Notes :
Coumarin replacer.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 1,4-dimethoxybenzene | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H10O2/c1-9-7-3-5-8(10-2)6-4-7/h3-6H,1-2H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | OHBQPCCCRFSCAX-UHFFFAOYAX | |||||||||||||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)OC | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | sweet green new mown hay fennel | |||||||||||||||||||||||||||||||||
| substantivity : | 76 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystalline solid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| melting point : | 55.00 - 60.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 210.00 - 213.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 109.00 °C. @ 20.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 2.04 | |||||||||||||||||||||||||||||||||
| shelf life : | 36.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3600.00 mg/kg FCTXAV 16,715,1978 Oral-Rat 8500.00 mg/kg Oral-Mouse 4000.00 mg/kg | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for dimethyl hydroquinone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for dimethyl hydroquinone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 8.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 205-771-9 | |||||||||||||||||||||||||||||||||
| rtecs : | CZ6650000 for 150-78-7 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000150787 | |||||||||||||||||||||||||||||||||
| epa-srs : | 150-78-7 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 7483 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 152196 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2364514153 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| 1,4- | dimethoxybenzene |
| para- | dimethoxybenzene |
| 1,4- | dimethoxybenzol |
| dimethyl ether hydroquinone | |
| dimethyl hydroquinone | |
| dimethyl hydroquinone ether | |
| hydrquinone dimethyl ether | |
| para- | methoxyanisole |
| methyl para-methoxyphenyl ether | |
| quinol dimethyl ether | |
| soluble in : | |
| alcohol | |
| water, 1370 mg/L @ 25C | |
| insoluble in : | |
| water | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| algae absolute | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl benzoate |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| basil oil | |
| bay leaf oil | |
| benzophenone | |
| benzyl benzoate | |
| benzyl salicylate | |
| iso | butyl quinoline |
| iso | butyl salicylate |
| carrot seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| para- | cresyl caprylate |
| cuminaldehyde | |
| currant bud absolute black | |
| cypress oil | |
| (E)-4- | decen-1-al |
| dihydromyrcenol | |
| dimethyl benzyl carbinol | |
| diphenyl methane | |
| diphenyl oxide | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl vanillin | |
| eugenol | |
| fir balsam absolute | |
| floral pyranol | |
| geranium oil | |
| geranyl acetate | |
| grapefruit pentanol | |
| green acetate | |
| guaiacwood oil | |
| heliotropin | |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| hyacinth ether | |
| indole | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| leaf acetal | |
| laevo- | linalool |
| melon nonenoate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| mimosa absolute | |
| musks | |
| narcissus absolute | |
| oakmoss absolute | |
| ocean propanal | |
| orangeflower absolute | |
| phenethyl alcohol | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| phenyl acetic acid | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| rose oxides | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tonka bean absolute | |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| acorn | |
| agrumen | |
| algae | |
| amaryllis | |
| amber | |
| ambrosia | |
| ash mountain ash | |
| bark | |
| bluebell | |
| boronia | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| calamus | |
| carrot seed | |
| cassis black currant bud | |
| castoreum | |
| cedar forest | |
| celery | |
| chamomile | |
| champaca champak | |
| chervil | |
| cilantro | |
| clematis | |
| clover trefle le'trefle incarnat | |
| cognac | |
| coriander | |
| coronilla | |
| cortex | |
| cypress | |
| daffodil narcissus | |
| deertongue | |
| earth humus | |
| erica | |
| evergreen | |
| fern fougere | |
| fig | |
| fir balsam | |
| fir needle | |
| flouve | |
| flouve blossom | |
| foliage | |
| fungus | |
| geranium | |
| ginger white ginger | |
| grass | |
| grass green grass | |
| green | |
| hancornia | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| hugonia | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| kewda | |
| leaf | |
| leaf autumn leaf | |
| leather | |
| liverwort | |
| lotus | |
| marjoram | |
| mate | |
| meadow | |
| mimosa wattle | |
| narcissus narcisse | |
| neroli | |
| nut hazelnut | |
| ocean sea | |
| opoponax | |
| orange bitter orange | |
| oregano | |
| orris iris | |
| palmarosa | |
| pansy | |
| parsley | |
| passion blossom | |
| patchouli | |
| pear prickly pear | |
| pine needle | |
| pine scotch pine | |
| poppy | |
| primrose | |
| privet | |
| privet blossom | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose geranium | |
| sandalwood | |
| seaweed | |
| stem | |
| straw | |
| tea | |
| tobacco tabac tabaco flower | |
| vine | |
| weedy | |
| woodruff asperula | |
| wormwood absinthium | |
| yew | |
| natural occurrence in : | |
| coffee | |
| hyacinth | |
| data page | ylang ylang oil @ 0.13% |
| data page | ylang ylang oil CO2 extract @ 0.10% |