Notes :
Natural notes to fern and peppermint.
dill note - dihydrolinalool and laevo-carvone.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | (5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3/t9-/m1/s1 | |||||||||||||||||||||||||||||||||
| InChIKey : | ULDHMXUKGWMISQ-SECBINFHBY | |||||||||||||||||||||||||||||||||
| SMILES : | CC1=CCC(CC1=O)C(=C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2914.29.0000 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| Fleurchem : | l-carvone | |||||||||||||||||||||||||||||||||
| natural | ||||||||||||||||||||||||||||||||||
| Fleurchem : | l-carvone | |||||||||||||||||||||||||||||||||
| Robertet : | Carvone laevo (L-1-methyl-4-isopropanyl-6-cyclohexen-2-one) | |||||||||||||||||||||||||||||||||
| naturel | ||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | L-Carvone | |||||||||||||||||||||||||||||||||
| ≥97%, FCC, Kosher | ||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | minty | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet spearmint herbal | |||||||||||||||||||||||||||||||||
| substantivity : | 24 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.95600 - 0.96000 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.955 to 7.988 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.49500 - 1.49900 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| optical rotation : | -57.00 to -62.00 | |||||||||||||||||||||||||||||||||
| boiling point : | 227.00 - 230.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 2.71 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1640.00 mg/kg FCTXAV 11,1057,1973 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 192.00 °F. TCC ( 88.89 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for laevo-carvone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 12.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for laevo-carvone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 850.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 229-352-5 | |||||||||||||||||||||||||||||||||
| rtecs : | OS8650000 for 6485-40-1 | |||||||||||||||||||||||||||||||||
| chemidplus : | 006485401 | |||||||||||||||||||||||||||||||||
| epa-srs : | 6485-40-1 | |||||||||||||||||||||||||||||||||
| EPI System : | Click here | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 380.2 | |||||||||||||||||||||||||||||||||
| fl. number : | 07.147 | |||||||||||||||||||||||||||||||||
| pubchem : | 165566 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| (4R)-(-)- | carvone |
| (R)-(-)- | carvone |
| laevo- | carvone |
| laevo-para- | mentha-1(6),8-dien-2-one |
| para- | mentha-6,8-dien-2-one |
| 6,8,9-para- | menthadien-2-one |
| laevo-6,8(9)-para- | menthadien-2-one |
| laevo-1- | methyl-4-isopropenyl-6-cyclohexen-2-one |
| soluble in : | |
| alcohol | |
| fixed oils | |
| paraffin oil | |
| propylene glycol | |
| water, 1310 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| non-discoloring | |
| (odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl phenyl acetate |
| amyris wood oil | |
| (E)- | anethol |
| para- | anisyl acetate |
| benzoin resinoid | |
| benzyl cinnamate | |
| blood orange oil | |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| clove bud oil | |
| coriander seed oil | |
| gamma- | decalactone |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| gurjun balsam oil | |
| heliotropin | |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| ionones | |
| lavender absolute | |
| alpha- | methyl cinnamaldehyde |
| methyl ionones | |
| methyl salicylate | |
| ocean propanal | |
| phenethyl acetate | |
| spearmint oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| (odor and/or flavor) used in : | |
| acacia | |
| allspice | |
| almond | |
| anise | |
| azalea | |
| baby powder | |
| banana | |
| basil | |
| bayberry | |
| blackberry | |
| boronia | |
| bouquet | |
| caraway | |
| carnation dianthus oeillet | |
| cassia blossom | |
| cherry | |
| cherry black cherry | |
| christmas blends | |
| cinnamon | |
| clover trefle le'trefle incarnat | |
| coronilla | |
| currant black currant | |
| date | |
| dill | |
| elderberry | |
| estragon | |
| fennel | |
| fenugreek | |
| fig | |
| floral | |
| ginger white ginger | |
| hawthorn | |
| heather | |
| hyssop | |
| lavender | |
| licorice black licorice | |
| loganberry dewberry | |
| lychee soapberry | |
| maple | |
| mint | |
| molasses | |
| moss | |
| natural | |
| passion blossom | |
| passion fruit | |
| peach | |
| pennyroyal | |
| peppermint | |
| phlox | |
| pina colada | |
| plum | |
| plum jam | |
| pomegranate | |
| snakeroot | |
| spearmint | |
| spice | |
| stephanotis | |
| stock evening scented stock | |
| sweet pea pois de senteur | |
| tarragon | |
| tropical | |
| tuberose tubereuse | |
| windsor soap | |
| wintergreen | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| artemisa fergamensis | |
| bergamot | |
| cassis | |
| chamomile moroccan wild. | |
| clove oil | |
| eucalyptus globulus | |
| ginger grass | |
| grapefruit | |
| juniperberry | |
| lavender | |
| lemon | |
| mandarin | |
| marjorum | |
| mentha cardiaca (scotch spearmint) 55-70% | |
| mentha longifolia | |
| mentha spicata (garden mint) 55-75% | |
| mentha viridis (common spearmint) 55-60% | |
| orange | |
| tagetes | |