Notes :
With suitable quantities of methyl or ethyl cinnamate.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutyl 2-phenylacetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C13H18O2/c1-11(2)8-9-15-13(14)10-12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | QWBQBUWZZBUFHN-UHFFFAOYAL | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C)CCOC(=O)CC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | chocolate | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet honey cocoa balsam chocolate castoreum animal | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 5.00 - 10.00 ppm. Warm rosy honey with phenyl chocolate nuances and dried fruit notes | |||||||||||||||||||||||||||||||||||
| substantivity : | 172 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.97500 - 0.98100 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.113 to 8.163 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.48548 - 1.49000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 268.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 265.00 - 266.00 °C. @ 723.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 3.87 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for isoamyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for isoamyl phenyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 15.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-012-6 | |||||||||||||||||||||||||||||||||||
| rtecs : | AJ2945000 for 102-19-2 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000102192 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 102-19-2 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 60582 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 150681 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 621150149 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 25, No. 4, 71, (2000)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| iso | amyl alpha-toluate |
| iso | amyl phenyl acetate |
| benzene acetic acid 3-methyl butyl ester | |
| 3- | methyl butyl benzene acetate |
| 3- | methyl butyl phenyl acetate |
| iso | pentyl phenyl acetate |
| phenyl acetic acid isopentyl ester | |
| soluble in : | |
| alcohol | |
| paraffin oil | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| antiperspirant | |
| bleach | |
| cream | |
| deo stick | |
| detergent | |
| detergent perborate | |
| hair spray | |
| hard surface cleaner | |
| non-discoloring in most media | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| para- | anisyl acetate |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl isobutyrate | |
| bois de rose oil | |
| caramel furanone | |
| cassia bark oil | |
| clary sage oil | |
| clove bud oil | |
| costus valerolactone | |
| coumarin | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| iso | eugenyl acetate |
| floral pyranol | |
| gardenia oxide | |
| guaiacwood oil | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| ionones | |
| jasmin absolute | |
| labdanum resinoid | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| mimosa absolute | |
| musks | |
| gamma- | nonalactone |
| nonanol | |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| peru balsam oil | |
| phenethyl phenyl acetate | |
| raspberry ketone methyl ether | |
| rose absolute | |
| rose butanoate | |
| santall | |
| strawberry glycidate 1 | |
| tonka bean absolute | |
| tuberose absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| amber | |
| animal | |
| apple | |
| apricot | |
| baby powder | |
| balsam | |
| bean locust bean | |
| birch tar | |
| blossom tropical blossom | |
| caramel | |
| castoreum | |
| chocolate cacao | |
| chocolate cocoa | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coronilla | |
| cream | |
| fern fougere | |
| fig | |
| floral | |
| fruit tropical fruit | |
| honey miel | |
| honeysuckle chevrefeuille | |
| jasmin | |
| mango | |
| marshmallow | |
| mint | |
| moss | |
| muguet lily of the valley | |
| opoponax | |
| papaya | |
| peach | |
| powder | |
| praline | |
| raisin | |
| sweet pea pois de senteur | |
| tea | |
| tobacco tabac tabaco | |
| toffee | |
| tomato | |
| vanilla | |
| woodruff asperula | |
| natural occurrence in : | |
| data page | layana oil kenya @ 0.24% |
| peppermint oil | |