| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl 2-cyclohexylacetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H12O2/c1-2-12-10(11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | DULCUDSUACXJJC-UHFFFAOYAN | |||||||||||||||||||||||||||||||||||
| SMILES : | CCOC(=O)CC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet floral honey rose balsam cocoa | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 5.00 - 10.00 ppm. Strong sweet rosy honey and balsamic cocoa-like with molasses and yeasty nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 312 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.02870 - 1.02940 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.560 to 8.566 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.49500 - 1.49800 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 227.00 - 229.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 100.00 °C. @ 10.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.50 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3300.00 mg/kg FCTXAV 13,99,1975 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 172.00 °F. TCC ( 77.78 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for ethyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for ethyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-993-8 | |||||||||||||||||||||||||||||||||||
| rtecs : | AJ2824000 for 101-97-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000101973 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 101-97-3 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8894 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150670 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1590118633 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 25, No. 4, 71, (2000)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzene acetic acid ethyl ester | |
| ethyl 2-phenyl ethanoate | |
| ethyl alpha-toluate | |
| ethyl benzene acetate | |
| ethyl phenyl acetate | |
| ethyl phenyl ethanoate | |
| phenyl acetic acid ethyl ester | |
| alpha- | toluic acid ethyl ester |
| soluble in : | |
| alcohol | |
| fixed oils | |
| water, 739 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| acetophenone | |
| 2- | acetyl furan |
| allspice oil | |
| allyl amyl glycolate | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| animal carbolactone | |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl isoeugenol | |
| blood orange oil | |
| iso | butyl cinnamate |
| caramel furanone | |
| laevo- | carvone |
| cassia bark oil | |
| chocolate pyrazine | |
| cinnamyl alcohol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| costus valerolactone | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| gamma- | decalactone |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl vanillin | |
| eugenol | |
| iso | eugenyl acetate |
| fennel seed oil | |
| floral pyranol | |
| geraniol | |
| guaiacwood oil | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| (Z)-3- | hexen-1-yl benzoate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| indole | |
| ionones | |
| labdanum resinoid | |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl isoeugenol | |
| methyl octine carbonate | |
| mimosa absolute | |
| musks | |
| nerolidol | |
| gamma- | nonalactone |
| ocean propanal | |
| gamma- | octalactone |
| orange oil | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl isobutyrate | |
| phenethyl propionate | |
| phenyl acetic acid | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| strawberry furanone | |
| strawberry glycidate 1 | |
| tobacco dodecane | |
| para- | tolyl aldehyde |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillyl acetate | |
| violet methyl carbonate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| absinthe | |
| apple | |
| apricot | |
| arnica | |
| balsam | |
| banana | |
| beeswax cire d'abeille | |
| blossom tropical blossom | |
| bramble arctic bramble blackberry | |
| brandy | |
| bread | |
| butter rum | |
| candy cotton candy | |
| cappuccino | |
| caramel | |
| cassie acacia farnesiana | |
| chocolate cocoa | |
| cider | |
| civet | |
| crabapple blossom | |
| date | |
| elder blossom | |
| elderberry | |
| fixer | |
| flouve blossom | |
| fruit dried fruit | |
| fruit tropical fruit | |
| gingerbread | |
| guaiacwood | |
| guava | |
| habuba | |
| honey miel | |
| honeysuckle chevrefeuille | |
| iris blossom | |
| jackfruit | |
| licorice | |
| lily | |
| malt | |
| marigold tagete | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| molasses | |
| orange | |
| orange blossom fleur d'oranger | |
| orchid | |
| oriental | |
| papaya | |
| passion blossom | |
| passion fruit | |
| pineapple | |
| pomegranate | |
| popcorn | |
| raspberry | |
| rose | |
| rose tea rose | |
| rose white rose | |
| rum butter rum | |
| sandalwood | |
| stock evening scented stock | |
| strawberry | |
| styrax | |
| sugar brown sugar | |
| sweet pea pois de senteur | |
| tobacco tabac tabaco | |
| toffee | |
| tropical | |
| wallflower giroflee | |
| waxy | |
| wine | |
| wormwood absinthium | |
| natural occurrence in : | |
| apple | |
| beer | |
| brandy grape brandy | |
| bread | |
| cider | |
| cocoa | |
| cognac | |
| grapefruit juice | |
| guava fruit | |
| honey | |
| melon | |
| olive | |
| papaya | |
| data page | petitgrain mandarin oil @ 0.06% |
| pineapple | |
| rum | |
| wine port wine | |