Notes :
Gives good body.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | (2-methoxyphenyl) 2-phenylacetate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C15H14O3/c1-17-13-9-5-6-10-14(13)18-15(16)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3 | |||||||||||||||||||||||||||||||
| InChIKey : | KNVYLIIBQXVDKC-UHFFFAOYAU | |||||||||||||||||||||||||||||||
| SMILES : | COC1=CC=CC=C1OC(=O)CC2=CC=CC=C2 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | heavy chemical phenolic floral honey woody smoked sausage | |||||||||||||||||||||||||||||||
| taste description³ : | at 15.00 ppm. Sweet, phenolic, spicy anisic, with clover honey and vanilla nuances | |||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | white to yellowish brown crystalline powder | |||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| melting point : | 38.00 - 42.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 150.00 °C. @ 0.40 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 310.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 3.12 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for guaiacyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||
| 3.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for guaiacyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||
| 15.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 223-898-8 | |||||||||||||||||||||||||||||||
| chemidplus : | 004112894 | |||||||||||||||||||||||||||||||
| epa-srs : | 4112-89-4 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 197598 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1087626573 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 19, No. 5, 79, (1994)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| benzene acetic acid 2-methoxyphenyl ester | |
| guaiacol phenyl acetate | |
| guaiacyl phenyl acetate | |
| ortho- | methoxyphenyl acetate |
| 2- | methoxyphenyl phenyl acetate |
| ortho- | methyl catechol acetate |
| phenyl acetic acid ortho-methoxyphenyl ester | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| bay leaf oil | |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| caramel furanone | |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| costus root oil | |
| costus valerolactone | |
| para- | cresyl caprylate |
| cyclohexyl ethyl alcohol | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacol | |
| guaiol | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| gamma- | heptalactone |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| labdanum resinoid | |
| leerall | |
| lilyall | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| oakmoss absolute | |
| ocean propanal | |
| orris absolute | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| pepper oil black | |
| peru balsam oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rose oxides | |
| santall | |
| spruce oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| acacia | |
| allspice | |
| alpine bouquet | |
| amber | |
| animal | |
| azalea | |
| bacon | |
| balsam | |
| barley | |
| bayberry | |
| beeswax cire d'abeille | |
| bouquet | |
| briar sweet briar eglantine | |
| cabreuva | |
| calamus | |
| carnation dianthus oeillet | |
| cassia | |
| cassia blossom | |
| castoreum | |
| chestnut blossom | |
| christmas blends | |
| cistus | |
| clove | |
| clove blossom | |
| clover trefle le'trefle incarnat | |
| cookie | |
| copaiba | |
| coronilla | |
| cyclamen | |
| deertongue | |
| dogwood | |
| fern fougere | |
| fig | |
| flouve | |
| flouve blossom | |
| forest | |
| ginger white ginger | |
| grass sweet grass | |
| guaiacwood | |
| gurjun | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| hinoki | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hugonia | |
| incense | |
| iris blossom | |
| jonquil narcissus jonquilla | |
| labdanum | |
| leaf autumn leaf | |
| linden blossom limeflower tilleul | |
| mate | |
| meadow | |
| millefleurs | |
| moss | |
| musk | |
| opoponax | |
| oriental | |
| orris iris | |
| osmanthus | |
| petunia | |
| phlox | |
| pinon cone | |
| praline | |
| rose moss rose | |
| rose tea rose | |
| smoky | |
| spice | |
| vanilla | |
| wistaria wisteria glycine | |
| natural occurrence in : | |
| not found in nature | |