Notes :
Blends well with fruity notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | (5E)-6,10-dimethylundeca-5,9-dien-2-one | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C13H22O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h7,9H,5-6,8,10H2,1-4H3/b12-9+ | |||||||||||||||||||||||||||||||||
| InChIKey : | HNZUNIKWNYHEJJ-FMIVXFBMBN | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCC/C(=C/CCC(=O)C)/C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fresh green fruity waxy rose woody magnolia | |||||||||||||||||||||||||||||||||
| taste description³ : | at 12.00 ppm. Floral, fruity, fatty, green, pear, apple and banana with tropical nuances | |||||||||||||||||||||||||||||||||
| substantivity : | 192 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.86200 - 0.87000 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.173 to 7.239 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.46200 - 1.47000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 92.00 - 93.00 °C. @ 2.50 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 250.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 4.13 | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5.00 gm/kg | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 41.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for (E)-geranyl acetone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for (E)-geranyl acetone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 12.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 223-269-8 | |||||||||||||||||||||||||||||||||
| rtecs : | RG5920000 for 3796-70-1 | |||||||||||||||||||||||||||||||||
| chemidplus : | 003796701 | |||||||||||||||||||||||||||||||||
| epa-srs : | 3796-70-1 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 406679 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 162538 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4107054982 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 23, No. 1, 33, (1998)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| (E)-6,10- | dimethyl undeca-5,9-dien-2-one |
| (E)-2,6- | dimethyl-2,6-undecadien-10-one |
| trans-2,6- | dimethyl-2,6-undecadien-2-one |
| (E)-6,10- | dimethyl-5,9-undecadien-2-one |
| trans-6,10- | dimethyl-5,9-undecadien-2-one |
| (E)- | geranyl acetone |
| trans- | geranyl acetone |
| soluble in : | |
| alcohol | |
| water, very slightly | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| benzyl isobutyrate | |
| bergamot oil | |
| bois de rose oil | |
| caraway seed oil | |
| chamomile oil | |
| citral | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| decanol | |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dodecanal dimethyl acetal | |
| floral pyranol | |
| gardenia oxide | |
| (E)- | geranyl acetone |
| geranyl butyrate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl formate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| 2,4- | ivy carbaldehyde |
| jasmin absolute | |
| lavender absolute | |
| leaf acetal | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| musk indanone | |
| nerolidol | |
| neryl acetate | |
| nonanal | |
| ocean propanal | |
| orange oil | |
| orangeflower absolute | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| rose absolute | |
| rose butanoate | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| (odor and/or flavor) used in : | |
| apple | |
| apple blossom | |
| apple green apple | |
| apricot | |
| banana | |
| bergamot | |
| berry | |
| butterscotch | |
| cassie acacia farnesiana | |
| cherry | |
| citrus | |
| coriander | |
| currant black currant | |
| elder blossom | |
| fig | |
| floral | |
| fruit | |
| gardenia | |
| geranium | |
| gooseberry | |
| grape | |
| grapefruit | |
| grass green grass | |
| green | |
| herbal | |
| honey miel | |
| jasmin | |
| lavender | |
| leather | |
| lemon | |
| lemongrass | |
| lime | |
| magnolia | |
| mandarin | |
| mango | |
| melon watermelon muskmelon cantaloupe | |
| muguet lily of the valley | |
| neroli | |
| nutmeg | |
| orange blossom fleur d'oranger | |
| oriental | |
| passion fruit | |
| peach | |
| pear | |
| petitgrain | |
| petitgrain lemon petitgrain | |
| pina colada | |
| pineapple | |
| plum | |
| raspberry | |
| rose | |
| rose moss rose | |
| rose red rose | |
| rose tea rose | |
| rum | |
| sassafras | |
| spice | |
| starfruit | |
| tangerine | |
| tea | |
| tomato | |
| tropical | |
| tuberose tubereuse | |
| wallflower giroflee | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| anise | |
| data page | champaca concrete @ 0.04% |
| fox red fox urine during mating season | |
| grapefruit oil | |
| hyssop | |
| mint | |
| data page | nepeta betonicifolia c.a. meyer oil turkey @ 0.20% |
| passion fruit | |
| sage red sage | |
| tea green tea | |
| tomato 3223 ppm | |