| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | 1-(dimethoxymethyl)-4-methoxybenzene | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H14O3/c1-11-9-6-4-8(5-7-9)10(12-2)13-3/h4-7,10H,1-3H3 | |||||||||||||||||||||||||||||
| InChIKey : | NNHYAHOTXLASEA-UHFFFAOYAA | |||||||||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)C(OC)OC | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| export tariff code : | 2911.00.5000 | |||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||
| Bedoukian Research : | ANISALDEHYDE DIMETHYL ACETAL
≥98.5%, Kosher Odor: A mild, floral, hawthorn. | |||||||||||||||||||||||||||||
| Penta : | anisic aldehyde dma | |||||||||||||||||||||||||||||
| Pfaltz & Bauer : | Anisaldehyde dimethyl acetal | |||||||||||||||||||||||||||||
| Sigma-Aldrich-Aldrich : | Anisaldehyde dimethyl acetal
puriss., ≥98.5% (GC) | |||||||||||||||||||||||||||||
| TCI AMERICA : | p-Anisaldehyde Dimethyl Acetal
>95.0%(GC) | |||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||
| odor strength : | low | |||||||||||||||||||||||||||||
| odor description :¹ at 100.00 %. | mild floral hawthorn jasmin lilac elderflower | |||||||||||||||||||||||||||||
| odor sample from : | Bedoukian Research, Inc. | |||||||||||||||||||||||||||||
| substantivity : | 112 Hour(s) | |||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||
| assay : | 99.00 to 100.00 % | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| specific gravity : | 1.06300 to 1.07300 @ 25.00 °C. | |||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.845 to 8.928 | |||||||||||||||||||||||||||||
| refractive index : | 1.49800 to 1.50800 @ 20.00 °C. | |||||||||||||||||||||||||||||
| boiling point : | 235.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||
| vapor pressure : | 0.04880 mm/Hg @ 25.00 °C. | |||||||||||||||||||||||||||||
| flash point : | 208.00 °F. TCC ( 97.78 °C. ) | |||||||||||||||||||||||||||||
| logP (o/w) : | 2.15 | |||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||
| storage : | refrigerate in tightly sealed containers. | |||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||
|
R 36/37/38 - Irritating to eyes, respiratory system, and skin. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||
| recommendation for para-anisaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||
| recommendation for para-anisaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||
| IUCLID : | view | |||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||
| WGK Germany : | 1 | |||||||||||||||||||||||||||||
| 1-(dimethoxymethyl)-4-methoxybenzene | ||||||||||||||||||||||||||||||
| (EINECS) number : | 218-577-4 | |||||||||||||||||||||||||||||
| chemidplus : | 002186927 | |||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 2186-92-7 | |||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||
| 1-(dimethoxymethyl)-4-methoxybenzene | ||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2186927 | |||||||||||||||||||||||||||||
| pubchem : | 217364 | |||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1989)¹ | |||||||||||||||||||||||||||||
| synonyms : | |
| anisic aldehyde dimethyl acetal | |
| anisyl aldehyde dimethyl acetal | |
| para-( | dimethoxymethyl) anisole |
| 1-( | dimethoxymethyl)-4-methoxybenzene |
| 4- | methoxybenzaldehyde dimethyl acetal |
| para- | methoxybenzaldehyde dimethyl acetal |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| alkalis | |
(odor and/or flavor) blends with : | |
| acetanisole | |
| acetoin | |
| acetophenone | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | bornyl acetate |
| cassia bark oil | |
| celery seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| costus valerolactone | |
| coumarin | |
| cuminaldehyde | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl salicylate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropin | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| lilyall | |
| alpha- | methyl cinnamaldehyde |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| neroli oil | |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| petitgrain oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| storax resinoid | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| ylang ylang oil | |
(odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| ambrene | |
| angel | |
| anise | |
| apple | |
| apres l'ondee | |
| apricot | |
| balsam | |
| banana | |
| bluebell | |
| boronia | |
| bouquet | |
| broom genet genista | |
| buchu | |
| butterscotch | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| crabapple blossom | |
| elder blossom | |
| fennel | |
| fern fougere | |
| floral | |
| gardenia | |
| ginger white ginger | |
| gooseberry | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hops houblon | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| modern | |
| modifier | |
| nut walnut | |
| orange | |
| orchid | |
| oriental | |
| pear | |
| peppermint | |
| pineapple | |
| powder | |
| raspberry | |
| sassafras | |
| spearmint | |
| strawberry | |
| sweet pea pois de senteur | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
natural occurrence in : | |
| not found in nature | |