| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-phenylacetic acid | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) | |||||||||||||||||||||||||||||||||||
| InChIKey : | WLJVXDMOQOGPHL-UHFFFAOYAR | |||||||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)CC(=O)O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2916.34.1500 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | honey | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet honey floral rose chocolate tobacco civet | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 ppm. Sweet, floral, chocolate, honey and tobacco | |||||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| melting point : | 76.00 - 78.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 265.00 - 266.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 142.00 - 143.00 °C. @ 10.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 1.41 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2250.00 mg/kg VPITAR 33(5),48,74 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 13,901,1975 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for phenyl acetic acid usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for phenyl acetic acid usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 15.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-148-6 | |||||||||||||||||||||||||||||||||||
| rtecs : | AJ2430000 for 103-82-2 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000103822 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 103-82-2 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 125718 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 1007 | |||||||||||||||||||||||||||||||||||
| fl. number : | 08.038 | |||||||||||||||||||||||||||||||||||
| pubchem : | 150763 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3987891960 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 21, No. 4, 51, (1996)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzenacetic acid | |
| benzene acetic acid | |
| benzyl carboxylic acid | |
| phenyl acetic acid | |
| omega- | phenyl acetic acid |
| phenyl ethanoic acid | |
| alpha- | toluic acid |
| soluble in : | |
| fixed oils | |
| glycerin | |
| water, 16600 mg/L @ 25C | |
| insoluble in : | |
| water | |
| stability : | |
| bath foam | |
| cream | |
| hair spray | |
| lotion | |
| non-discoloring in most media | |
| powder | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | butyl cinnamate |
| iso | butyl salicylate |
| caramel furanone | |
| chocolate pyrazine | |
| cinnamyl alcohol | |
| costus valerolactone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| frankincense oil | |
| guaiacwood oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| immortelle absolute | |
| ionones | |
| labdanum resinoid | |
| maltol | |
| methyl acetophenone | |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl ionones | |
| methyl phenyl acetate | |
| musks | |
| beta- | naphthyl ethyl ether |
| gamma- | nonalactone |
| gamma- | octalactone |
| osmanthus absolute | |
| phenethyl phenyl acetate | |
| phenethyl propionate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| skatole | |
| strawberry furanone | |
| tonka bean absolute | |
| vanilla absolute | |
| vanillyl acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| absinthe | |
| acacia | |
| amber | |
| animal | |
| apple blossom | |
| arnica | |
| beeswax cire d'abeille | |
| bouquet | |
| broom genet genista | |
| cappuccino | |
| cassie acacia farnesiana | |
| castoreum | |
| chocolate cocoa | |
| civet | |
| clover trefle le'trefle incarnat | |
| date | |
| deertongue | |
| elder blossom | |
| elderberry | |
| fig | |
| fixer | |
| floral | |
| geranium | |
| graham cracker | |
| grape | |
| heliotrope | |
| honey miel | |
| honeysuckle chevrefeuille | |
| immortelle helichrysum everlasting | |
| jasmin | |
| kewda | |
| licorice | |
| lilac lilas syringa | |
| musk | |
| narcissus narcisse | |
| neroli | |
| orange blossom fleur d'oranger | |
| passion blossom | |
| pumpkin | |
| rose | |
| rose red rose | |
| sweet pea pois de senteur | |
| tobacco tabac tabaco | |
| toffee | |
| tropical | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| natural occurrence in : | |
| data page | champaca concrete @ 0.20% |
| cheese swiss cheese | |
| cocoa | |
| mango | |
| neroli | |
| rose bulgarian | |
| sake | |
| sherry | |
| data page | thyme oil spain @ 2.49% |
| tobacco | |
| tomato | |
| wine white wine | |