Notes :
Lifter in compositions and to modify creamy notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutyl butanoate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H18O2/c1-4-5-9(10)11-7-6-8(2)3/h8H,4-7H2,1-3H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | PQLMXFQTAMDXIZ-UHFFFAOYAT | |||||||||||||||||||||||||||||||||
| SMILES : | CCCC(=O)OCCC(C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.60.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fruity green apricot pear banana green | |||||||||||||||||||||||||||||||||
| taste description³ : | at 5.00 ppm. Waxy, green apple, fruity, sweet estry, melon and berry notes | |||||||||||||||||||||||||||||||||
| substantivity : | < 2 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.86000 - 0.86800 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.156 to 7.223 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.86100 - 0.86900 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.173 to 7.239 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.40900 - 1.41300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 184.00 - 185.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 0.10 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 3.25 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5.00 gm/kg FCTXAV 17,823,1979 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 17,823,1979 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 135.00 °F. TCC ( 57.22 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for isoamyl butyrate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for isoamyl butyrate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 570.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-380-8 | |||||||||||||||||||||||||||||||||
| rtecs : | ET5034000 for 106-27-4 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000106274 | |||||||||||||||||||||||||||||||||
| epa-srs : | 106-27-4 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 6548 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 150889 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2696207571 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 24, No. 2, 49, (1999)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| iso | amyl butanoate |
| iso | amyl butyrate |
| iso | amyl-N-butyrate |
| butanoic acid 3-methyl butyl ester | |
| butyric acid isopentyl ester | |
| 3- | methyl butanoate |
| 3- | methyl butyl butanoate |
| 3- | methyl butyl butyrate |
| iso | pentyl alcohol butyrate |
| iso | pentyl butanoate |
| iso | pentyl butyrate |
| soluble in : | |
| alcohol | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| water, 118 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| iso | amyl acetate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| para- | anisaldehyde |
| anise seed oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| cassia bark oil | |
| citronellyl acetate | |
| citronellyl nitrile | |
| citrus | |
| coriander seed oil | |
| cyclamen aldehyde | |
| diethyl malonate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl heptanoate | |
| ethyl vanillin | |
| fir needle oil | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geranyl acetate | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl formate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl tiglate | |
| leerall | |
| laevo- | linalool |
| linalool oxide | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| methyl heptenone | |
| mimosa absolute | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| orange oil | |
| petitgrain oil | |
| phenethyl propionate | |
| raspberry ketone | |
| strawberry glycidate 1 | |
| styralyl acetate | |
| tetrahydrolinalool | |
| para- | tolyl aldehyde |
| gamma- | undecalactone |
| vanilla absolute | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| apple | |
| apple green apple | |
| apricot | |
| arrack | |
| banana | |
| blackberry | |
| bluebell | |
| brandy | |
| bubblegum | |
| butter | |
| butterscotch | |
| cherry | |
| cherry black cherry | |
| chocolate cacao | |
| cider | |
| coconut | |
| cranberry | |
| cream | |
| currant | |
| date | |
| fruit juicy fruit | |
| ginger | |
| gooseberry | |
| grape | |
| grenadine | |
| herbal | |
| hibiscus | |
| honey miel | |
| hops houblon | |
| huckleberry bilberry | |
| lemon | |
| lime | |
| melon watermelon muskmelon cantaloupe | |
| orange | |
| orris iris | |
| passion fruit | |
| peach | |
| pear | |
| pineapple | |
| plum | |
| raspberry | |
| rum | |
| strawberry | |
| tangerine | |
| tea | |
| tomato | |
| tropical | |
| tutti frutti | |
| woodruff asperula | |
| natural occurrence in : | |
| apple | |
| banana | |
| beans | |
| cheese bleu cheese | |
| cider | |
| cocoa bean | |
| coconut oil | |
| currant | |
| data page | gingergrass oil @ 0.08% |
| grape | |
| data page | heracleum paphlagonicum czeczott fruit oil turkey @ <0.10% |
| honey | |
| hop | |
| jackfruit | |
| data page | mastic fruit oil @ 0.58% |
| data page | mastic leaf oil @ 1.12% |
| melon | |
| papaya | |
| rum | |
| strawberry | |
| tomato | |