Notes :
Jasmin modifier.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl 2-methylpropanoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | UIKJRDSCEYGECG-UHFFFAOYAS | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C)C(=O)OCC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.60.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | jasmin oily fruity sweet rose tropical | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Fruity and sweet with ripe berry nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 12 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00100 - 1.00500 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.329 to 8.363 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.48900 - 1.49200 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 235.00 - 238.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.81 | |||||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2850.00 mg/kg FCTXAV 11,1023,1973 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 210.00 °F. TCC ( 98.89 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for benzyl isobutyrate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for benzyl isobutyrate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 25.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-095-9 | |||||||||||||||||||||||||||||||||||
| rtecs : | NQ4550000 for 103-28-6 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000103286 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 103-28-6 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 406201 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150727 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1048605300 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 18, No. 6, 33, (1993)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl 2-methyl propanoate | |
| benzyl 2-methyl propionate | |
| benzyl isobutanoate | |
| benzyl isobutyrate | |
| iso | butyric acid benzyl ester |
| 2- | methyl propanoic acid phenyl methyl ester |
| phenyl methyl 2-methyl propanoate | |
| soluble in : | |
| ethyl alcohol, 1:6 in 70% alcohol | |
| fixed oils | |
| paraffin oil | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| non-discoloring in most media | |
| store under normal conditions | |
| very stable | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| iso | amyl benzoate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| clary sage oil | |
| coriander seed oil | |
| para- | cresyl caprylate |
| cyclamen aldehyde | |
| dihydrojasmone | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| gardenia oxide | |
| geranium oil | |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| lavender absolute | |
| laevo- | linalool |
| methyl dihydrojasmonate | |
| methyl ionones | |
| mimosa absolute | |
| beta- | naphthyl ethyl ether |
| ocean propanal | |
| osmanthus absolute | |
| phenethyl acetate | |
| 3- | phenyl propyl alcohol |
| strawberry furanone | |
| strawberry glycidate 1 | |
| para- | tolyl aldehyde |
| vetiver oil | |
| violet leaf absolute | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| apple blossom | |
| baby powder | |
| balsam | |
| banana | |
| bayberry | |
| beer | |
| blackberry | |
| bouquet | |
| carnation dianthus oeillet | |
| cherry blossom | |
| chocolate cocoa | |
| citrus | |
| coconut | |
| cranberry | |
| currant | |
| fig | |
| fir balsam | |
| floral | |
| gardenia | |
| grapefruit | |
| herbal | |
| hyacinth jacinthe | |
| jasmin | |
| juniperberry | |
| lavender | |
| lilac lilas syringa | |
| mint | |
| narcissus narcisse | |
| neroli | |
| opoponax | |
| orchid | |
| peach | |
| pina colada | |
| pineapple | |
| plum | |
| raspberry | |
| rose | |
| rose white rose | |
| spice | |
| strawberry | |
| sweet pea pois de senteur | |
| tea green tea | |
| vanilla | |
| verbena verveine | |
| woody | |
| natural occurrence in : | |
| beer | |
| data page | cassie absolute @ 0.18% |
| data page | chamomile oil @ 0.10% |
| data page | featherfew leaf oil @ trace% |
| grape cherimoya grape | |
| data page | heracleum paphlagonicum czeczott fruit oil turkey @ <0.10% |
| spearmint | |