| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | 2-(1-ethoxyethoxy)ethylbenzene | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H18O2/c1-3-13-11(2)14-10-9-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 | |||||||||||||||||||||||||||||
| InChIKey : | QQDGMPOYFGNLMT-UHFFFAOYAT | |||||||||||||||||||||||||||||
| SMILES : | CCOC(C)OCCC1=CC=CC=C1 | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2911.00.5000 | |||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||
| odor description : at 100.00 %. | leafy green nasturtium fresh floral hyacinth | |||||||||||||||||||||||||||||
| substantivity : | 12 hour(s) at 100.00 % | |||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||
| assay : | 96.00 - 100.00 % | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| specific gravity : | 0.95300 - 0.96100 @ 25.00 °C. | |||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.930 to 7.996 | |||||||||||||||||||||||||||||
| specific gravity : | 0.95400 - 0.96200 @ 20.00 °C. | |||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.947 to 8.014 | |||||||||||||||||||||||||||||
| refractive index : | 1.47800 - 1.48300 @ 20.00 °C. | |||||||||||||||||||||||||||||
| boiling point : | 110.00 °C. @ 5.00 mm Hg | |||||||||||||||||||||||||||||
| logp : | 2.85 | |||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5.00 gm/kg | |||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||
| recommendation for acetaldehyde ethyl phenethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||
| 4.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||
| recommendation for acetaldehyde ethyl phenethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||
| (EINECS) number : | 219-868-9 | |||||||||||||||||||||||||||||
| toxnet : | 2556-10-7 | |||||||||||||||||||||||||||||
| epa-srs : | 2556-10-7 | |||||||||||||||||||||||||||||
| pubchem : | 2556-10-7 | |||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||
| synonyms : | |
| acetal e | |
| acetaldehyde ethyl 2-phenyl ethyl acetal | |
| acetaldehyde ethyl phenethyl acetal | |
| acetaldehyde ethyl phenyl ethyl acetal | |
| efetaal | |
| 1- | ethoxy-1-(2-phenyl ethoxy) ethane |
| 2-(1'-( | ethoxy)ethoxy) ethyl benzene |
| (2-(1- | ethoxyethoxy)ethyl) benzene |
| 1-(2-((1-( | ethyl oxy)ethyl)oxy)ethyl) benzene |
| ethyl phenethyl acetal | |
| hyacinth body | |
| nasturtium acetal | |
| verdilyn | |
| verotyl | |
| vertocinth | |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| isopropyl myristate | |
| insoluble in : | |
| water | |
| stability : | |
| alcohol, good | |
| alkalis | |
| ammonia | |
| candle, excellent | |
| cream rinse, excellent | |
| deo pump spray, good | |
| detergent powder, good | |
| fabric softener, excellent | |
| hand cream, excellent | |
| household cleaners | |
| joss sticks, excellent | |
| liquid detergent, excellent | |
| shampoo, moderate (color) | |
| soap, good | |
| (odor and/or flavor) blends with : | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl acetate |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| carrot seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| cortex pyridine | |
| para- | cresyl caprylate |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanal | |
| 9- | decen-1-ol |
| dihydrojasmone | |
| dihydromyrcenol | |
| ethyl heptanoate | |
| ethyl laurate | |
| ethyl phenyl acetate | |
| fir balsam absolute | |
| fir needle oil | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| (Z)-3- | hexen-1-yl tiglate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| hyacinth ether | |
| ionones | |
| ivy carbaldehyde | |
| leaf acetal | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl isoeugenol | |
| methyl octine carbonate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| beta- | naphthyl ethyl ether |
| narcissus absolute | |
| nerol | |
| nerolidol | |
| neryl acetate | |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl propionate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| 10- | undecen-1-al |
| verbena oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| algae | |
| amaryllis | |
| apple crabapple | |
| ash mountain ash | |
| ash mountain ash blossom | |
| bean | |
| bouquet | |
| boxwood blossom | |
| boxwoodberry | |
| cassis black currant bud | |
| cedar forest | |
| celery | |
| chamomile | |
| cherry blossom | |
| chestnut blossom | |
| cilantro | |
| citronella | |
| clematis | |
| cortex | |
| crabapple blossom | |
| daffodil narcissus | |
| davana | |
| evergreen | |
| fagonia | |
| fantasy blends | |
| fern fougere | |
| fig | |
| fir balsam | |
| fir needle | |
| floral | |
| foliage | |
| gardenia | |
| geranium | |
| green | |
| herbal | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| leaf | |
| lilac lilas syringa | |
| lily | |
| liverwort | |
| lotus | |
| mate | |
| mimosa wattle | |
| muguet lily of the valley | |
| narcissus narcisse | |
| oregano | |
| pansy | |
| parsley | |
| pear prickly pear | |
| peony | |
| petal flower petal | |
| privet | |
| privet blossom | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| stem | |
| stock evening scented stock | |
| tea | |
| violet | |
| violet leaf | |
| wasabi | |
| watercress nasturtium | |
| wintergreen | |
| wormwood absinthium | |
| yew | |
| natural occurrence in : | |
| not found in nature | |