphor | |
| cardamom | |
| carrot | |
| castoreum | |
| cedar forest | |
| cedarleaf | |
| cedarwood | |
| christmas blends | |
| cinnamon | |
| citronella | |
| coriander | |
| earth humus | |
| fir | |
| fir balsam | |
| fir needle | |
| fixer | |
| geranium | |
| ginger | |
| grass sweet grass | |
| herbal | |
| hollyberry | |
| juniperberry | |
| lavandin | |
| lavender | |
| lavender spike lavender | |
| mace | |
| myrrh | |
| nutmeg | |
| oakmoss mousse de chene | |
| olibanum frankincense | |
| patchouli | |
| peppermint | |
| pine | |
| pine needle | |
| rosemary | |
| sage | |
| snakeroot | |
| spice | |
| spruce | |
| truffle | |
| valerian | |
| woody | |
natural occurrence in : | |
| cardamom | |
| carrot | |
| cinnamon leaf | |
| citronella | |
| coriander | |
| geranium | |
| ginger | |
| lime oil distilled | |
| mace | |
| nutmeg | |
| oakmoss | |
| olibanum | |
| pine needle | |
| rosemary | |
| sage | |
| snake root | |
| thyme | |
| valerian root | |