| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-inden-5-yl 2-methyl propanoate | |||||||||||||||||||||||
| InChI : | InChI=1/C14H20O2/c1-8(2)14(15)16-13-7-9-6-12(13)11-5-3-4-10(9)11/h3,5,8-13H,4,6-7H2,1-2H3 | |||||||||||||||||||||||
| InChIKey : | QNEXACLQEWOALO-UHFFFAOYAL | |||||||||||||||||||||||
| SMILES : | CC(C)C(=O)OC1CC2CC1C3C2CC=C3 | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.60.0000 | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | herbal | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | fruity amber chocolate anise basil | |||||||||||||||||||||||
| substantivity : | 344 Hour(s) | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 97.00 - 100.00 % sum of isomers | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.02100 - 1.02900 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.496 to 8.562 | |||||||||||||||||||||||
| specific gravity : | 1.02200 - 1.03000 @ 20.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.514 to 8.581 | |||||||||||||||||||||||
| refractive index : | 1.48200 - 1.48700 @ 20.00 °C. | |||||||||||||||||||||||
| logp : | 3.46 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||
| recommendation for tricyclodecenyl isobutyrate usage levels up to : | ||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for tricyclodecenyl isobutyrate usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 266-825-5 | |||||||||||||||||||||||
| chemidplus : | 067634202 | |||||||||||||||||||||||
| epa-srs : | 67634-20-2 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 683971 | |||||||||||||||||||||||
| synonyms : | |
| cyclabute | |
| gardocyclene | |
| greenyl isobutyrate | |
| herbyl isobutyrate | |
| 3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-5-yl 2-methyl propanoate |
| 3a,4,5,6,7,7a- | hexahydro-4,7-methano-1H-inden-5-yl isobutyrate |
| hexahydro-4,7-methanoinden-5(or 6)-yl isobutyrate | |
| hexahydromethanoinden-5-yl isobutyrate | |
| tricyclo(5.2.1.0 2,6)dec-3(or 4)-en-8-yl 2-methyl propanoate | |
| tricyclodecenyl isobutyrate | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| amber carbinol | |
| iso | amyl benzoate |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| iso | butyl quinoline |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanol | |
| 9- | decen-1-ol |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl isobutyrate | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl vanillin | |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| geraniol | |
| green acetate | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| marine pyridine | |
| melon nonenoate | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nonanal | |
| nonanol | |
| ocean propanal | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl propionate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| santall | |
| strawberry furanone | |
| strawberry glycidate 1 | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| absinthe | |
| acacia | |
| agate | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amber | |
| animal | |
| balsam | |
| bark | |
| bean locust bean | |
| beeswax cire d'abeille | |
| blue grass | |
| broom genet genista | |
| calamus | |
| cassia blossom | |
| cedar forest | |
| cherry black cherry | |
| chestnut blossom | |
| chocolate | |
| chocolate cacao | |
| chypre | |
| citronella | |
| clean | |
| clove blossom | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coronilla | |
| cortex | |
| costus | |
| cyclamen | |
| dillenia | |
| dogwood | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fruit | |
| galanga | |
| ginger white ginger | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| immortelle helichrysum everlasting | |
| iris blossom | |
| ivy leaf | |
| kewda | |
| leaf autumn leaf | |
| leather | |
| licorice | |
| liverwort | |
| lychee soapberry | |
| maja | |
| marigold tagete | |
| meadow | |
| musk | |
| orange bitter orange | |
| oriental | |
| passion fruit | |
| petunia | |
| pine | |
| sandalwood | |
| soapy | |
| spice | |
| stephanotis | |
| tarragon | |
| tulip | |
| vanilla | |
| woodruff asperula | |
| woody | |
| wormwood absinthium | |
| natural occurrence in : | |
| not found in nature | |