Notes :
Accentuate peppery camphor notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | (1S,4R,6R)-1,7,7-trimethylbicyclo[2.2.1]heptan-6-ol | |||||||||||||||||||||||||||
| InChI : | InChI=1/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10-/m1/s1 | |||||||||||||||||||||||||||
| InChIKey : | DTGKSKDOIYIVQL-NQMVMOMDBK | |||||||||||||||||||||||||||
| SMILES : | CC1([C@@H]2CC[C@@]1([C@@H](C2)O)C)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | 2906.39 | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Fleurchem : | l-borneol | |||||||||||||||||||||||||||
| natural | ||||||||||||||||||||||||||||
| Fleurchem : | l-borneol | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | pine woody camphor | |||||||||||||||||||||||||||
| substantivity : | 16 Hour(s) | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | colorless crystals | |||||||||||||||||||||||||||
| assay : | 80.00 - 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| optical rotation : | -20.00 to 0.00 | |||||||||||||||||||||||||||
| melting point : | 206.00 - 208.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 210.00 - 212.00 °C. @ 779.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 203.00 - 204.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 3.01 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5800.00 mg/kg FCTXAV 16,655,1978 | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 150.00 °F. TCC ( 65.56 °C. ) | |||||||||||||||||||||||||||
| recommendation for laevo-borneol usage levels up to : | ||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for laevo-borneol usage levels up to : | ||||||||||||||||||||||||||||
| 6.0000 ppm in the flavor. | ||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||
| (EINECS) number : | 207-353-1 | |||||||||||||||||||||||||||
| rtecs : | DT5095000 for 464-45-9 | |||||||||||||||||||||||||||
| chemidplus : | 000464459 | |||||||||||||||||||||||||||
| epa-srs : | 464-45-9 | |||||||||||||||||||||||||||
| dtp/nci : | 26352 | |||||||||||||||||||||||||||
| EPI System : | Click here | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| pubchem : | 153282 | |||||||||||||||||||||||||||
| synonyms : | |
| laevo-2- | bornanol |
| laevo-endo-2- | bornanol |
| ((1S)-endo)-(-)- | borneol |
| (1S,2R,4S)-(-)- | borneol |
| laevo- | borneol |
| dextro- | camphanol |
| laevo-2- | camphanol |
| laevo-endo-2- | camphanol |
| laevo- | camphol |
| laevo-2- | hydroxybornane |
| laevo-endo-2- | hydroxycamphane |
| (1S-endo)-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol |
| laevo-1,7,7- | trimethyl bicyclo(2.2.1)heptan-2-ol |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| propylene glycol | |
| insoluble in : | |
| water | |
| stability : | |
| bath foam | |
| cream | |
| detergent | |
| lotion | |
| non-discoloring in most media | |
| shampoo | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| ambrette seed oil | |
| alpha- | amyl cinnamaldehyde |
| amyris wood oil | |
| angelica root oil | |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl salicylate | |
| bornyl acetate | |
| iso | bornyl acetate |
| cangerana root bark oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarleaf oil | |
| cedarwood oil atlas | |
| cedarwood oils | |
| chamomile oil | |
| cistus oil | |
| clove bud oil | |
| coriander seed oil | |
| costus valerolactone | |
| currant bud absolute black | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| ethyl laurate | |
| fir balsam absolute | |
| frankincense oil | |
| gurjun balsam oil | |
| alpha- | hexyl cinnamaldehyde |
| juniper berry oil | |
| labdanum resinoid | |
| menthol | |
| methyl cedryl ketone | |
| methyl phenyl acetate | |
| 2- | methyl undecanal |
| musks | |
| myrrh oil | |
| patchouli ethanone | |
| patchouli oil | |
| peppermint oil | |
| santall | |
| thymol | |
| tonka bean absolute | |
| vanillin | |
| verymoss | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agate | |
| balsam | |
| bayberry | |
| bouquet | |
| camphor | |
| cardamom | |
| carrot | |
| castoreum | |
| cedar forest | |
| cedarleaf | |
| cedarwood | |
| christmas blends | |
| cinnamon | |
| citronella | |
| coriander | |
| earth humus | |
| fir | |
| fir balsam | |
| fir needle | |
| fixer | |
| geranium | |
| ginger | |
| grass sweet grass | |
| herbal | |
| hollyberry | |
| juniperberry | |
| lavandin | |
| lavender | |
| lavender spike lavender | |
| mace | |
| myrrh | |
| nutmeg | |
| oakmoss mousse de chene | |
| olibanum frankincense | |
| patchouli | |
| peppermint | |
| pine | |
| pine needle | |
| rosemary | |
| sage | |
| snakeroot | |
| spice | |
| spruce | |
| truffle | |
| valerian | |
| woody | |
| natural occurrence in : | |
| cardamom | |
| carrot | |
| cinnamon leaf | |
| citronella | |
| coriander | |
| geranium | |
| ginger | |
| lime oil distilled | |
| mace | |
| nutmeg | |
| oakmoss | |
| olibanum | |
| pine needle | |
| rosemary | |
| sage | |
| snake root | |
| thyme | |
| valerian root | |