Notes :
Blends well with animal notes. Better than the acetate.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | (4-methylphenyl) 2-phenylacetate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C15H14O2/c1-12-7-9-14(10-8-12)17-15(16)11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | OJEQSSJFSNLMLB-UHFFFAOYAA | |||||||||||||||||||||||||||||||||
| SMILES : | CC1=CC=C(C=C1)OC(=O)CC2=CC=CC=C2 | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2916.35.1500 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | p-Tolyl phenylacetate
≥99% | |||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | animal | |||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | animal rose honey narcissus lily hyacinth | |||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||||
| assay : | 99.00 to 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| melting point : | 74.00 to 76.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 310.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| congealing point : | 73.70 | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 3.79 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5.00 gm/kg FCTXAV 13,775,1975 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 13,775,1975 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for para-cresyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for para-cresyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 6.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-990-1 | |||||||||||||||||||||||||||||||||
| RTECS : | CY1679750 for 101-94-0 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000101940 | |||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 101-94-0 | |||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 101-94-0 | |||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 101-94-0 | |||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 101-94-0 | |||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 101-94-0 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 5981 | |||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 705 | |||||||||||||||||||||||||||||||||
| fl. number : | 09.709 | |||||||||||||||||||||||||||||||||
| pubchem : | 197218 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 753177000 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| benzene acetic acid 4-methyl phenyl ester | |
| para- | cresyl alpha-toluate |
| para- | cresyl phenyl acetate |
| para- | methyl phenyl alpha-toluate |
| 4- | methyl phenyl benzene acetate |
| para- | methyl phenyl phenyl acetate |
| narcissin | |
| phenyl acetic acid para-tolyl ester | |
| para- | tolyl alpha-toluate |
| para- | tolyl phenyl acetate |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| non-discoloring in most media | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| benzaldehyde propylene glycol acetal | |
| benzoin resinoid | |
| benzophenone | |
| benzyl propionate | |
| benzyl salicylate | |
| butyl phenyl acetate | |
| iso | butyl salicylate |
| carrot seed oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl isovalerate | |
| citronellyl phenyl acetate | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| costus root oil | |
| costus valerolactone | |
| para- | cresol |
| para- | cresyl acetate |
| para- | cresyl caprylate |
| para- | cresyl isobutyrate |
| para- | cresyl phenyl ether |
| cyclohexyl ethyl alcohol | |
| (E)-beta- | damascone |
| (Z)-beta- | damascone |
| beta- | damascone |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl hydrocinnamate | |
| ethyl laurate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| genet concrete | |
| geranyl phenyl acetate | |
| guaiacwood oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| indole | |
| ionones | |
| labdanum resinoid | |
| lilac pentanol | |
| lily absolute | |
| linalyl phenyl acetate | |
| magnolia indene | |
| methyl acetophenone | |
| methyl ionones | |
| musks | |
| beta- | naphthyl ethyl ether |
| narcissus | |
| narcissus absolute | |
| narcissus acetate | |
| oakmoss absolute | |
| octyl isovalerate | |
| patchouli ethanone | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl furoate | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl formate |
| reseda acetal | |
| rhodinol | |
| rose carboxylate | |
| santall | |
| tea acetate | |
| tobacco dodecane | |
| tonka bean absolute | |
| verymoss | |
| vetiver oil | |
| wallflower absolute | |
| waxy acetate | |
| woody acetate | |
| woody amylene | |
(odor and/or flavor) used in : | |
| almond blossom | |
| animal | |
| bayberry | |
| beeswax cire d'abeille | |
| bouquet | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| castoreum | |
| cherry blossom | |
| civet | |
| clematis | |
| clover trefle le'trefle incarnat | |
| crabapple blossom | |
| daffodil narcissus | |
| deertongue | |
| elder blossom | |
| fagonia | |
| fecal | |
| fern fougere | |
| flouve blossom | |
| gingergrass | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| herbal | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| ivy leaf | |
| jasmin | |
| jonquil narcissus jonquilla | |
| joy | |
| kewda | |
| leaf autumn leaf | |
| leather | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| liverwort | |
| meadow | |
| musk | |
| narcissus narcisse | |
| nemesia | |
| orchid | |
| privet blossom | |
| saffron | |
| straw | |
| tobacco tabac tabaco | |
| tuberose tubereuse | |
| vol de nuit | |
| wallflower giroflee | |
| woodruff asperula | |
| wormwood absinthium | |
| ylang ylang cananga | |
natural occurrence in : | |
| not found in nature | |