Notes :
Oriental lifter.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutyl acetate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | MLFHJEHSLIIPHL-UHFFFAOYAI | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C)CCOC(=O)C | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.39.4550 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet fruity banana solvent | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 ppm. Sweet fruity, banana-Iike with a green ripe nuance | |||||||||||||||||||||||||||||||||||
| substantivity : | < 1 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.86000 - 0.87800 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.156 to 7.306 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.40000 - 1.40400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -78.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 142.00 °C. @ 756.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 30.00 °C. @ 2.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.26 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 16600.00 mg/kg YKYUA6 32,1241,1981 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg NTIS** OTS0573010 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 77.00 °F. TCC ( 25.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for isoamyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 25.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for isoamyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 2700.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-662-3 | |||||||||||||||||||||||||||||||||||
| rtecs : | NS9800000 for 123-92-2 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000123922 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 123-92-2 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 9260 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 173320 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2463083215 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 16, No. 6, 43, (1991)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| acetic acid 3-methyl butyl ester | |
| acetic acid isopentyl ester | |
| iso | amyl acetate |
| iso | amyl ethanoate |
| 3- | methyl butyl acetate |
| beta- | methyl butyl acetate |
| 2- | methyl butyl ethanoate |
| 3- | methyl butyl ethanoate |
| 3- | methyl-1-butanol acetate |
| 3- | methyl-1-butyl acetate |
| iso | pentyl acetate |
| iso | pentyl alcohol acetate |
| iso | pentyl ethanoate |
| soluble in : | |
| alcohol | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| water, 2000 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| (odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| para- | anisaldehyde |
| anise seed oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| cassia bark oil | |
| citronella oil | |
| citronellyl acetate | |
| coriander seed oil | |
| diethyl malonate | |
| dihydromyrcenol | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl heptanoate | |
| floral pyranol | |
| geranyl acetate | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| hexyl 2-methyl butyrate | |
| lavender absolute | |
| litsea cubeba oil | |
| melon heptenal | |
| methyl dihydrojasmonate | |
| neryl acetate | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| (Z)-5- | octen-1-ol |
| strawberry glycidate 1 | |
| styralyl acetate | |
| alpha- | terpinyl acetate |
| gamma- | undecalactone |
| vanilla absolute | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| almond bitter almond | |
| apple | |
| apple red apple | |
| apricot | |
| banana | |
| blackberry | |
| blueberry | |
| blueberry whortleberry red whortleberry | |
| brandy | |
| bubblegum | |
| butterscotch | |
| carnation dianthus oeillet | |
| cherry | |
| chocolate cocoa | |
| coconut | |
| coffee | |
| crabapple blossom | |
| cranberry | |
| currant | |
| date | |
| floral | |
| fruit juicy fruit | |
| gooseberry | |
| grape | |
| grenadine | |
| hibiscus | |
| honey miel | |
| hops houblon | |
| huckleberry bilberry | |
| hyacinth jacinthe | |
| lemon | |
| lime | |
| melon watermelon muskmelon cantaloupe | |
| mint | |
| muguet lily of the valley | |
| mulberry | |
| nut pistachio | |
| orange | |
| oriental | |
| passion fruit | |
| peach | |
| pear | |
| pina colada | |
| pineapple | |
| plum | |
| quince | |
| raspberry | |
| rose | |
| strawberry | |
| tangerine | |
| tutti frutti | |
| vanilla | |
| violet | |
| natural occurrence in : | |
| apple | |
| apple juice | |
| banana | |
| beer | |
| butter | |
| data page | chamomile oil @ 0.93% |
| cocoa bean | |
| musa sapientum l. | |
| strawberry | |